diff --git a/apps/documenteditor/main/locale/en.json b/apps/documenteditor/main/locale/en.json index e2cc30cfb..0d7f3b2a2 100644 --- a/apps/documenteditor/main/locale/en.json +++ b/apps/documenteditor/main/locale/en.json @@ -1014,6 +1014,7 @@ "DE.Views.ImageSettingsAdvanced.textWrapThroughTooltip": "Through", "DE.Views.ImageSettingsAdvanced.textWrapTightTooltip": "Tight", "DE.Views.ImageSettingsAdvanced.textWrapTopbottomTooltip": "Top and Bottom", + "DE.Views.ImageSettingsAdvanced.textPositionPc": "Relative position", "DE.Views.LeftMenu.tipAbout": "About", "DE.Views.LeftMenu.tipChat": "Chat", "DE.Views.LeftMenu.tipComments": "Comments", @@ -1355,6 +1356,9 @@ "DE.Views.TableSettingsAdvanced.tipTableOuterCellInner": "Set Outer Border and Vertical and Horizontal Lines for Inner Cells", "DE.Views.TableSettingsAdvanced.tipTableOuterCellOuter": "Set Table Outer Border and Outer Borders for Inner Cells", "DE.Views.TableSettingsAdvanced.txtNoBorders": "No borders", + "DE.Views.TableSettingsAdvanced.txtPercent": "Percent", + "DE.Views.TableSettingsAdvanced.txtCm": "Centimeter", + "DE.Views.TableSettingsAdvanced.txtPt": "Point", "DE.Views.TextArtSettings.strColor": "Color", "DE.Views.TextArtSettings.strFill": "Fill", "DE.Views.TextArtSettings.strSize": "Size", diff --git a/sdk/Common/Images/marker_format.cur b/sdk/Common/Images/marker_format.cur new file mode 100644 index 000000000..d89700010 Binary files /dev/null and b/sdk/Common/Images/marker_format.cur differ diff --git a/sdk/Common/Images/plus.cur b/sdk/Common/Images/plus.cur new file mode 100644 index 000000000..efb46a04c Binary files /dev/null and b/sdk/Common/Images/plus.cur differ diff --git a/sdk/Common/Images/plus_2x.cur b/sdk/Common/Images/plus_2x.cur new file mode 100644 index 000000000..090170053 Binary files /dev/null and b/sdk/Common/Images/plus_2x.cur differ diff --git a/sdk/Common/Images/plus_copy.cur b/sdk/Common/Images/plus_copy.cur new file mode 100644 index 000000000..b9ded58df Binary files /dev/null and b/sdk/Common/Images/plus_copy.cur differ diff --git a/sdk/Common/Images/plus_copy_2x.cur b/sdk/Common/Images/plus_copy_2x.cur new file mode 100644 index 000000000..9f31f6f57 Binary files /dev/null and b/sdk/Common/Images/plus_copy_2x.cur differ diff --git a/sdk/Common/Images/text_copy.cur b/sdk/Common/Images/text_copy.cur new file mode 100644 index 000000000..ebe0c90c2 Binary files /dev/null and b/sdk/Common/Images/text_copy.cur differ diff --git a/sdk/Common/Images/text_copy_2x.cur b/sdk/Common/Images/text_copy_2x.cur new file mode 100644 index 000000000..25d47fc4b Binary files /dev/null and b/sdk/Common/Images/text_copy_2x.cur differ diff --git a/sdk/Common/Native/jquery_native.js b/sdk/Common/Native/jquery_native.js new file mode 100644 index 000000000..ed890e509 --- /dev/null +++ b/sdk/Common/Native/jquery_native.js @@ -0,0 +1,8998 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + return jQuery.makeArray( _null_object, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.7.1", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.add( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.fireWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).off( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery.Callbacks( "once memory" ); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array, i ) { + var len; + + if ( array ) { + if ( indexOf ) { + return indexOf.call( array, elem, i ); + } + + len = array.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in array && array[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return ( new Date() ).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +// String to Object flags format cache +var flagsCache = {}; + +// Convert String-formatted flags into Object-formatted ones and store in cache +function createFlags( flags ) { + var object = flagsCache[ flags ] = {}, + i, length; + flags = flags.split( /\s+/ ); + for ( i = 0, length = flags.length; i < length; i++ ) { + object[ flags[i] ] = true; + } + return object; +} + +/* + * Create a callback list using the following parameters: + * + * flags: an optional list of space-separated flags that will change how + * the callback list behaves + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible flags: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( flags ) { + + // Convert flags from String-formatted to Object-formatted + // (we check in cache first) + flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; + + var // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = [], + // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Add one or several callbacks to the list + add = function( args ) { + var i, + length, + elem, + type, + actual; + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + // Inspect recursively + add( elem ); + } else if ( type === "function" ) { + // Add if not in unique mode and callback is not in + if ( !flags.unique || !self.has( elem ) ) { + list.push( elem ); + } + } + } + }, + // Fire callbacks + fire = function( context, args ) { + args = args || []; + memory = !flags.memory || [ context, args ]; + firing = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { + memory = true; // Mark as halted + break; + } + } + firing = false; + if ( list ) { + if ( !flags.once ) { + if ( stack && stack.length ) { + memory = stack.shift(); + self.fireWith( memory[ 0 ], memory[ 1 ] ); + } + } else if ( memory === true ) { + self.disable(); + } else { + list = []; + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + var length = list.length; + add( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away, unless previous + // firing was halted (stopOnFalse) + } else if ( memory && memory !== true ) { + firingStart = length; + fire( memory[ 0 ], memory[ 1 ] ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + var args = arguments, + argIndex = 0, + argLength = args.length; + for ( ; argIndex < argLength ; argIndex++ ) { + for ( var i = 0; i < list.length; i++ ) { + if ( args[ argIndex ] === list[ i ] ) { + // Handle firingIndex and firingLength + if ( firing ) { + if ( i <= firingLength ) { + firingLength--; + if ( i <= firingIndex ) { + firingIndex--; + } + } + } + // Remove the element + list.splice( i--, 1 ); + // If we have some unicity property then + // we only need to do this once + if ( flags.unique ) { + break; + } + } + } + } + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + if ( list ) { + var i = 0, + length = list.length; + for ( ; i < length; i++ ) { + if ( fn === list[ i ] ) { + return true; + } + } + } + return false; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory || memory === true ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( stack ) { + if ( firing ) { + if ( !flags.once ) { + stack.push( [ context, args ] ); + } + } else if ( !( flags.once && memory ) ) { + fire( context, args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!memory; + } + }; + + return self; +}; + + + + +var // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + + Deferred: function( func ) { + var doneList = jQuery.Callbacks( "once memory" ), + failList = jQuery.Callbacks( "once memory" ), + progressList = jQuery.Callbacks( "memory" ), + state = "pending", + lists = { + resolve: doneList, + reject: failList, + notify: progressList + }, + promise = { + done: doneList.add, + fail: failList.add, + progress: progressList.add, + + state: function() { + return state; + }, + + // Deprecated + isResolved: doneList.fired, + isRejected: failList.fired, + + then: function( doneCallbacks, failCallbacks, progressCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); + return this; + }, + always: function() { + deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); + return this; + }, + pipe: function( fnDone, fnFail, fnProgress ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ], + progress: [ fnProgress, "notify" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + obj = promise; + } else { + for ( var key in promise ) { + obj[ key ] = promise[ key ]; + } + } + return obj; + } + }, + deferred = promise.promise({}), + key; + + for ( key in lists ) { + deferred[ key ] = lists[ key ].fire; + deferred[ key + "With" ] = lists[ key ].fireWith; + } + + // Handle state + deferred.done( function() { + state = "resolved"; + }, failList.disable, progressList.lock ).fail( function() { + state = "rejected"; + }, doneList.disable, progressList.lock ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = sliceDeferred.call( arguments, 0 ), + i = 0, + length = args.length, + pValues = new Array( length ), + count = length, + pCount = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(), + promise = deferred.promise(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + deferred.resolveWith( deferred, args ); + } + }; + } + function progressFunc( i ) { + return function( value ) { + pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + deferred.notifyWith( promise, pValues ); + }; + } + if ( length > 1 ) { + for ( ; i < length; i++ ) { + if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return promise; + } +}); + + + + +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + marginDiv, + fragment, + tds, + events, + eventName, + i, + isSupported, + div = document.createElement( "div" ), + documentElement = document.documentElement; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = "
a"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( window.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.style.width = "2px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + fragment.removeChild( div ); + + // Null elements to avoid leaks in IE + fragment = select = opt = marginDiv = div = input = null; + + // Run tests that need a body at doc ready + jQuery(function() { + var container, outer, inner, table, td, offsetSupport, + conMarginTop, ptlm, vb, style, html, + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + conMarginTop = 1; + ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;"; + vb = "visibility:hidden;border:0;"; + style = "style='" + ptlm + "border:5px solid #000;padding:0;'"; + html = "
" + + "" + + "
"; + + container = document.createElement("div"); + container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
t
"; + tds = div.getElementsByTagName( "td" ); + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Figure out if the W3C box model works as expected + div.innerHTML = ""; + div.style.width = div.style.paddingLeft = "1px"; + jQuery.boxModel = support.boxModel = div.offsetWidth === 2; + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "
"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.style.cssText = ptlm + vb; + div.innerHTML = html; + + outer = div.firstChild; + inner = outer.firstChild; + td = outer.nextSibling.firstChild.firstChild; + + offsetSupport = { + doesNotAddBorder: ( inner.offsetTop !== 5 ), + doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) + }; + + inner.style.position = "fixed"; + inner.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); + inner.style.position = inner.style.top = ""; + + outer.style.overflow = "hidden"; + outer.style.position = "relative"; + + offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); + offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); + + body.removeChild( container ); + div = container = null; + + jQuery.extend( support, offsetSupport ); + }); + + return support; +})(); + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var privateCache, thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey, + isEvents = name === "events"; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = ++jQuery.uuid; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + privateCache = thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Users should not attempt to inspect the internal events object using jQuery.data, + // it is undocumented and subject to change. But does anyone listen? No. + if ( isEvents && !thisCache[ name ] ) { + return privateCache.events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ internalKey ] : internalKey; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split( " " ); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the cache and need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ internalKey ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + } else { + elem[ internalKey ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, attr, name, + data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) { + attr = this[0].attributes; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + jQuery._data( this[0], "parsedAttrs", true ); + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var self = jQuery( this ), + args = [ parts[0], value ]; + + self.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + jQuery.isNumeric( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery._data( elem, deferDataKey ); + if ( defer && + ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && + ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery._data( elem, queueDataKey ) && + !jQuery._data( elem, markDataKey ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.fire(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = ( type || "fx" ) + "mark"; + jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); + if ( count ) { + jQuery._data( elem, key, count ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + var q; + if ( elem ) { + type = ( type || "fx" ) + "queue"; + q = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = {}; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + jQuery._data( elem, type + ".run", hooks ); + fn.call( elem, function() { + jQuery.dequeue( elem, type ); + }, hooks ); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue " + type + ".run", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { + count++; + tmp.add( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute, + nodeHook, boolHook, fixSpecified; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = ( value || "" ).split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, l, + i = 0; + + if ( value && elem.nodeType === 1 ) { + attrNames = value.toLowerCase().split( rspace ); + l = attrNames.length; + + for ( ; i < l; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + + // See #9699 for explanation of this approach (setting first, then removal) + jQuery.attr( elem, name, "" ); + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) +jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.nodeValue = value + "" ); + } + }; + + // Apply the nodeHook to tabindex + jQuery.attrHooks.tabindex.set = nodeHook.set; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + + + + +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, + rhoverHack = /\bhover(\.\S+)?\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, + quickParse = function( selector ) { + var quick = rquickIs.exec( selector ); + if ( quick ) { + // 0 1 2 3 + // [ _, tag, id, class ] + quick[1] = ( quick[1] || "" ).toLowerCase(); + quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); + } + return quick; + }, + quickIs = function( elem, m ) { + var attrs = elem.attributes || {}; + return ( + (!m[1] || elem.nodeName.toLowerCase() === m[1]) && + (!m[2] || (attrs.id || {}).value === m[2]) && + (!m[3] || m[3].test( (attrs[ "class" ] || {}).value )) + ); + }, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, quick, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + quick: quickParse( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + t, tns, type, origType, namespaces, origCount, + j, events, special, handle, eventType, handleObj; + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, [ "events", "handle" ], true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var type = event.type || event, + namespaces = [], + cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + old = null; + for ( ; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old && old === elem.ownerDocument ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments, 0 ), + run_all = !event.exclusive && !event.namespace, + handlerQueue = [], + i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Determine handlers that should run if there are delegated events + // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) { + + // Pregenerate a single jQuery object for reuse with .is() + jqcur = jQuery(this); + jqcur.context = this.ownerDocument || this; + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + selMatch = {}; + matches = []; + jqcur[0] = cur; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = ( + handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel ) + ); + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) + if ( event.metaKey === undefined ) { + event.metaKey = event.ctrlKey; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector, + ret; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !form._submit_attached ) { + jQuery.event.add( form, "submit._submit", function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + }); + form._submit_attached = true; + } + }); + // return undefined since we don't need an event listener + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + jQuery.event.simulate( "change", this, event, true ); + } + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + elem._change_attached = true; + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + // ( types-Object, data ) + data = selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on.call( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + var handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( var type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + expando = "sizcache" + (Math.random() + '').replace('.', ''), + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rReturn = /\r\n/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context, seed ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set, seed ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set, i, len, match, type, left; + + if ( !expr ) { + return []; + } + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + type, found, item, filter, left, + i, pass, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + filter = Expr.filter[ type ]; + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + pass = not ^ found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Utility function for retreiving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var i, node, + nodeType = elem.nodeType, + ret = ""; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 ) { + // Use textContent || innerText for elements + if ( typeof elem.textContent === 'string' ) { + return elem.textContent; + } else if ( typeof elem.innerText === 'string' ) { + // Replace IE's carriage returns + return elem.innerText.replace( rReturn, '' ); + } else { + // Traverse it's children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + } else { + + // If no nodeType, this is expected to be an array + for ( i = 0; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + if ( node.nodeType !== 8 ) { + ret += getText( node ); + } + } + } + return ret; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var first, last, + doneName, parent, cache, + count, diff, + type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + first = match[2]; + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + doneName = match[0]; + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { + count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent[ expando ] = doneName; + } + + diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Sizzle.attr ? + Sizzle.attr( elem, name ) : + Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + !type && Sizzle.attr ? + result != null : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = ""; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = ""; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "

"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "
"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context, seed ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet, seed ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +Sizzle.selectors.attrMap = {}; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + POS.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array (deprecated as of jQuery 1.7) + if ( jQuery.isArray( selectors ) ) { + var level = 1; + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( i = 0; i < selectors.length; i++ ) { + + if ( jQuery( cur ).is( selectors[ i ] ) ) { + ret.push({ selector: selectors[ i ], elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} + + + + +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /", "" ], + legend: [ 1, "
", "
" ], + thead: [ 1, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + col: [ 2, "", "
" ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize and + + + + + + + + + + + + + + +
Spreadsheets |
+ +
+ + + + + + + + + search by row + search forward + + + + + + +
+
info
+ +
+ +
+ +
+
+
+ + +
+
+ +
+
–
+ +
+
+
+
+ + + diff --git a/sdk/Excel/api.js b/sdk/Excel/api.js new file mode 100644 index 000000000..66784dcfa --- /dev/null +++ b/sdk/Excel/api.js @@ -0,0 +1,3462 @@ +"use strict"; + +var editor; +(/** + * @param {jQuery} $ + * @param {Window} window + * @param {undefined} undefined + */ + function($, window, undefined) { + + var asc = window["Asc"]; + var asc_applyFunction = asc.applyFunction; + var asc_CCollaborativeEditing = asc.CCollaborativeEditing; + var asc_CAdjustPrint = asc.asc_CAdjustPrint; + var prot; + + + /** + * + * @param name + * @param inputName + * @param eventsHandlers + * @constructor + * @returns {spreadsheet_api} + * @extends {baseEditorsApi} + */ + function spreadsheet_api(name, inputName, eventsHandlers) { + spreadsheet_api.superclass.constructor.call(this, name); + this.editorId = c_oEditorId.Spreadsheet; + + /************ private!!! **************/ + this.topLineEditorName = inputName; + this.topLineEditorElement = null; + + this.controller = new asc.asc_CEventsController(); + + this.handlers = new asc.asc_CHandlersList(eventsHandlers); + // Вид печати + this.adjustPrint = null; + + this.fontRenderingMode = c_oAscFontRenderingModeType.hintingAndSubpixeling; + this.wb = null; + this.wbModel = null; + + this.documentFormatSave = c_oAscFileType.XLSX; + + // объекты, нужные для отправки в тулбар (шрифты, стили) + this._gui_control_colors = null; + this._gui_color_schemes = null; + this.GuiControlColorsMap = null; + this.IsSendStandartColors = false; + + this.asyncMethodCallback = undefined; + + // Переменная отвечает, загрузились ли фонты + this.FontLoadWaitComplete = false; + // Переменная отвечает, отрисовали ли мы все (иначе при рестарте, получится переинициализация) + this.DocumentLoadComplete = false; + // Переменная, которая отвечает, послали ли мы окончание открытия документа + this.IsSendDocumentLoadCompleate = false; + //текущий обьект куда записываются информация для update, когда принимаются изменения в native редакторе + this.oRedoObjectParamNative = null; + + this.collaborativeEditing = null; + + // AutoSave + this.lastSaveTime = null; // Время последнего сохранения + this.autoSaveGapRealTime = 30; // Интервал быстрого автосохранения (когда выставлен флаг realtime) - 30 мс. + this.autoSaveGapFast = 2000; // Интервал быстрого автосохранения (когда человек один) - 2 сек. + this.autoSaveGapSlow = 10 * 60 * 1000; // Интервал медленного автосохранения (когда совместно) - 10 минут + + // Shapes + this.isStartAddShape = false; + this.shapeElementId = null; + this.textArtElementId = null; + this.isImageChangeUrl = false; + this.isShapeImageChangeUrl = false; + this.isTextArtChangeUrl = false; + + //находится ли фокус в рабочей области редактора(используется для copy/paste в MAC) + // ToDo убрать, когда Гоша поправит clipboard.js + this.IsFocus = null; + + this.formulasList = null; // Список всех формул + + this._init(); + return this; + } + asc.extendClass(spreadsheet_api, baseEditorsApi); + + spreadsheet_api.prototype.sendEvent = function() { + this.handlers.trigger.apply(this.handlers, arguments); + }; + + spreadsheet_api.prototype._init = function() { + this.topLineEditorElement = document.getElementById(this.topLineEditorName); + this.formulasList = getFormulasInfo(); + // ToDo нужно ли это + asc['editor'] = ( asc['editor'] || this ); + AscBrowser.checkZoom(); + }; + + spreadsheet_api.prototype.asc_CheckGuiControlColors = function() { + // потом реализовать проверку на то, что нужно ли посылать + + var arr_colors = new Array(10); + var _count = arr_colors.length; + for (var i = 0; i < _count; ++i) { + var color = g_oColorManager.getThemeColor(i); + arr_colors[i] = new CColor(color.getR(), color.getG(), color.getB()); + } + + // теперь проверим + var bIsSend = false; + if (this.GuiControlColorsMap != null) { + for (var i = 0; i < _count; ++i) { + var _color1 = this.GuiControlColorsMap[i]; + var _color2 = arr_colors[i]; + + if ((_color1.r !== _color2.r) || (_color1.g !== _color2.g) || (_color1.b !== _color2.b)) { + bIsSend = true; + break; + } + } + } else { + this.GuiControlColorsMap = new Array(_count); + bIsSend = true; + } + + if (bIsSend) { + for (var i = 0; i < _count; ++i) { + this.GuiControlColorsMap[i] = arr_colors[i]; + } + + this.asc_SendControlColors(); + } + }; + + spreadsheet_api.prototype.asc_SendControlColors = function() { + var standart_colors = null; + if (!this.IsSendStandartColors) { + var _c_s = g_oStandartColors.length; + standart_colors = new Array(_c_s); + + for (var i = 0; i < _c_s; ++i) { + standart_colors[i] = new CColor(g_oStandartColors[i]["R"], g_oStandartColors[i]["G"], g_oStandartColors[i]["B"]); + } + + this.IsSendStandartColors = true; + } + + var _count = this.GuiControlColorsMap.length; + + var _ret_array = new Array(_count * 6); + var _cur_index = 0; + + for (var i = 0; i < _count; ++i) { + var basecolor = g_oColorManager.getThemeColor(i); + var aTints = g_oThemeColorsDefaultModsSpreadsheet[GetDefaultColorModsIndex(basecolor.getR(), basecolor.getG(), basecolor.getB())]; + for (var j = 0, length = aTints.length; j < length; ++j) { + var tint = aTints[j]; + var color = g_oColorManager.getThemeColor(i, tint); + _ret_array[_cur_index] = new CColor(color.getR(), color.getG(), color.getB()); + _cur_index++; + } + } + + this.asc_SendThemeColors(_ret_array, standart_colors); + }; + + spreadsheet_api.prototype.asc_SendThemeColorScheme = function() { + var infos = []; + var _index = 0; + + var _c = null; + + // user scheme + var _count_defaults = g_oUserColorScheme.length; + for (var i = 0; i < _count_defaults; ++i) { + var _obj = g_oUserColorScheme[i]; + infos[_index] = new CAscColorScheme(); + infos[_index].Name = _obj["name"]; + + _c = _obj["dk1"]; + infos[_index].Colors[0] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["lt1"]; + infos[_index].Colors[1] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["dk2"]; + infos[_index].Colors[2] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["lt2"]; + infos[_index].Colors[3] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent1"]; + infos[_index].Colors[4] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent2"]; + infos[_index].Colors[5] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent3"]; + infos[_index].Colors[6] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent4"]; + infos[_index].Colors[7] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent5"]; + infos[_index].Colors[8] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent6"]; + infos[_index].Colors[9] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["hlink"]; + infos[_index].Colors[10] = new CColor(_c["R"], _c["G"], _c["B"]); + + _c = _obj["folHlink"]; + infos[_index].Colors[11] = new CColor(_c["R"], _c["G"], _c["B"]); + + ++_index; + } + + // theme colors + var _theme = this.wbModel.theme; + var _extra = _theme.extraClrSchemeLst; + var _count = _extra.length; + var _rgba = {R: 0, G: 0, B: 0, A: 255}; + for (var i = 0; i < _count; ++i) { + var _scheme = _extra[i].clrScheme; + + infos[_index] = new CAscColorScheme(); + infos[_index].Name = _scheme.name; + + _scheme.colors[8].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[8].RGBA; + infos[_index].Colors[0] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[12].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[12].RGBA; + infos[_index].Colors[1] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[9].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[9].RGBA; + infos[_index].Colors[2] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[13].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[13].RGBA; + infos[_index].Colors[3] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[0].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[0].RGBA; + infos[_index].Colors[4] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[1].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[1].RGBA; + infos[_index].Colors[5] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[2].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[2].RGBA; + infos[_index].Colors[6] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[3].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[3].RGBA; + infos[_index].Colors[7] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[4].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[4].RGBA; + infos[_index].Colors[8] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[5].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[5].RGBA; + infos[_index].Colors[9] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[11].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[11].RGBA; + infos[_index].Colors[10] = new CColor(_c.R, _c.G, _c.B); + + _scheme.colors[10].Calculate(_theme, null, null, null, _rgba); + _c = _scheme.colors[10].RGBA; + infos[_index].Colors[11] = new CColor(_c.R, _c.G, _c.B); + + _index++; + } + + this.asc_SendThemeColorSchemes(infos); + }; + + spreadsheet_api.prototype.asc_getLocaleExample = function(val, number, date) { + var res = ''; + var cultureInfo = g_aCultureInfos[val]; + if (cultureInfo) { + var numFormatDigit = oNumFormatCache.get('#,##0.00'); + + var dateElems = []; + for (var i = 0; i < cultureInfo.ShortDatePattern.length; ++i) { + switch (cultureInfo.ShortDatePattern[i]) { + case '0': + dateElems.push('d'); + break; + case '1': + dateElems.push('m'); + break; + case '2': + dateElems.push('yyyy'); + break; + } + } + var formatDate = dateElems.join('/'); + formatDate += " h:mm"; + if (cultureInfo.AMDesignator && cultureInfo.PMDesignator) { + formatDate += " AM/PM"; + } + var numFormatDate = oNumFormatCache.get(formatDate); + + res += numFormatDigit.formatToChart(number, cultureInfo); + res += '; '; + res += numFormatDate.formatToChart(date.getExcelDateWithTime(), cultureInfo); + } + return res; + }; + spreadsheet_api.prototype.asc_getLocaleCurrency = function(val) { + var res = ''; + var cultureInfo = g_aCultureInfos[val]; + if (!cultureInfo) { + cultureInfo = g_aCultureInfos[1033]; + } + var prefixs = ['_ ', '_-', '_(', '_)']; + var prefix = prefixs[0]; + var postfix = prefixs[0]; + var numberFormat = '#,##0.00'; + var nullSignFormat = '* "-"??'; + var positiveNumberFormat = '* ' + numberFormat; + var signCurrencyFormat = '[$' + cultureInfo.CurrencySymbol + '-' + cultureInfo.LCID.toString(16).toUpperCase() + ']'; + var positiveFormat; + var negativeFormat; + var nullFormat; + switch (cultureInfo.CurrencyNegativePattern) { + case 0: + prefix = prefixs[2]; + postfix = prefixs[3]; + negativeFormat = prefix + signCurrencyFormat + '* \\(' + numberFormat + '\\)'; + break; + case 1: + prefix = postfix = prefixs[1]; + negativeFormat = '\\-' + signCurrencyFormat + '* ' + numberFormat + postfix; + break; + case 2: + negativeFormat = prefix + signCurrencyFormat + '\\ * \\-' + numberFormat + postfix; + break; + case 3: + prefix = postfix = prefixs[1]; + negativeFormat = prefix + signCurrencyFormat + '\\ * ' + numberFormat + '\\-'; + break; + case 4: + prefix = prefixs[2]; + postfix = prefixs[3]; + negativeFormat = prefix + '* \\(' + numberFormat + '\\)' + signCurrencyFormat + postfix; + break; + case 5: + prefix = postfix = prefixs[1]; + negativeFormat = '\\-* ' + numberFormat + signCurrencyFormat + postfix; + break; + case 6: + negativeFormat = prefix + '* ' + numberFormat + '\\-' + signCurrencyFormat + postfix; + break; + case 7: + negativeFormat = prefix + '* ' + numberFormat + signCurrencyFormat + '\\-'; + break; + case 8: + prefix = postfix = prefixs[1]; + negativeFormat = '\\-* ' + numberFormat + '\\ ' + signCurrencyFormat + postfix; + break; + case 9: + prefix = postfix = prefixs[1]; + negativeFormat = '\\-' + signCurrencyFormat + '\\ * ' + numberFormat + postfix; + break; + case 10: + negativeFormat = prefix + '* ' + numberFormat + '\\ ' + signCurrencyFormat + '\\-'; + break; + case 11: + negativeFormat = prefix + signCurrencyFormat + '\\ * ' + numberFormat + '\\-'; + break; + case 12: + negativeFormat = prefix + signCurrencyFormat + '\\ * \\-' + numberFormat + postfix; + break; + case 13: + negativeFormat = prefix + '* ' + numberFormat + '\\-\\ ' + signCurrencyFormat + postfix; + break; + case 14: + prefix = prefixs[2]; + postfix = prefixs[3]; + negativeFormat = prefix + signCurrencyFormat + '\\ * \\(' + numberFormat + '\\)'; + break; + case 15: + prefix = prefixs[2]; + postfix = prefixs[3]; + negativeFormat = prefix + '* \\(' + numberFormat + '\\)\\ ' + signCurrencyFormat + postfix; + break; + } + switch (cultureInfo.CurrencyPositivePattern) { + case 0: + positiveFormat = signCurrencyFormat + positiveNumberFormat; + nullFormat = signCurrencyFormat + nullSignFormat; + break; + case 1: + positiveFormat = positiveNumberFormat + signCurrencyFormat; + nullFormat = nullSignFormat + signCurrencyFormat; + break; + case 2: + positiveFormat = signCurrencyFormat + '\\ ' + positiveNumberFormat; + nullFormat = signCurrencyFormat + '\\ ' + nullSignFormat; + break; + case 3: + positiveFormat = positiveNumberFormat + '\\ ' + signCurrencyFormat; + nullFormat = nullSignFormat + '\\ ' + signCurrencyFormat; + break; + } + positiveFormat = prefix + positiveFormat + postfix; + nullFormat = prefix + nullFormat + postfix; + var textFormat = prefix + '@' + postfix; + return positiveFormat + ';' + negativeFormat + ';' + nullFormat + ';' + textFormat; + }; + spreadsheet_api.prototype.asc_setLocale = function(val) { + g_oDefaultCultureInfo = g_aCultureInfos[val]; + parserHelp.setDigitSeparator( g_oDefaultCultureInfo.NumberDecimalSeparator ); + if (this.wbModel) { + oGeneralEditFormatCache.cleanCache(); + oNumFormatCache.cleanCache(); + this.wbModel.rebuildColors(); + if (this.IsSendDocumentLoadCompleate) { + this._onUpdateAfterApplyChanges(); + } + } + }; + + spreadsheet_api.prototype.asc_LoadEmptyDocument = function() { + this.CoAuthoringApi.auth(this.getViewMode()); + + var emptyWorkbook = getEmptyWorkbook() + ""; + if (emptyWorkbook.length && (Asc.c_oSerFormat.Signature === emptyWorkbook.substring(0, Asc.c_oSerFormat.Signature.length))) { + this.isChartEditor = true; + this._startOpenDocument(emptyWorkbook); + } + }; + + spreadsheet_api.prototype._openDocument = function(data) { + var wb = new Workbook(this.handlers, this); + this.initGlobalObjects(wb); + this.wbModel = wb; + var oBinaryFileReader = new Asc.BinaryFileReader(); + oBinaryFileReader.Read(data, wb); + g_oIdCounter.Set_Load(false); + return wb; + }; + + spreadsheet_api.prototype.initGlobalObjects = function(wbModel) { + // History & global counters + History = new CHistory(wbModel); + + g_oTableId = new CTableId(); + g_oUndoRedoCell = new UndoRedoCell(wbModel); + g_oUndoRedoWorksheet = new UndoRedoWoorksheet(wbModel); + g_oUndoRedoWorkbook = new UndoRedoWorkbook(wbModel); + g_oUndoRedoCol = new UndoRedoRowCol(wbModel, false); + g_oUndoRedoRow = new UndoRedoRowCol(wbModel, true); + g_oUndoRedoComment = new UndoRedoComment(wbModel); + g_oUndoRedoAutoFilters = new UndoRedoAutoFilters(wbModel); + }; + + spreadsheet_api.prototype.asc_DownloadAs = function(typeFile, bIsDownloadEvent) {//передаем число соответствующее своему формату. например c_oAscFileType.XLSX + if (!this.canSave || this.isChartEditor || c_oAscAdvancedOptionsAction.None !== this.advancedOptionsAction) { + return; + } + + if (c_oAscFileType.PDF === typeFile) { + this.adjustPrint = new asc_CAdjustPrint(); + } + this._asc_downloadAs(typeFile, c_oAscAsyncAction.DownloadAs, {downloadType: bIsDownloadEvent ? DownloadType.Download: DownloadType.None}); + }; + + spreadsheet_api.prototype.asc_Save = function(isAutoSave) { + if (!this.canSave || this.isChartEditor || c_oAscAdvancedOptionsAction.None !== this.advancedOptionsAction || this.isLongAction()) { + return; + } + + this.IsUserSave = !isAutoSave; + if (this.IsUserSave) { + this.sync_StartAction(c_oAscAsyncActionType.Information, c_oAscAsyncAction.Save); + } + /* Нужно закрыть редактор (до выставления флага canSave, т.к. мы должны успеть отправить + asc_onDocumentModifiedChanged для подписки на сборку) Баг http://bugzserver/show_bug.cgi?id=28331 */ + this.asc_closeCellEditor(); + + // Не даем пользователю сохранять, пока не закончится сохранение + this.canSave = false; + + var t = this; + this.CoAuthoringApi.askSaveChanges(function(e) { + t.onSaveCallback(e); + }); + }; + + spreadsheet_api.prototype.asc_Print = function(adjustPrint, bIsDownloadEvent) { + if (window["AscDesktopEditor"]) { + window.AscDesktopEditor_PrintData = adjustPrint; + window["AscDesktopEditor"]["Print"](); + return; + } + + this.adjustPrint = adjustPrint ? adjustPrint : new asc_CAdjustPrint(); + this._asc_downloadAs(c_oAscFileType.PDF, c_oAscAsyncAction.Print, {downloadType: bIsDownloadEvent ? DownloadType.Print: DownloadType.None}); + }; + + spreadsheet_api.prototype.asc_Copy = function() { + if (window["AscDesktopEditor"]) { + + var _e = {}; + _e.ctrlKey = true; + _e.shiftKey = false; + _e.which = 67; + + window["AscDesktopEditorButtonMode"] = true; + + if (!this.asc_getCellEditMode()) + this.controller._onWindowKeyDown(_e); + else + this.wb.cellEditor._onWindowKeyDown(_e); + + window["AscDesktopEditorButtonMode"] = false; + + return; + } + + var result = this.wb.copyToClipboardButton(); + this.wb.restoreFocus(); + return result; + }; + + spreadsheet_api.prototype.asc_Paste = function() { + if (window["AscDesktopEditor"]) { + + var _e = {}; + _e.ctrlKey = true; + _e.shiftKey = false; + _e.which = 86; + + window["AscDesktopEditorButtonMode"] = true; + + if (!this.asc_getCellEditMode()) + this.controller._onWindowKeyDown(_e); + else + this.wb.cellEditor._onWindowKeyDown(_e); + + window["AscDesktopEditorButtonMode"] = false; + + return; + } + + var result = this.wb.pasteFromClipboardButton(); + this.wb.restoreFocus(); + return result; + }; + + spreadsheet_api.prototype.asc_Cut = function() { + if (window["AscDesktopEditor"]) { + + var _e = {}; + _e.ctrlKey = true; + _e.shiftKey = false; + _e.which = 88; + + window["AscDesktopEditorButtonMode"] = true; + + if (!this.asc_getCellEditMode()) + this.controller._onWindowKeyDown(_e); + else + this.wb.cellEditor._onWindowKeyDown(_e); + + window["AscDesktopEditorButtonMode"] = false; + + return; + } + + var result = this.wb.cutToClipboardButton(); + this.wb.restoreFocus(); + return result; + }; + + spreadsheet_api.prototype.asc_CheckCopy = function(_clipboard /* CClipboardData */, _formats) + { + var result = this.wb.checkCopyToClipboard(_clipboard, _formats); + return result; + }; + + spreadsheet_api.prototype.asc_bIsEmptyClipboard = function() { + var result = this.wb.bIsEmptyClipboard(); + this.wb.restoreFocus(); + return result; + }; + + spreadsheet_api.prototype.asc_Undo = function() { + this.wb.undo(); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_Redo = function() { + this.wb.redo(); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_Resize = function() { + if (this.wb) { + this.wb.resize(); + } + }; + + spreadsheet_api.prototype.asc_addAutoFilter = function(styleName, addFormatTableOptionsObj) { + var ws = this.wb.getWorksheet(); + return ws.addAutoFilter(styleName, addFormatTableOptionsObj); + }; + + spreadsheet_api.prototype.asc_changeAutoFilter = function(tableName, optionType, val) { + var ws = this.wb.getWorksheet(); + return ws.changeAutoFilter(tableName, optionType, val); + }; + + spreadsheet_api.prototype.asc_applyAutoFilter = function(type, autoFilterObject) { + var ws = this.wb.getWorksheet(); + ws.applyAutoFilter(type, autoFilterObject); + }; + + spreadsheet_api.prototype.asc_sortColFilter = function(type, cellId, displayName) { + var ws = this.wb.getWorksheet(); + ws.sortColFilter(type, cellId, displayName); + }; + + spreadsheet_api.prototype.asc_getAddFormatTableOptions = function(range) { + var ws = this.wb.getWorksheet(); + return ws.getAddFormatTableOptions(range); + }; + + spreadsheet_api.prototype.asc_clearFilter = function() { + var ws = this.wb.getWorksheet(); + return ws.clearFilter(); + }; + + spreadsheet_api.prototype.asc_setMobileVersion = function(isMobile) { + this.isMobileVersion = isMobile; + AscBrowser.isMobileVersion = isMobile; + }; + + spreadsheet_api.prototype.getViewMode = function() { + return this.controller.getViewerMode(); + }; + + spreadsheet_api.prototype.asc_setViewMode = function(isViewerMode) { + this.controller.setViewerMode(isViewerMode); + if (this.collaborativeEditing) { + this.collaborativeEditing.setViewerMode(isViewerMode); + } + + if (false === isViewerMode) { + // Загружаем не обрезанные шрифты для полной версии (при редактировании) + if (this.FontLoader.embedded_cut_manager.bIsCutFontsUse) { + this.FontLoader.embedded_cut_manager.bIsCutFontsUse = false; + this.asyncMethodCallback = undefined; + this.FontLoader.LoadDocumentFonts(this.wbModel.generateFontMap2()); + } + + this.isUseEmbeddedCutFonts = false; + + // Отправка стилей + this._sendWorkbookStyles(); + if (this.wb) { + this.wb._initCommentsToSave(); + } + + if (this.IsSendDocumentLoadCompleate && this.collaborativeEditing) { + // Принимаем чужие изменения + this.collaborativeEditing.applyChanges(); + // Пересылаем свои изменения + this.collaborativeEditing.sendChanges(); + } + } + }; + + spreadsheet_api.prototype.asc_setUseEmbeddedCutFonts = function(bUse) { + this.isUseEmbeddedCutFonts = bUse; + }; + + /* + idOption идентификатор дополнительного параметра, пока c_oAscAdvancedOptionsID.CSV. + option - какие свойства применить, пока массив. для CSV объект asc_CCSVAdvancedOptions(codepage, delimiter) + exp: asc_setAdvancedOptions(c_oAscAdvancedOptionsID.CSV, new Asc.asc_CCSVAdvancedOptions(1200, c_oAscCsvDelimiter.Comma) ); + */ + spreadsheet_api.prototype.asc_setAdvancedOptions = function(idOption, option) { + switch (idOption) { + case c_oAscAdvancedOptionsID.CSV: + // Проверяем тип состояния в данный момент + if (this.advancedOptionsAction === c_oAscAdvancedOptionsAction.Open) { + var v = { + "id": this.documentId, + "userid": this.documentUserId, + "format": this.documentFormat, + "vkey": this.documentVKey, + "editorid": this.editorId, + "c": "reopen", + "url": this.documentUrl, + "title": this.documentTitle, + "embeddedfonts": this.isUseEmbeddedCutFonts, + "delimiter": option.asc_getDelimiter(), + "codepage": option.asc_getCodePage()}; + + sendCommand2(this, null, v); + } else if (this.advancedOptionsAction === c_oAscAdvancedOptionsAction.Save) { + var options = {CSVOptions: option, downloadType: this.downloadType}; + this.downloadType = DownloadType.None; + this._asc_downloadAs(c_oAscFileType.CSV, c_oAscAsyncAction.DownloadAs, options); + } + break; + } + }; + // Опции страницы (для печати) + spreadsheet_api.prototype.asc_setPageOptions = function(options, index) { + var sheetIndex = (undefined !== index && null !== index) ? index : this.wbModel.getActive(); + this.wbModel.getWorksheet(sheetIndex).PagePrintOptions = options; + }; + + spreadsheet_api.prototype.asc_getPageOptions = function(index) { + var sheetIndex = (undefined !== index && null !== index) ? index : this.wbModel.getActive(); + return this.wbModel.getWorksheet(sheetIndex).PagePrintOptions; + }; + + spreadsheet_api.prototype._onNeedParams = function(data) { + var t = this; + // Проверяем, возможно нам пришли опции для CSV + if (this.documentOpenOptions) { + var codePageCsv = c_oAscEncodingsMap[this.documentOpenOptions["codePage"]] || c_oAscCodePageUtf8, delimiterCsv = this.documentOpenOptions["delimiter"]; + if (null != codePageCsv && null != delimiterCsv) { + this.asc_setAdvancedOptions(c_oAscAdvancedOptionsID.CSV, new asc.asc_CCSVAdvancedOptions(codePageCsv, delimiterCsv)); + return; + } + } + if (data) { + g_fLoadFileContent(data, function(result) { + if (null === result) { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.Critical); + return; + } + var cp = JSON.parse(result); + cp['encodings'] = getEncodingParams(); + t.handlers.trigger("asc_onAdvancedOptions", new asc.asc_CAdvancedOptions(c_oAscAdvancedOptionsID.CSV, cp), t.advancedOptionsAction); + }); + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + }; + spreadsheet_api.prototype._onOpenCommand = function(data) { + var t = this; + g_fOpenFileCommand(data, this.documentUrlChanges, Asc.c_oSerFormat.Signature, function(error, result) { + if (error || !result.bSerFormat) { + var oError = {returnCode: c_oAscError.Level.Critical, val: c_oAscError.ID.Unknown}; + t.handlers.trigger("asc_onError", oError.val, oError.returnCode); + return; + } + + t._startOpenDocument(result.data); + }); + }; + + spreadsheet_api.prototype._OfflineAppDocumentEndLoad = function() { + var data = getTestWorkbook(); + var sData = data + ""; + if (Asc.c_oSerFormat.Signature === sData.substring(0, Asc.c_oSerFormat.Signature.length)) { + this._startOpenDocument(sData); + } + }; + + spreadsheet_api.prototype._asc_save2 = function() { + var oBinaryFileWriter = new Asc.BinaryFileWriter(this.wbModel); + var dataContainer = {data: null, part: null, index: 0, count: 0}; + dataContainer.data = oBinaryFileWriter.Write(); + var filetype = 0x1002; + var oAdditionalData = {}; + oAdditionalData["c"] = "sfct"; + oAdditionalData["id"] = this.documentId; + oAdditionalData["userid"] = this.documentUserId; + oAdditionalData["vkey"] = this.documentVKey; + oAdditionalData["outputformat"] = filetype; + oAdditionalData["title"] = changeFileExtention(this.documentTitle, getExtentionByFormat(filetype)); + this.wb._initCommentsToSave(); + oAdditionalData["savetype"] = c_oAscSaveTypes.CompleteAll; + var t = this; + t.fCurCallback = function(incomeObject) { + if (null != input && "save" == input["type"]) { + if ('ok' == input["status"]) { + var url = input["data"]; + if (url) { + t.processSavedFile(url, false); + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + } else { + t.handlers.trigger("asc_onError", g_fMapAscServerErrorToAscError(parseInt(input["data"])), c_oAscError.Level.NoCritical); + } + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + }; + g_fSaveWithParts(function(fCallback1, oAdditionalData1, dataContainer1) { + sendCommand2(t, fCallback1, oAdditionalData1, dataContainer1); + }, t.fCurCallback, null, oAdditionalData, dataContainer); + }; + + spreadsheet_api.prototype._asc_downloadAs = function(sFormat, actionType, options) { //fCallback({returnCode:"", ...}) + var t = this; + if (!options) { + options = {}; + } + if (actionType) { + this.sync_StartAction(c_oAscAsyncActionType.BlockInteraction, actionType); + } + // Меняем тип состояния (на сохранение) + this.advancedOptionsAction = c_oAscAdvancedOptionsAction.Save; + + //sFormat: xlsx, xls, ods, csv, html + var dataContainer = {data: null, part: null, index: 0, count: 0}; + var command = "save"; + var oAdditionalData = {}; + oAdditionalData["c"] = command; + oAdditionalData["id"] = this.documentId; + oAdditionalData["userid"] = this.documentUserId; + oAdditionalData["vkey"] = this.documentVKey; + oAdditionalData["outputformat"] = sFormat; + oAdditionalData["title"] = changeFileExtention(this.documentTitle, getExtentionByFormat(sFormat)); + if (c_oAscFileType.PDF === sFormat) { + var printPagesData = this.wb.calcPagesPrint(this.adjustPrint); + var pdf_writer = new CPdfPrinter(); + var isEndPrint = this.wb.printSheet(pdf_writer, printPagesData); + + dataContainer.data = pdf_writer.DocumentRenderer.Memory.GetBase64Memory(); + } else if (c_oAscFileType.CSV === sFormat && !options.CSVOptions) { + // Мы открывали команду, надо ее закрыть. + if (actionType) { + this.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, actionType); + } + var cp = {'delimiter': c_oAscCsvDelimiter.Comma, 'codepage': c_oAscCodePageUtf8, 'encodings': getEncodingParams()}; + this.downloadType = options.downloadType; + this.handlers.trigger("asc_onAdvancedOptions", new asc.asc_CAdvancedOptions(c_oAscAdvancedOptionsID.CSV, cp), this.advancedOptionsAction); + return; + } else { + this.wb._initCommentsToSave(); + var oBinaryFileWriter = new Asc.BinaryFileWriter(this.wbModel); + if (c_oAscFileType.CSV === sFormat) { + if (options.CSVOptions instanceof asc.asc_CCSVAdvancedOptions) { + oAdditionalData["codepage"] = options.CSVOptions.asc_getCodePage(); + oAdditionalData["delimiter"] = options.CSVOptions.asc_getDelimiter(); + } + } + dataContainer.data = oBinaryFileWriter.Write(); + } + var fCallback = function(input) { + var error = c_oAscError.ID.Unknown; + if (null != input && command == input["type"]) { + if ('ok' == input["status"]) { + var url = input["data"]; + if (url) { + error = c_oAscError.ID.No; + t.processSavedFile(url, options.downloadType); + } + } else { + error = g_fMapAscServerErrorToAscError(parseInt(input["data"])); + } + } + if (c_oAscError.ID.No != error) { + t.handlers.trigger("asc_onError", error, c_oAscError.Level.NoCritical); + } + // Меняем тип состояния (на никакое) + t.advancedOptionsAction = c_oAscAdvancedOptionsAction.None; + if (actionType) { + t.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, actionType); + } + }; + t.fCurCallback = fCallback; + g_fSaveWithParts(function(fCallback1, oAdditionalData1, dataContainer1) { + sendCommand2(t, fCallback1, oAdditionalData1, dataContainer1); + }, fCallback, null, oAdditionalData, dataContainer); + }; + + spreadsheet_api.prototype.asc_isDocumentModified = function() { + if (!this.canSave || this.asc_getCellEditMode()) { + // Пока идет сохранение или редактирование ячейки, мы не закрываем документ + return true; + } else if (History && History.Is_Modified) { + return History.Is_Modified(); + } + return false; + }; + + spreadsheet_api.prototype.asc_getCanUndo = function() { + return History.Can_Undo(); + }; + spreadsheet_api.prototype.asc_getCanRedo = function() { + return History.Can_Redo(); + }; + + + // Actions and callbacks interface + + /* + * asc_onStartAction (type, id) + * asc_onEndAction (type, id) + * asc_onInitEditorFonts (gui_fonts) + * asc_onInitEditorStyles (gui_styles) + * asc_onOpenDocumentProgress (COpenProgress) + * asc_onAdvancedOptions (asc_CAdvancedOptions, ascAdvancedOptionsAction) - эвент на получение дополнительных опций (открытие/сохранение CSV) + * asc_onError (c_oAscError.ID, c_oAscError.Level) - эвент об ошибке + * asc_onEditCell (c_oAscCellEditorState) - эвент на редактирование ячейки с состоянием (переходами из формулы и обратно) + * asc_onEditorSelectionChanged (asc_CFont) - эвент на смену информации о выделении в редакторе ячейки + * asc_onSelectionChanged (asc_CCellInfo) - эвент на смену информации о выделении + * asc_onSelectionNameChanged (sName) - эвент на смену имени выделения (Id-ячейки, число выделенных столбцов/строк, имя диаграммы и др.) + * asc_onSelectionMathChanged (asc_CSelectionMathInfo) - эвент на смену математической информации о выделении + * asc_onZoomChanged (zoom) + * asc_onSheetsChanged () - эвент на обновление списка листов + * asc_onActiveSheetChanged (indexActiveSheet) - эвент на обновление активного листа + * asc_onCanUndoChanged (bCanUndo) - эвент на обновление возможности undo + * asc_onCanRedoChanged (bCanRedo) - эвент на обновление возможности redo + * asc_onSaveUrl (sUrl, callback(hasError)) - эвент на сохранение файла на сервер по url + * asc_onDocumentModifiedChanged(bIsModified) - эвент на обновление статуса "изменен ли файл" + * asc_onMouseMove (asc_CMouseMoveData) - эвент на наведение мышкой на гиперлинк или комментарий + * asc_onHyperlinkClick (sUrl) - эвент на нажатие гиперлинка + * asc_onCoAuthoringDisconnect () - эвент об отключении от сервера без попытки reconnect + * asc_onSelectionRangeChanged (selectRange) - эвент о выборе диапазона для диаграммы (после нажатия кнопки выбора) + * asc_onRenameCellTextEnd (countCellsFind, countCellsReplace) - эвент об окончании замены текста в ячейках (мы не можем сразу прислать ответ) + * asc_onWorkbookLocked (result) - эвент залочена ли работа с листами или нет + * asc_onWorksheetLocked (index, result) - эвент залочен ли лист или нет + * asc_onGetEditorPermissions (permission) - эвент о правах редактора + * asc_onStopFormatPainter () - эвент об окончании форматирования по образцу + * asc_onUpdateSheetSettings () - эвент об обновлении свойств листа (закрепленная область, показывать сетку/заголовки) + * asc_onUpdateTabColor (index) - эвент об обновлении цвета иконки листа + * asc_onDocumentCanSaveChanged (bIsCanSave) - эвент об обновлении статуса "можно ли сохранять файл" + * asc_onDocumentUpdateVersion (callback) - эвент о том, что файл собрался и не может больше редактироваться + * asc_onContextMenu (event) - эвент на контекстное меню + * asc_onDocumentContentReady () - эвент об окончании загрузки документа + */ + + spreadsheet_api.prototype.asc_registerCallback = function(name, callback, replaceOldCallback) { + this.handlers.add(name, callback, replaceOldCallback); + + /* + Не самая хорошая схема для отправки эвентов: + проверяем, подписан ли кто-то на эвент? Если да, то отправляем и больше ничего не делаем. + Если никто не подписан, то сохраняем у себя переменную и как только кто-то подписывается - отправляем ее + */ + if (null !== this._gui_control_colors && "asc_onSendThemeColors" === name) { + this.handlers.trigger("asc_onSendThemeColors", this._gui_control_colors.Colors, this._gui_control_colors.StandartColors); + this._gui_control_colors = null; + } else if (null !== this._gui_color_schemes && "asc_onSendThemeColorSchemes" === name) { + this.handlers.trigger("asc_onSendThemeColorSchemes", this._gui_color_schemes); + this._gui_color_schemes = null; + } else if ("asc_onInitEditorShapes" === name) { + this.handlers.trigger("asc_onInitEditorShapes", g_oAutoShapesGroups, g_oAutoShapesTypes); + } else if ("asc_onInitEditorTextArts" === name) { + this.handlers.trigger("asc_onInitEditorTextArts", [g_oPresetTxWarpGroups, g_PresetTxWarpTypes]); + } else if ("asc_onInitStandartTextures" === name) { + var _count = g_oUserTexturePresets.length; + var arr = new Array(_count); + for (var i = 0; i < _count; ++i) { + arr[i] = new asc_CTexture(); + arr[i].Id = i; + arr[i].Image = g_oUserTexturePresets[i]; + this.ImageLoader.LoadImage(g_oUserTexturePresets[i], 1); + } + + this.handlers.trigger("asc_onInitStandartTextures", arr); + } + }; + + spreadsheet_api.prototype.asc_unregisterCallback = function(name, callback) { + this.handlers.remove(name, callback); + }; + + spreadsheet_api.prototype.asc_getController = function() { + return this.controller; +// return null; + }; + + spreadsheet_api.prototype.asc_SetDocumentPlaceChangedEnabled = function(val) { + this.wb.setDocumentPlaceChangedEnabled(val); + }; + + spreadsheet_api.prototype.asc_SetFastCollaborative = function(bFast) { + if (this.collaborativeEditing) { + CollaborativeEditing.Set_Fast(bFast); + this.collaborativeEditing.setFast(bFast); + } + }; + + // Посылает эвент о том, что обновились листы + spreadsheet_api.prototype.sheetsChanged = function() { + this.handlers.trigger("asc_onSheetsChanged"); + }; + + spreadsheet_api.prototype.asyncFontsDocumentStartLoaded = function() { + this.OpenDocumentProgress.Type = c_oAscAsyncAction.LoadDocumentFonts; + this.OpenDocumentProgress.FontsCount = this.FontLoader.fonts_loading.length; + this.OpenDocumentProgress.CurrentFont = 0; + this.sync_StartAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.LoadDocumentFonts); + }; + + spreadsheet_api.prototype.asyncFontsDocumentEndLoaded = function() { + this.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.LoadDocumentFonts); + + if (this.asyncMethodCallback !== undefined) { + this.asyncMethodCallback(); + this.asyncMethodCallback = undefined; + } else { + // Шрифты загрузились, возможно стоит подождать совместное редактирование + this.FontLoadWaitComplete = true; + if (this.ServerIdWaitComplete) { + this._openDocumentEndCallback(); + } + } + }; + + spreadsheet_api.prototype.asyncFontEndLoaded = function(font) { + this.sync_EndAction(c_oAscAsyncActionType.Information, c_oAscAsyncAction.LoadFont); + }; + + spreadsheet_api.prototype._loadFonts = function(fonts, callback) { + if (window["NATIVE_EDITOR_ENJINE"]) { + return callback(); + } + this.asyncMethodCallback = callback; + var arrLoadFonts = []; + for (var i in fonts) + arrLoadFonts.push(new CFont(i, 0, "", 0)); + History.loadFonts(arrLoadFonts); + this.FontLoader.LoadDocumentFonts2(arrLoadFonts); + }; + + spreadsheet_api.prototype._startOpenDocument = function(sData) { + this.wbModel = this._openDocument(sData); + + this.FontLoader.LoadDocumentFonts(this.wbModel.generateFontMap2()); + + // Какая-то непонятная заглушка, чтобы не падало в ipad + if (this.isMobileVersion) { + window.USER_AGENT_SAFARI_MACOS = false; + PASTE_ELEMENT_ID = "wrd_pastebin"; + ELEMENT_DISPAY_STYLE = "none"; + } + + if (window.USER_AGENT_SAFARI_MACOS) { + setInterval(SafariIntervalFocus2, 10); + } + }; + + // Соединились с сервером + spreadsheet_api.prototype.asyncServerIdEndLoaded = function() { + // С сервером соединились, возможно стоит подождать загрузку шрифтов + this.ServerIdWaitComplete = true; + if (this.FontLoadWaitComplete) { + this._openDocumentEndCallback(); + } + }; + + // Эвент о пришедщих изменениях + spreadsheet_api.prototype.syncCollaborativeChanges = function() { + // Для быстрого сохранения уведомлять не нужно. + if (!this.collaborativeEditing.getFast()) { + this.handlers.trigger("asc_onCollaborativeChanges"); + } + }; + + // Применение изменений документа, пришедших при открытии + // Их нужно применять после того, как мы создали WorkbookView + // т.к. автофильтры, диаграммы, изображения и комментарии завязаны на WorksheetView (ToDo переделать) + spreadsheet_api.prototype._applyFirstLoadChanges = function() { + if (this.IsSendDocumentLoadCompleate) { + return; + } + if (this.collaborativeEditing.applyChanges()) { + // Изменений не было + this.IsSendDocumentLoadCompleate = true; + this.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.Open); + this.handlers.trigger('asc_onDocumentContentReady'); + } + }; + + ///////////////////////////////////////////////////////////////////////// + ///////////////////CoAuthoring and Chat api////////////////////////////// + ///////////////////////////////////////////////////////////////////////// + spreadsheet_api.prototype._coAuthoringInitEnd = function() { + var t = this; + this.collaborativeEditing = new asc_CCollaborativeEditing(/*handlers*/{ + "askLock": function() { + t.CoAuthoringApi.askLock.apply(t.CoAuthoringApi, arguments); + }, + "releaseLocks": function() { + t.CoAuthoringApi.releaseLocks.apply(t.CoAuthoringApi, arguments); + }, + "sendChanges": function() { + t._onSaveChanges.apply(t, arguments); + }, + "applyChanges": function() { + t._onApplyChanges.apply(t, arguments); + }, + "updateAfterApplyChanges": function() { + t._onUpdateAfterApplyChanges.apply(t, arguments); + }, + "drawSelection": function() { + t._onDrawSelection.apply(t, arguments); + }, + "drawFrozenPaneLines": function() { + t._onDrawFrozenPaneLines.apply(t, arguments); + }, + "updateAllSheetsLock": function() { + t._onUpdateAllSheetsLock.apply(t, arguments); + }, + "showDrawingObjects": function() { + t._onShowDrawingObjects.apply(t, arguments); + }, + "showComments": function() { + t._onShowComments.apply(t, arguments); + }, + "cleanSelection": function() { + t._onCleanSelection.apply(t, arguments); + }, + "updateDocumentCanSave": function() { + t._onUpdateDocumentCanSave(); + }, + "checkCommentRemoveLock": function(lockElem) { + return t._onCheckCommentRemoveLock(lockElem); + }, + "unlockDefName": function() { + t._onUnlockDefName.apply(t, arguments); + }, + "checkDefNameLock": function(lockElem) { + return t._onCheckDefNameLock(lockElem); + } + }, this.getViewMode()); + + this.CoAuthoringApi.onConnectionStateChanged = function(e) { + t.handlers.trigger("asc_onConnectionStateChanged", e); + }; + this.CoAuthoringApi.onLocksAcquired = function(e) { + if (!t.IsSendDocumentLoadCompleate) { + // Пока документ еще не загружен, будем сохранять функцию и аргументы + t.arrPreOpenLocksObjects.push(function(){t.CoAuthoringApi.onLocksAcquired(e);}); + return; + } + + if (2 != e["state"]) { + var elementValue = e["blockValue"]; + var lockElem = t.collaborativeEditing.getLockByElem(elementValue, c_oAscLockTypes.kLockTypeOther); + if (null === lockElem) { + lockElem = new asc.CLock(elementValue); + t.collaborativeEditing.addUnlock(lockElem); + } + + var drawing, lockType = lockElem.Element["type"]; + var oldType = lockElem.getType(); + if (c_oAscLockTypes.kLockTypeOther2 === oldType || c_oAscLockTypes.kLockTypeOther3 === oldType) { + lockElem.setType(c_oAscLockTypes.kLockTypeOther3, true); + } else { + lockElem.setType(c_oAscLockTypes.kLockTypeOther, true); + } + + // Выставляем ID пользователя, залочившего данный элемент + lockElem.setUserId(e["user"]); + + if (lockType === c_oAscLockTypeElem.Object) { + drawing = g_oTableId.Get_ById(lockElem.Element["rangeOrObjectId"]); + if (drawing) { + drawing.lockType = lockElem.Type; + } + } + + if (t.wb) { + // Шлем update для toolbar-а, т.к. когда select в lock ячейке нужно заблокировать toolbar + t.wb._onWSSelectionChanged(/*info*/null); + + // Шлем update для листов + t._onUpdateSheetsLock(lockElem); + + t._onUpdateDefinedNames(lockElem); + + var ws = t.wb.getWorksheet(); + var lockSheetId = lockElem.Element["sheetId"]; + if (lockSheetId === ws.model.getId()) { + if (lockType === c_oAscLockTypeElem.Object) { + // Нужно ли обновлять закрепление областей + if (t._onUpdateFrozenPane(lockElem)) { + ws.draw(); + } else if (drawing && ws.model === drawing.worksheet) { + if (ws.objectRender) { + ws.objectRender.showDrawingObjects(true); + } + } + } else if (lockType === c_oAscLockTypeElem.Range || lockType === c_oAscLockTypeElem.Sheet) { + ws.updateSelection(); + } + } else if (-1 !== lockSheetId && 0 === lockSheetId.indexOf(CCellCommentator.sStartCommentId)) { + // Коммментарий + t.handlers.trigger("asc_onLockComment", lockElem.Element["rangeOrObjectId"], e["user"]); + } + } + } + }; + this.CoAuthoringApi.onLocksReleased = function(e, bChanges) { + if (!t.IsSendDocumentLoadCompleate) { + // Пока документ еще не загружен, будем сохранять функцию и аргументы + t.arrPreOpenLocksObjects.push(function(){t.CoAuthoringApi.onLocksReleased(e, bChanges);}); + return; + } + + var element = e["block"]; + var lockElem = t.collaborativeEditing.getLockByElem(element, c_oAscLockTypes.kLockTypeOther); + if (null != lockElem) { + var curType = lockElem.getType(); + + var newType = c_oAscLockTypes.kLockTypeNone; + if (curType === c_oAscLockTypes.kLockTypeOther) { + if (true != bChanges) { + newType = c_oAscLockTypes.kLockTypeNone; + } else { + newType = c_oAscLockTypes.kLockTypeOther2; + } + } else if (curType === c_oAscLockTypes.kLockTypeMine) { + // Такого быть не должно + newType = c_oAscLockTypes.kLockTypeMine; + } else if (curType === c_oAscLockTypes.kLockTypeOther2 || curType === c_oAscLockTypes.kLockTypeOther3) { + newType = c_oAscLockTypes.kLockTypeOther2; + } + + if (t.wb) { + t.wb.getWorksheet().cleanSelection(); + } + + var drawing; + if (c_oAscLockTypes.kLockTypeNone !== newType) { + lockElem.setType(newType, true); + } else { + // Удаляем из lock-ов, тот, кто правил ушел и не сохранил + t.collaborativeEditing.removeUnlock(lockElem); + if (!t._onCheckCommentRemoveLock(lockElem.Element)) { + if (lockElem.Element["type"] === c_oAscLockTypeElem.Object) { + drawing = g_oTableId.Get_ById(lockElem.Element["rangeOrObjectId"]); + if (drawing) { + drawing.lockType = c_oAscLockTypes.kLockTypeNone; + } + } + } + } + if (t.wb) { + // Шлем update для листов + t._onUpdateSheetsLock(lockElem); + /*снимаем лок для DefName*/ + t.handlers.trigger("asc_onLockDefNameManager",c_oAscDefinedNameReason.OK); + } + } + }; + this.CoAuthoringApi.onLocksReleasedEnd = function() { + if (!t.IsSendDocumentLoadCompleate) { + // Пока документ еще не загружен ничего не делаем + return; + } + + if (t.wb) { + // Шлем update для toolbar-а, т.к. когда select в lock ячейке нужно сбросить блокировку toolbar + t.wb._onWSSelectionChanged(/*info*/null); + + var worksheet = t.wb.getWorksheet(); + worksheet.cleanSelection(); + worksheet._drawSelection(); + worksheet._drawFrozenPaneLines(); + if (worksheet.objectRender) { + worksheet.objectRender.showDrawingObjects(true); + } + } + }; + this.CoAuthoringApi.onSaveChanges = function(e, userId, bFirstLoad) { + t.collaborativeEditing.addChanges(e); + if (!bFirstLoad && t.IsSendDocumentLoadCompleate) { + t.syncCollaborativeChanges(); + } + }; + this.CoAuthoringApi.onRecalcLocks = function(excelAdditionalInfo) { + if (!excelAdditionalInfo) { + return; + } + + var tmpAdditionalInfo = JSON.parse(excelAdditionalInfo); + // Это мы получили recalcIndexColumns и recalcIndexRows + var oRecalcIndexColumns = t.collaborativeEditing.addRecalcIndex('0', tmpAdditionalInfo['indexCols']); + var oRecalcIndexRows = t.collaborativeEditing.addRecalcIndex('1', tmpAdditionalInfo['indexRows']); + + // Теперь нужно пересчитать индексы для lock-элементов + if (null !== oRecalcIndexColumns || null !== oRecalcIndexRows) { + t.collaborativeEditing._recalcLockArray(c_oAscLockTypes.kLockTypeMine, oRecalcIndexColumns, oRecalcIndexRows); + t.collaborativeEditing._recalcLockArray(c_oAscLockTypes.kLockTypeOther, oRecalcIndexColumns, oRecalcIndexRows); + } + }; + this.CoAuthoringApi.onStartCoAuthoring = function(isStartEvent) { + t.startCollaborationEditing(); + + // На старте не нужно ничего делать + if (!isStartEvent) { + // Когда документ еще не загружен, нужно отпустить lock (при быстром открытии 2-мя пользователями) + if (!t.IsSendDocumentLoadCompleate) { + t.CoAuthoringApi.unLockDocument(false); + } else { + // Принимаем чужие изменения + t.collaborativeEditing.applyChanges(); + // Пересылаем свои изменения + t.collaborativeEditing.sendChanges(); + } + } + }; + this.CoAuthoringApi.onEndCoAuthoring = function(isStartEvent) { + t.endCollaborationEditing(); + }; + }; + + spreadsheet_api.prototype._onSaveChanges = function(recalcIndexColumns, recalcIndexRows) { + if (this.IsSendDocumentLoadCompleate) { + var arrChanges = this.wbModel.SerializeHistory(); + var deleteIndex = History.Get_DeleteIndex(); + var excelAdditionalInfo = null; + if (this.collaborativeEditing.getCollaborativeEditing()) { + // Пересчетные индексы добавляем только если мы не одни + if (recalcIndexColumns || recalcIndexRows) { + excelAdditionalInfo = {"indexCols": recalcIndexColumns, "indexRows": recalcIndexRows}; + } + } + if (0 < arrChanges.length || null !== deleteIndex || null !== excelAdditionalInfo) { + this.CoAuthoringApi.saveChanges(arrChanges, deleteIndex, excelAdditionalInfo); + } else { + this.CoAuthoringApi.unLockDocument(true); + } + } + }; + + spreadsheet_api.prototype._onApplyChanges = function(changes, fCallback) { + this.wbModel.DeserializeHistory(changes, fCallback); + }; + + spreadsheet_api.prototype._onUpdateAfterApplyChanges = function() { + if (!this.IsSendDocumentLoadCompleate) { + // При открытии после принятия изменений мы должны сбросить пересчетные индексы + this.collaborativeEditing.clearRecalcIndex(); + this.IsSendDocumentLoadCompleate = true; + this.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.Open); + this.handlers.trigger('asc_onDocumentContentReady'); + } else if (this.wb && !window["NATIVE_EDITOR_ENJINE"]) { + // Нужно послать 'обновить свойства' (иначе для удаления данных не обновится строка формул). + // ToDo Возможно стоит обновлять только строку формул + CollaborativeEditing.Load_Images(); + this.wb._onWSSelectionChanged(null); + this.wb.getWorksheet().updateVisibleRange(); + } + }; + + spreadsheet_api.prototype._onCleanSelection = function() { + if (this.wb) { + this.wb.getWorksheet().cleanSelection(); + } + }; + + spreadsheet_api.prototype._onDrawSelection = function() { + if (this.wb) { + this.wb.getWorksheet()._drawSelection(); + } + }; + + spreadsheet_api.prototype._onDrawFrozenPaneLines = function() { + if (this.wb) { + this.wb.getWorksheet()._drawFrozenPaneLines(); + } + }; + + spreadsheet_api.prototype._onUpdateAllSheetsLock = function() { + var t = this; + if (t.wbModel) { + // Шлем update для листов + t.handlers.trigger("asc_onWorkbookLocked", t.asc_isWorkbookLocked()); + var i, length, wsModel, wsIndex; + for (i = 0, length = t.wbModel.getWorksheetCount(); i < length; ++i) { + wsModel = t.wbModel.getWorksheet(i); + wsIndex = wsModel.getIndex(); + t.handlers.trigger("asc_onWorksheetLocked", wsIndex, t.asc_isWorksheetLockedOrDeleted(wsIndex)); + } + } + }; + + spreadsheet_api.prototype._onShowDrawingObjects = function() { + if (this.wb) { + var ws = this.wb.getWorksheet(); + if (ws && ws.objectRender) { + ws.objectRender.showDrawingObjects(true); + } + } + }; + + spreadsheet_api.prototype._onShowComments = function() { + if (this.wb) { + this.wb.getWorksheet().cellCommentator.drawCommentCells(); + } + }; + + spreadsheet_api.prototype._onUpdateSheetsLock = function(lockElem) { + var t = this; + // Шлем update для листов, т.к. нужно залочить лист + if (c_oAscLockTypeElem.Sheet === lockElem.Element["type"]) { + t.handlers.trigger("asc_onWorkbookLocked", t.asc_isWorkbookLocked()); + } + // Шлем update для листа + var wsModel = t.wbModel.getWorksheetById(lockElem.Element["sheetId"]); + if (wsModel) { + var wsIndex = wsModel.getIndex(); + t.handlers.trigger("asc_onWorksheetLocked", wsIndex, t.asc_isWorksheetLockedOrDeleted(wsIndex)); + } + }; + + spreadsheet_api.prototype._onUpdateFrozenPane = function(lockElem) { + return (c_oAscLockTypeElem.Object === lockElem.Element["type"] && lockElem.Element["rangeOrObjectId"] === c_oAscLockNameFrozenPane); + }; + + spreadsheet_api.prototype._sendWorkbookStyles = function() { + if (this.wbModel) { + // Для нативной версии не генерируем стили + if (window["NATIVE_EDITOR_ENJINE"] && (!this.handlers.hasTrigger("asc_onInitTablePictures") || !this.handlers.hasTrigger("asc_onInitEditorStyles"))) { + return; + } + + // Отправка стилей форматированных таблиц + this.handlers.trigger("asc_onInitTablePictures", this.wb.getTablePictures()); + // Отправка стилей ячеек + this.handlers.trigger("asc_onInitEditorStyles", this.wb.getCellStyles()); + } + }; + + spreadsheet_api.prototype.startCollaborationEditing = function() { + // Начинаем совместное редактирование + this.collaborativeEditing.startCollaborationEditing(); + }; + + spreadsheet_api.prototype.endCollaborationEditing = function() { + // Временно заканчиваем совместное редактирование + this.collaborativeEditing.endCollaborationEditing(); + }; + + // End Load document + spreadsheet_api.prototype._openDocumentEndCallback = function() { + // Не инициализируем дважды + if (this.DocumentLoadComplete) { + return; + } + + this.wb = new asc.WorkbookView(this.wbModel, this.controller, this.handlers, this.HtmlElement, this.topLineEditorElement, this, this.collaborativeEditing, this.fontRenderingMode); + + this.DocumentLoadComplete = true; + + this.asc_CheckGuiControlColors(); + this.asc_SendThemeColorScheme(); + this.asc_ApplyColorScheme(false); + + // Применяем пришедшие при открытии изменения + this._applyFirstLoadChanges(); + // Применяем все lock-и (ToDo возможно стоит пересмотреть вообще Lock-и) + for (var i = 0; i < this.arrPreOpenLocksObjects.length; ++i) { + this.arrPreOpenLocksObjects[i](); + } + this.arrPreOpenLocksObjects = []; + + // Меняем тип состояния (на никакое) + this.advancedOptionsAction = c_oAscAdvancedOptionsAction.None; + + // Были ошибки при открытии, посылаем предупреждение + if (0 < this.wbModel.openErrors.length) { + this.sendEvent('asc_onError', c_oAscError.ID.OpenWarning, c_oAscError.Level.NoCritical); + } + + //this.asc_Resize(); // Убрал, т.к. сверху приходит resize (http://bugzserver/show_bug.cgi?id=14680) + }; + + // Переход на диапазон в листе + spreadsheet_api.prototype._asc_setWorksheetRange = function(val) { + // Получаем sheet по имени + var ws = this.wbModel.getWorksheetByName(val.asc_getSheet()); + if (!ws || ws.getHidden()) { + return; + } + // Индекс листа + var sheetIndex = ws.getIndex(); + // Если не совпали индекс листа и индекс текущего, то нужно сменить + if (this.asc_getActiveWorksheetIndex() !== sheetIndex) { + // Меняем активный лист + this.asc_showWorksheet(sheetIndex); + // Посылаем эвент о смене активного листа + this.handlers.trigger("asc_onActiveSheetChanged", sheetIndex); + } + var range = ws.getRange2(val.asc_getRange()); + if (null !== range) { + this.wb._onSetSelection(range.getBBox0(), /*validRange*/ true); + } + }; + + spreadsheet_api.prototype.onSaveCallback = function(e) { + var t = this; + var nState; + if (false == e["saveLock"]) { + if (this.isLongAction()) { + // Мы не можем в этот момент сохранять, т.к. попали в ситуацию, когда мы залочили сохранение и успели нажать вставку до ответа + // Нужно снять lock с сохранения + this.CoAuthoringApi.onUnSaveLock = function() { + t.canSave = true; + t.IsUserSave = false; + t.lastSaveTime = null; + }; + this.CoAuthoringApi.unSaveLock(); + return; + } + + if (!this.IsUserSave) { + this.sync_StartAction(c_oAscAsyncActionType.Information, c_oAscAsyncAction.Save); + } + + CollaborativeEditing.Clear_CollaborativeMarks(); + // Принимаем чужие изменения + this.collaborativeEditing.applyChanges(); + + this.CoAuthoringApi.onUnSaveLock = function() { + t.CoAuthoringApi.onUnSaveLock = null; + + if (t.collaborativeEditing.getCollaborativeEditing()) { + // Шлем update для toolbar-а, т.к. когда select в lock ячейке нужно заблокировать toolbar + t.wb._onWSSelectionChanged(/*info*/null); + } + + t.canSave = true; + t.IsUserSave = false; + t.lastSaveTime = null; + + t.sync_EndAction(c_oAscAsyncActionType.Information, c_oAscAsyncAction.Save); + // Обновляем состояние возможности сохранения документа + t.onUpdateDocumentModified(History.Is_Modified()); + + if (undefined !== window["AscDesktopEditor"]) { + window["AscDesktopEditor"]["OnSave"](); + } + }; + + // Пересылаем всегда, но чистим только если началось совместное редактирование + // Пересылаем свои изменения + this.collaborativeEditing.sendChanges(this.IsUserSave); + } else { + nState = t.CoAuthoringApi.get_state(); + if (ConnectionState.Close === nState) { + // Отключаемся от сохранения, соединение потеряно + if (this.IsUserSave) { + this.sync_EndAction(c_oAscAsyncActionType.Information, c_oAscAsyncAction.Save); + } + this.IsUserSave = false; + this.canSave = true; + } else { + // Если автосохранение, то не будем ждать ответа, а просто перезапустим таймер на немного + if (!this.IsUserSave) { + this.canSave = true; + return; + } + + setTimeout(function() { + t.CoAuthoringApi.askSaveChanges(function(event) { + t.onSaveCallback(event); + }); + }, 1000); + } + } + }; + + spreadsheet_api.prototype._getIsLockObjectSheet = function(lockInfo, callback) { + if (false === this.collaborativeEditing.getCollaborativeEditing()) { + // Пользователь редактирует один: не ждем ответа, а сразу продолжаем редактирование + asc_applyFunction(callback, true); + callback = undefined; + } + if (false !== this.collaborativeEditing.getLockIntersection(lockInfo, c_oAscLockTypes.kLockTypeMine, /*bCheckOnlyLockAll*/false)) { + // Редактируем сами + asc_applyFunction(callback, true); + return; + } else if (false !== this.collaborativeEditing.getLockIntersection(lockInfo, c_oAscLockTypes.kLockTypeOther, /*bCheckOnlyLockAll*/false)) { + // Уже ячейку кто-то редактирует + asc_applyFunction(callback, false); + return; + } + + this.collaborativeEditing.onStartCheckLock(); + this.collaborativeEditing.addCheckLock(lockInfo); + this.collaborativeEditing.onEndCheckLock(callback); + }; + // Залочена ли панель для закрепления + spreadsheet_api.prototype._isLockedTabColor = function(index, callback) { + var sheetId = this.wbModel.getWorksheet(index).getId(); + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Object, null, sheetId, c_oAscLockNameTabColor); + + if (false === this.collaborativeEditing.getCollaborativeEditing()) { + // Пользователь редактирует один: не ждем ответа, а сразу продолжаем редактирование + asc_applyFunction(callback, true); + callback = undefined; + } + if (false !== this.collaborativeEditing.getLockIntersection(lockInfo, c_oAscLockTypes.kLockTypeMine, /*bCheckOnlyLockAll*/false)) { + // Редактируем сами + asc_applyFunction(callback, true); + return; + } else if (false !== this.collaborativeEditing.getLockIntersection(lockInfo, c_oAscLockTypes.kLockTypeOther, /*bCheckOnlyLockAll*/false)) { + // Уже ячейку кто-то редактирует + asc_applyFunction(callback, false); + return; + } + + this.collaborativeEditing.onStartCheckLock(); + this.collaborativeEditing.addCheckLock(lockInfo); + this.collaborativeEditing.onEndCheckLock(callback); + }; + + spreadsheet_api.prototype._addWorksheet = function(name, i) { + this.wbModel.createWorksheet(i, name); + this.wb.spliceWorksheet(i, 0, null); + this.asc_showWorksheet(i); + // Посылаем callback об изменении списка листов + this.sheetsChanged(); + }; + + // Workbook interface + + spreadsheet_api.prototype.asc_getWorksheetsCount = function() { + return this.wbModel.getWorksheetCount(); + }; + + spreadsheet_api.prototype.asc_getWorksheetName = function(index) { + return this.wbModel.getWorksheet(index).getName(); + }; + + spreadsheet_api.prototype.asc_getWorksheetTabColor = function(index) { + return this.wbModel.getWorksheet(index).getTabColor(); + }; + spreadsheet_api.prototype.asc_setWorksheetTabColor = function(index, color) { + var t = this; + var changeTabColorCallback = function(res) { + if (res) { + color = CorrectAscColor(color); + t.wbModel.getWorksheet(index).setTabColor(color); + } + }; + this._isLockedTabColor(index, changeTabColorCallback); + }; + + spreadsheet_api.prototype.asc_getActiveWorksheetIndex = function() { + return this.wbModel.getActive(); + }; + + spreadsheet_api.prototype.asc_getActiveWorksheetId = function() { + var activeIndex = this.wbModel.getActive(); + return this.wbModel.getWorksheet(activeIndex).getId(); + }; + + spreadsheet_api.prototype.asc_getWorksheetId = function(index) { + return this.wbModel.getWorksheet(index).getId(); + }; + + spreadsheet_api.prototype.asc_isWorksheetHidden = function(index) { + return this.wbModel.getWorksheet(index).getHidden(); + }; + + spreadsheet_api.prototype.asc_getDefinedNames = function(defNameListId) { + return this.wb.getDefinedNames(defNameListId); + }; + + spreadsheet_api.prototype.asc_setDefinedNames = function(defName) { +// return this.wb.setDefinedNames(defName); + // Проверка глобального лока + if (this.collaborativeEditing.getGlobalLock()) { + return; + } + return this.wb.editDefinedNames(null, defName); + }; + + spreadsheet_api.prototype.asc_editDefinedNames = function(oldName, newName) { + // Проверка глобального лока + if (this.collaborativeEditing.getGlobalLock()) { + return; + } + + return this.wb.editDefinedNames(oldName, newName); + }; + + spreadsheet_api.prototype.asc_delDefinedNames = function(oldName) { + // Проверка глобального лока + if (this.collaborativeEditing.getGlobalLock()) { + return; + } + return this.wb.delDefinedNames(oldName); + }; + + spreadsheet_api.prototype.asc_checkDefinedName = function(checkName, scope) { + return this.wb.checkDefName(checkName, scope); + }; + + spreadsheet_api.prototype.asc_getDefaultDefinedName = function() { + return this.wb.getDefaultDefinedName(); + }; + + spreadsheet_api.prototype._onUpdateDefinedNames = function(lockElem) { +// if( lockElem.Element["subType"] == c_oAscLockTypeElemSubType.DefinedNames ){ + if( lockElem.Element["sheetId"] == -1 && lockElem.Element["rangeOrObjectId"] != -1 && !this.collaborativeEditing.getFast() ){ + var dN = this.wbModel.dependencyFormulas.defNameList[lockElem.Element["rangeOrObjectId"]]; + if (dN) { + dN.isLock = lockElem.UserId; + this.handlers.trigger("asc_onRefreshDefNameList",dN.getAscCDefName()); + } + this.handlers.trigger("asc_onLockDefNameManager",c_oAscDefinedNameReason.LockDefNameManager); + } + } + + spreadsheet_api.prototype._onUnlockDefName = function() { + this.wb.unlockDefName(); + } + + spreadsheet_api.prototype._onCheckDefNameLock = function() { + return this.wb._onCheckDefNameLock(); + } + + // Залочена ли работа с листом + spreadsheet_api.prototype.asc_isWorksheetLockedOrDeleted = function(index) { + var ws = this.wbModel.getWorksheet(index); + var sheetId = null; + if (null === ws || undefined === ws) { + sheetId = this.asc_getActiveWorksheetId(); + } else { + sheetId = ws.getId(); + } + + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, sheetId, sheetId); + // Проверим, редактирует ли кто-то лист + return (false !== this.collaborativeEditing.getLockIntersection(lockInfo, c_oAscLockTypes.kLockTypeOther, /*bCheckOnlyLockAll*/false)); + }; + + // Залочена ли работа с листами + spreadsheet_api.prototype.asc_isWorkbookLocked = function() { + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, null, null); + // Проверим, редактирует ли кто-то лист + return (false !== this.collaborativeEditing.getLockIntersection(lockInfo, c_oAscLockTypes.kLockTypeOther, /*bCheckOnlyLockAll*/false)); + }; + + spreadsheet_api.prototype.asc_getHiddenWorksheets = function() { + var model = this.wbModel; + var len = model.getWorksheetCount(); + var i, ws, res = []; + + for (i = 0; i < len; ++i) { + ws = model.getWorksheet(i); + if (ws.getHidden()) { + res.push({"index": i, "name": ws.getName()}); + } + } + return res; + }; + + spreadsheet_api.prototype.asc_showWorksheet = function(index) { + if (typeof index === "number" && undefined !== index && null !== index) { + var t = this; + var ws = this.wbModel.getWorksheet(index); + var isHidden = ws.getHidden(); + var showWorksheetCallback = function(res) { + if (res) { + t.wbModel.getWorksheet(index).setHidden(false); + t.wb.showWorksheet(index); + if (isHidden) { + // Посылаем callback об изменении списка листов + t.sheetsChanged(); + } + } + }; + if (isHidden) { + var sheetId = this.wbModel.getWorksheet(index).getId(); + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, sheetId, sheetId); + this._getIsLockObjectSheet(lockInfo, showWorksheetCallback); + } else { + showWorksheetCallback(true); + } + } + }; + + spreadsheet_api.prototype.asc_showActiveWorksheet = function() { + this.wb.showWorksheet(this.wbModel.getActive()); + }; + + spreadsheet_api.prototype.asc_hideWorksheet = function() { + var t = this; + // Колличество листов + var countWorksheets = this.asc_getWorksheetsCount(); + // Колличество скрытых листов + var arrHideWorksheets = this.asc_getHiddenWorksheets(); + var countHideWorksheets = arrHideWorksheets.length; + // Вдруг остался один лист + if (countWorksheets <= countHideWorksheets + 1) { + return false; + } + + var model = this.wbModel; + // Активный лист + var activeWorksheet = model.getActive(); + var sheetId = this.wbModel.getWorksheet(activeWorksheet).getId(); + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, sheetId, sheetId); + + var hideWorksheetCallback = function(res) { + if (res) { + t.wbModel.getWorksheet(activeWorksheet).setHidden(true); + } + }; + + this._getIsLockObjectSheet(lockInfo, hideWorksheetCallback); + return true; + }; + + spreadsheet_api.prototype.asc_renameWorksheet = function(name) { + // Проверка глобального лока + if (this.collaborativeEditing.getGlobalLock()) { + return false; + } + + var i = this.wbModel.getActive(); + var sheetId = this.wbModel.getWorksheet(i).getId(); + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, sheetId, sheetId); + + var t = this; + var renameCallback = function(res) { + if (res) { + t.wbModel.getWorksheet(i).setName(name); + t.sheetsChanged(); + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.LockedWorksheetRename, c_oAscError.Level.NoCritical); + } + }; + + this._getIsLockObjectSheet(lockInfo, renameCallback); + return true; + }; + + spreadsheet_api.prototype.asc_addWorksheet = function(name) { + var i = this.wbModel.getActive(); + this._addWorksheet(name, i + 1); + }; + + spreadsheet_api.prototype.asc_insertWorksheet = function(name) { + var i = this.wbModel.getActive(); + this._addWorksheet(name, i); + }; + + // Удаление листа + spreadsheet_api.prototype.asc_deleteWorksheet = function() { + // Проверка глобального лока + if (this.collaborativeEditing.getGlobalLock()) { + return false; + } + + var i = this.wbModel.getActive(); + var activeSheet = this.wbModel.getWorksheet(i); + var activeName = activeSheet.sName; + var sheetId = activeSheet.getId(); + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, sheetId, sheetId); + + var t = this; + var deleteCallback = function(res) { + if (res) { + + History.Create_NewPoint(); + History.StartTransaction(); + + // Нужно проверить все диаграммы, ссылающиеся на удаляемый лист + for (var key in t.wb.model.aWorksheets) { + var wsModel = t.wb.model.aWorksheets[key]; + if (wsModel) { + History.TurnOff(); + var ws = t.wb.getWorksheet(wsModel.index); + History.TurnOn(); + wsModel.oDrawingOjectsManager.updateChartReferencesWidthHistory(parserHelp.getEscapeSheetName(activeName), parserHelp.getEscapeSheetName(wsModel.sName)); + if (ws && ws.objectRender && ws.objectRender.controller) { + ws.objectRender.controller.recalculate2(true); + } + } + } + + // Удаляем Worksheet и получаем новый активный индекс (-1 означает, что ничего не удалилось) + var activeNow = t.wbModel.removeWorksheet(i); + if (-1 !== activeNow) { + t.wb.removeWorksheet(i); + t.asc_showWorksheet(activeNow); + // Посылаем callback об изменении списка листов + t.sheetsChanged(); + } + History.EndTransaction(); + } + }; + + this._getIsLockObjectSheet(lockInfo, deleteCallback); + return true; + }; + + spreadsheet_api.prototype.asc_moveWorksheet = function(where) { + var i = this.wbModel.getActive(); + var d = i < where ? +1 : -1; + // Мы должны поместить слева от заданного значения, поэтому если идем вправо, то вычтем 1 + if (1 === d) { + where -= 1; + } + + this.wb.replaceWorksheet(i, where); + this.wbModel.replaceWorksheet(i, where); + + // Обновим текущий номер + this.asc_showWorksheet(where); + // Посылаем callback об изменении списка листов + this.sheetsChanged(); + }; + + spreadsheet_api.prototype.asc_copyWorksheet = function(where, newName) { + var scale = this.asc_getZoom(); + var i = this.wbModel.getActive(); + + // ToDo уйти от lock для листа при копировании + var sheetId = this.wbModel.getWorksheet(i).getId(); + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Sheet, /*subType*/null, sheetId, sheetId); + var t = this; + var copyWorksheet = function(res) { + if (res) { + t.wb._initCommentsToSave(); + // ToDo перейти от wsViews на wsViewsId (сейчас вызываем раньше, чем в модели, т.к. там будет sortDependency + // и cleanCellCache, который создаст уже скопированный лист(и splice сработает неправильно)) + History.Create_NewPoint(); + t.wb.copyWorksheet(i, where); + t.wbModel.copyWorksheet(i, where, newName); + // Делаем активным скопированный + t.asc_showWorksheet(where); + t.asc_setZoom(scale); + // Посылаем callback об изменении списка листов + t.sheetsChanged(); + } + }; + + this._getIsLockObjectSheet(lockInfo, copyWorksheet); + }; + + spreadsheet_api.prototype.asc_cleanSelection = function() { + this.wb.getWorksheet().cleanSelection(); + }; + + spreadsheet_api.prototype.asc_getZoom = function() { + return this.wb.getZoom(); + }; + + spreadsheet_api.prototype.asc_setZoom = function(scale) { + this.wb.changeZoom(scale); + }; + + spreadsheet_api.prototype.asc_enableKeyEvents = function(isEnabled) { + if (this.wb) { + this.wb.enableKeyEventsHandler(isEnabled); + } + //наличие фокуса в рабочей области редактора(используется для copy/paste в MAC) + this.IsFocus = isEnabled; + }; + + spreadsheet_api.prototype.asc_IsFocus = function(bIsNaturalFocus) { + var res = true; + if (this.wb) { + res = this.wb.getEnableKeyEventsHandler(bIsNaturalFocus); + } + return res; + }; + + spreadsheet_api.prototype.asc_searchEnabled = function(bIsEnabled) { + }; + + spreadsheet_api.prototype.asc_findText = function(options) { + if (window["NATIVE_EDITOR_ENJINE"]) { + if (this.wb.findCellText(options)) { + var ws = this.wb.getWorksheet(); + return [ws.getCellLeftRelative(ws.activeRange.c1, 0), ws.getCellTopRelative(ws.activeRange.r1, 0)]; + } + + return null; + } + + var d = this.wb.findCellText(options); + if (d) { + if (d.deltaX) { + this.controller.scrollHorizontal(d.deltaX); + } + if (d.deltaY) { + this.controller.scrollVertical(d.deltaY); + } + } + return !!d; + }; + + spreadsheet_api.prototype.asc_replaceText = function(options) { + options.lookIn = c_oAscFindLookIn.Formulas; // При замене поиск только в формулах + this.wb.replaceCellText(options); + }; + + spreadsheet_api.prototype.asc_endFindText = function() { + // Нужно очистить поиск + this.wb._cleanFindResults(); + }; + + /** + * Делает активной указанную ячейку + * @param {String} reference Ссылка на ячейку вида A1 или R1C1 + */ + spreadsheet_api.prototype.asc_findCell = function(reference) { + if(this.wb.cellEditor.isOpened) return; + var d = this.wb.findCell(reference); + + if (!d) { + this.handlers.trigger("asc_onError", c_oAscError.ID.InvalidReferenceOrName, c_oAscError.Level.NoCritical); + return; + } + + // Получаем sheet по имени + var ws = this.wbModel.getWorksheetByName(d.sheet); + if (!ws || ws.getHidden()) { + return; + } + // Индекс листа + var sheetIndex = ws.getIndex(); + // Если не совпали индекс листа и индекс текущего, то нужно сменить + if (this.asc_getActiveWorksheetIndex() !== sheetIndex) { + // Меняем активный лист + this.asc_showWorksheet(sheetIndex); + // Посылаем эвент о смене активного листа + this.handlers.trigger("asc_onActiveSheetChanged", sheetIndex); + } + + ws = this.wb.getWorksheet(); + d = d.range ? ws.setSelection(d.range, true) : null; + + if (d) { + if (d.deltaX) { + this.controller.scrollHorizontal(d.deltaX); + } + if (d.deltaY) { + this.controller.scrollVertical(d.deltaY); + } + } else { + this.handlers.trigger("asc_onError", c_oAscError.ID.InvalidReferenceOrName, c_oAscError.Level.NoCritical); + } + }; + + spreadsheet_api.prototype.asc_closeCellEditor = function() { + this.wb.closeCellEditor(); + }; + + + // Spreadsheet interface + + spreadsheet_api.prototype.asc_getColumnWidth = function() { + var ws = this.wb.getWorksheet(); + return ws.getSelectedColumnWidthInSymbols(); + }; + + spreadsheet_api.prototype.asc_setColumnWidth = function(width) { + this.wb.getWorksheet().changeWorksheet("colWidth", width); + }; + + spreadsheet_api.prototype.asc_showColumns = function() { + this.wb.getWorksheet().changeWorksheet("showCols"); + }; + + spreadsheet_api.prototype.asc_hideColumns = function() { + this.wb.getWorksheet().changeWorksheet("hideCols"); + }; + + spreadsheet_api.prototype.asc_getRowHeight = function() { + var ws = this.wb.getWorksheet(); + return ws.getSelectedRowHeight(); + }; + + spreadsheet_api.prototype.asc_setRowHeight = function(height) { + this.wb.getWorksheet().changeWorksheet("rowHeight", height); + }; + + spreadsheet_api.prototype.asc_showRows = function() { + this.wb.getWorksheet().changeWorksheet("showRows"); + }; + + spreadsheet_api.prototype.asc_hideRows = function() { + this.wb.getWorksheet().changeWorksheet("hideRows"); + }; + + spreadsheet_api.prototype.asc_insertCells = function(options) { + this.wb.getWorksheet().changeWorksheet("insCell", options); + }; + + spreadsheet_api.prototype.asc_deleteCells = function(options) { + this.wb.getWorksheet().changeWorksheet("delCell", options); + }; + + spreadsheet_api.prototype.asc_mergeCells = function(options) { + this.wb.getWorksheet().setSelectionInfo("merge", options); + }; + + spreadsheet_api.prototype.asc_sortCells = function(options) { + this.wb.getWorksheet().setSelectionInfo("sort", options); + }; + + spreadsheet_api.prototype.asc_emptyCells = function(options) { + this.wb.emptyCells(options); + }; + + spreadsheet_api.prototype.asc_drawDepCells = function(se) { + /* ToDo + if( se != c_oAscDrawDepOptions.Clear ) + this.wb.getWorksheet().prepareDepCells(se); + else + this.wb.getWorksheet().cleanDepCells();*/ + }; + + // Потеряем ли мы что-то при merge ячеек + spreadsheet_api.prototype.asc_mergeCellsDataLost = function(options) { + return this.wb.getWorksheet().getSelectionMergeInfo(options); + }; + + spreadsheet_api.prototype.asc_getSheetViewSettings = function() { + return this.wb.getWorksheet().getSheetViewSettings(); + }; + + spreadsheet_api.prototype.asc_setSheetViewSettings = function(options) { + this.wb.getWorksheet().changeWorksheet("sheetViewSettings", options); + }; + + // Images & Charts + + spreadsheet_api.prototype.asc_drawingObjectsExist = function() { + for (var i = 0; i < this.wb.model.aWorksheets.length; i++) { + if (this.wb.model.aWorksheets[i].Drawings && this.wb.model.aWorksheets[i].Drawings.length) { + return true; + } + } + return false; + }; + + spreadsheet_api.prototype.asc_getChartObject = function() { // Return new or existing chart. For image return null + this.asc_onOpenChartFrame(); + var ws = this.wb.getWorksheet(); + return ws.objectRender.getAscChartObject(); + }; + + spreadsheet_api.prototype.asc_addChartDrawingObject = function(chart) { + var ws = this.wb.getWorksheet(); + return ws.objectRender.addChartDrawingObject(chart); + }; + + spreadsheet_api.prototype.asc_editChartDrawingObject = function(chart) { + var ws = this.wb.getWorksheet(); + return ws.objectRender.editChartDrawingObject(chart); + }; + + spreadsheet_api.prototype.asc_addImageDrawingObject = function(imageUrl) { + var rData = { + "id": this.documentId, + "userid": this.documentUserId, + "vkey": this.documentVKey, + "c": "imgurl", + "saveindex": g_oDocumentUrls.getMaxIndex(), + "data": imageUrl}; + + var t = this; + this.sync_StartAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.UploadImage); + this.fCurCallback = function(input) { + if (null != input && "imgurl" == input["type"]) { + if ("ok" == input["status"]) { + var data = input["data"]; + var urls = {}; + var firstUrl; + for (var i = 0; i < data.length; ++i) { + var elem = data[i]; + if (elem.url) { + if (!firstUrl) { + firstUrl = elem.url; + } + urls[elem.path] = elem.url; + } + } + g_oDocumentUrls.addUrls(urls); + if (firstUrl) { + var ws = t.wb.getWorksheet(); + ws.objectRender.addImageDrawingObject(firstUrl, null); + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + } else { + t.handlers.trigger("asc_onError", g_fMapAscServerErrorToAscError(parseInt(input["data"])), c_oAscError.Level.NoCritical); + } + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + t.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.UploadImage); + }; + sendCommand2(this, null, rData); + }; + + spreadsheet_api.prototype.asc_showImageFileDialog = function() { + // ToDo заменить на общую функцию для всех + this.asc_addImage(); + }; + spreadsheet_api.prototype._addImageUrl = function(url) { + var ws = this.wb.getWorksheet(); + if (ws) { + if (this.isImageChangeUrl || this.isShapeImageChangeUrl || this.isTextArtChangeUrl) { + ws.objectRender.editImageDrawingObject(url); + } else { + ws.objectRender.addImageDrawingObject(url, null); + } + } + }; + spreadsheet_api.prototype.asc_setSelectedDrawingObjectLayer = function(layerType) { + var ws = this.wb.getWorksheet(); + return ws.objectRender.setGraphicObjectLayer(layerType); + }; + spreadsheet_api.prototype.asc_addTextArt = function(nStyle) { + var ws = this.wb.getWorksheet(); + return ws.objectRender.addTextArt(nStyle); + }; + + spreadsheet_api.prototype.asc_checkDataRange = function(dialogType, dataRange, fullCheck, isRows, chartType) { + return parserHelp.checkDataRange(this.wbModel, this.wb, dialogType, dataRange, fullCheck, isRows, chartType); + }; + + // Для вставки диаграмм в Word + spreadsheet_api.prototype.asc_getBinaryFileWriter = function() { + this.wb._initCommentsToSave(); + return new Asc.BinaryFileWriter(this.wbModel); + }; + + spreadsheet_api.prototype.asc_getWordChartObject = function() { + var ws = this.wb.getWorksheet(); + return ws.objectRender.getWordChartObject(); + }; + + spreadsheet_api.prototype.asc_cleanWorksheet = function() { + var ws = this.wb.getWorksheet(); // Для удаления данных листа и диаграмм + if (ws.objectRender) { + ws.objectRender.cleanWorksheet(); + } + }; + + // Выставление данных (пока используется только для MailMerge) + spreadsheet_api.prototype.asc_setData = function(oData) { + this.wb.getWorksheet().setData(oData); + }; + // Получение данных + spreadsheet_api.prototype.asc_getData = function() { + this.asc_closeCellEditor(); + return this.wb.getWorksheet().getData(); + }; + + // Cell comment interface + spreadsheet_api.prototype.asc_addComment = function(oComment) { + }; + + spreadsheet_api.prototype.asc_changeComment = function(id, oComment) { + if (oComment.bDocument) { + this.wb.cellCommentator.changeComment(id, oComment); + } else { + var ws = this.wb.getWorksheet(); + ws.cellCommentator.changeComment(id, oComment); + } + }; + + spreadsheet_api.prototype.asc_selectComment = function(id) { + var ws = this.wb.getWorksheet(); + ws.cellCommentator.selectComment(id, /*bMove*/true); + }; + + spreadsheet_api.prototype.asc_showComment = function(id, bNew) { + var ws = this.wb.getWorksheet(); + ws.cellCommentator.showComment(id, bNew); + }; + + spreadsheet_api.prototype.asc_findComment = function(id) { + var ws = this.wb.getWorksheet(); + return ws.cellCommentator.findComment(id); + }; + + spreadsheet_api.prototype.asc_removeComment = function(id) { + var ws = this.wb.getWorksheet(); + ws.cellCommentator.removeComment(id); + this.wb.cellCommentator.removeComment(id); + }; + + spreadsheet_api.prototype.asc_getComments = function(col, row) { + var ws = this.wb.getWorksheet(); + return ws.cellCommentator.getComments(col, row); + }; + + spreadsheet_api.prototype.asc_getDocumentComments = function() { + return this.wb.cellCommentator.getDocumentComments(); + }; + + spreadsheet_api.prototype.asc_showComments = function() { + var ws = this.wb.getWorksheet(); + return ws.cellCommentator.showComments(); + }; + + spreadsheet_api.prototype.asc_hideComments = function() { + var ws = this.wb.getWorksheet(); + return ws.cellCommentator.hideComments(); + }; + + spreadsheet_api.prototype.asc_getWorkbookComments = function() { + var _this = this, comments = []; + if (_this.wb) { + for (var key in _this.wb.wsViews) { + var ws = _this.wb.wsViews[key]; + if (ws) { + for (var i = 0; i < ws.cellCommentator.aComments.length; i++) { + var comment = ws.cellCommentator.aComments[i]; + comments.push({ "Id": comment.asc_getId(), "Comment": comment }); + } + } + } + } + return comments; + }; + + // Shapes + spreadsheet_api.prototype.setStartPointHistory = function() { + this.noCreatePoint = true; + this.exucuteHistory = true; + this.asc_stopSaving(); + }; + + spreadsheet_api.prototype.setEndPointHistory = function() { + this.noCreatePoint = false; + this.exucuteHistoryEnd = true; + this.asc_continueSaving(); + }; + + spreadsheet_api.prototype.asc_startAddShape = function(sPreset) { + this.isStartAddShape = this.controller.isShapeAction = true; + var ws = this.wb.getWorksheet(); + ws.objectRender.controller.startTrackNewShape(sPreset); + }; + + spreadsheet_api.prototype.asc_endAddShape = function() { + this.isStartAddShape = false; + this.handlers.trigger("asc_onEndAddShape"); + }; + + spreadsheet_api.prototype.asc_isAddAutoshape = function() { + return this.isStartAddShape; + }; + + spreadsheet_api.prototype.asc_canAddShapeHyperlink = function() { + var ws = this.wb.getWorksheet(); + return ws.objectRender.controller.canAddHyperlink(); + }; + + spreadsheet_api.prototype.asc_canGroupGraphicsObjects = function() { + var ws = this.wb.getWorksheet(); + return ws.objectRender.controller.canGroup(); + }; + + spreadsheet_api.prototype.asc_groupGraphicsObjects = function() { + var ws = this.wb.getWorksheet(); + ws.objectRender.groupGraphicObjects(); + }; + + spreadsheet_api.prototype.asc_canUnGroupGraphicsObjects = function() { + var ws = this.wb.getWorksheet(); + return ws.objectRender.controller.canUnGroup(); + }; + + spreadsheet_api.prototype.asc_unGroupGraphicsObjects = function() { + var ws = this.wb.getWorksheet(); + ws.objectRender.unGroupGraphicObjects(); + }; + + spreadsheet_api.prototype.asc_changeShapeType = function(value) { + this.asc_setGraphicObjectProps(new asc_CImgProperty({ShapeProperties: {type: value}})); + }; + + spreadsheet_api.prototype.asc_getGraphicObjectProps = function() { + var ws = this.wb.getWorksheet(); + if (ws && ws.objectRender && ws.objectRender.controller) { + return ws.objectRender.controller.getGraphicObjectProps(); + } + return null; + }; + + spreadsheet_api.prototype.asc_setGraphicObjectProps = function(props) { + + var ws = this.wb.getWorksheet(); + var fReplaceCallback = null, sImageUrl = null; + if(!isNullOrEmptyString(props.ImageUrl)){ + if(!g_oDocumentUrls.getImageLocal(props.ImageUrl)){ + sImageUrl = props.ImageUrl; + fReplaceCallback = function(sLocalUrl){ + props.ImageUrl = sLocalUrl; + } + } + } + else if(props.ShapeProperties && props.ShapeProperties.fill && props.ShapeProperties.fill.fill && + !isNullOrEmptyString(props.ShapeProperties.fill.fill.url)){ + if(!g_oDocumentUrls.getImageLocal(props.ShapeProperties.fill.fill.url)){ + sImageUrl = props.ShapeProperties.fill.fill.url; + fReplaceCallback = function(sLocalUrl){ + props.ShapeProperties.fill.fill.url = sLocalUrl; + } + } + } + if(fReplaceCallback){ + var rData = { + "id": this.documentId, + "userid": this.documentUserId, + "vkey": this.documentVKey, + "c": "imgurl", + "saveindex": g_oDocumentUrls.getMaxIndex(), + "data": sImageUrl}; + + var t = this; + this.sync_StartAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.UploadImage); + this.fCurCallback = function(input) { + if (null != input && "imgurl" == input["type"]) { + if ("ok" == input["status"]) { + var data = input["data"]; + var urls = {}; + var firstUrl; + for (var i = 0; i < data.length; ++i) { + var elem = data[i]; + if (elem.url) { + if (!firstUrl) { + firstUrl = elem.url; + } + urls[elem.path] = elem.url; + } + } + g_oDocumentUrls.addUrls(urls); + if (firstUrl) { + fReplaceCallback(firstUrl); + ws.objectRender.setGraphicObjectProps(props); + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + } else { + t.handlers.trigger("asc_onError", g_fMapAscServerErrorToAscError(parseInt(input["data"])), c_oAscError.Level.NoCritical); + } + } else { + t.handlers.trigger("asc_onError", c_oAscError.ID.Unknown, c_oAscError.Level.NoCritical); + } + t.sync_EndAction(c_oAscAsyncActionType.BlockInteraction, c_oAscAsyncAction.UploadImage); + }; + sendCommand2(this, null, rData); + } + else{ + ws.objectRender.setGraphicObjectProps(props); + } + }; + + spreadsheet_api.prototype.asc_getOriginalImageSize = function() { + var ws = this.wb.getWorksheet(); + return ws.objectRender.getOriginalImageSize(); + }; + + spreadsheet_api.prototype.asc_setInterfaceDrawImagePlaceShape = function(elementId) { + this.shapeElementId = elementId; + }; + + spreadsheet_api.prototype.asc_setInterfaceDrawImagePlaceTextArt = function(elementId) { + this.textArtElementId = elementId; + }; + + spreadsheet_api.prototype.asc_changeImageFromFile = function() { + this.isImageChangeUrl = true; + this.asc_addImage(); + }; + + spreadsheet_api.prototype.asc_changeShapeImageFromFile = function() { + this.isShapeImageChangeUrl = true; + this.asc_addImage(); + }; + + spreadsheet_api.prototype.asc_changeArtImageFromFile = function() { + this.isTextArtChangeUrl = true; + this.asc_addImage(); + }; + + spreadsheet_api.prototype.asc_putPrLineSpacing = function(type, value) { + var ws = this.wb.getWorksheet(); + ws.objectRender.controller.putPrLineSpacing(type, value); + }; + + spreadsheet_api.prototype.asc_putLineSpacingBeforeAfter = function(type, value) { // "type == 0" means "Before", "type == 1" means "After" + var ws = this.wb.getWorksheet(); + ws.objectRender.controller.putLineSpacingBeforeAfter(type, value); + }; + + spreadsheet_api.prototype.asc_setDrawImagePlaceParagraph = function(element_id, props) { + var ws = this.wb.getWorksheet(); + ws.objectRender.setDrawImagePlaceParagraph(element_id, props); + }; + + spreadsheet_api.prototype.asyncImageEndLoaded = function(_image) { + if (this.wb) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.asyncImageEndLoaded) { + ws.objectRender.asyncImageEndLoaded(_image); + } + } + }; + + spreadsheet_api.prototype.asyncImagesDocumentEndLoaded = function() { + if (c_oAscAdvancedOptionsAction.None === this.advancedOptionsAction && this.wb && !window["NATIVE_EDITOR_ENJINE"]) { + var ws = this.wb.getWorksheet(); + ws.objectRender.showDrawingObjects(true); + ws.objectRender.controller.getGraphicObjectProps(); + } + }; + + spreadsheet_api.prototype.asyncImageEndLoadedBackground = function() { + var worksheet = this.wb.getWorksheet(); + if (worksheet && worksheet.objectRender) { + var drawing_area = worksheet.objectRender.drawingArea; + if (drawing_area) { + for (var i = 0; i < drawing_area.frozenPlaces.length; ++i) { + worksheet.objectRender.showDrawingObjects(false, new GraphicOption(worksheet, c_oAscGraphicOption.ScrollVertical, drawing_area.frozenPlaces[i].range, {offsetX: 0, offsetY: 0})); + worksheet.objectRender.controller && worksheet.objectRender.controller.getGraphicObjectProps(); + } + } + } + }; + + // Frozen pane + spreadsheet_api.prototype.asc_freezePane = function() { + this.wb.getWorksheet().freezePane(); + }; + + // Cell interface + spreadsheet_api.prototype.asc_getCellInfo = function(bExt) { + return this.wb.getWorksheet().getSelectionInfo(!!bExt); + }; + + // Получить координаты активной ячейки + spreadsheet_api.prototype.asc_getActiveCellCoord = function() { + return this.wb.getWorksheet().getActiveCellCoord(); + }; + + // Получить координаты для каких-либо действий (для общей схемы) + spreadsheet_api.prototype.asc_getAnchorPosition = function() { + return this.asc_getActiveCellCoord(); + }; + + // Получаем свойство: редактируем мы сейчас или нет + spreadsheet_api.prototype.asc_getCellEditMode = function() { + return this.wb ? this.wb.getCellEditMode() : false; + }; + + spreadsheet_api.prototype.asc_getIsTrackShape = function() { + return this.wb ? this.wb.getIsTrackShape() : false; + }; + + spreadsheet_api.prototype.asc_setCellFontName = function(fontName) { + var t = this, fonts = {}; + fonts[fontName] = 1; + t._loadFonts(fonts, function() { + var ws = t.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellFontName) { + ws.objectRender.controller.setCellFontName(fontName); + } else { + t.wb.setFontAttributes("fn", fontName); + t.wb.restoreFocus(); + } + }); + }; + + spreadsheet_api.prototype.asc_setCellFontSize = function(fontSize) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellFontSize) { + ws.objectRender.controller.setCellFontSize(fontSize); + } else { + this.wb.setFontAttributes("fs", fontSize); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellBold = function(isBold) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellBold) { + ws.objectRender.controller.setCellBold(isBold); + } else { + this.wb.setFontAttributes("b", isBold); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellItalic = function(isItalic) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellItalic) { + ws.objectRender.controller.setCellItalic(isItalic); + } else { + this.wb.setFontAttributes("i", isItalic); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellUnderline = function(isUnderline) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellUnderline) { + ws.objectRender.controller.setCellUnderline(isUnderline); + } else { + this.wb.setFontAttributes("u", isUnderline ? Asc.EUnderline.underlineSingle : Asc.EUnderline.underlineNone); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellStrikeout = function(isStrikeout) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellStrikeout) { + ws.objectRender.controller.setCellStrikeout(isStrikeout); + } else { + this.wb.setFontAttributes("s", isStrikeout); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellSubscript = function(isSubscript) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellSubscript) { + ws.objectRender.controller.setCellSubscript(isSubscript); + } else { + this.wb.setFontAttributes("fa", isSubscript ? "subscript" : "none"); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellSuperscript = function(isSuperscript) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellSuperscript) { + ws.objectRender.controller.setCellSuperscript(isSuperscript); + } else { + this.wb.setFontAttributes("fa", isSuperscript ? "superscript" : "none"); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellAlign = function(align) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellAlign) { + ws.objectRender.controller.setCellAlign(align); + } else { + this.wb.getWorksheet().setSelectionInfo("a", align); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellVertAlign = function(align) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellVertAlign) { + ws.objectRender.controller.setCellVertAlign(align); + } else { + this.wb.getWorksheet().setSelectionInfo("va", align); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellTextWrap = function(isWrapped) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellTextWrap) { + ws.objectRender.controller.setCellTextWrap(isWrapped); + } else { + this.wb.getWorksheet().setSelectionInfo("wrap", isWrapped); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellTextShrink = function(isShrinked) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellTextShrink) { + ws.objectRender.controller.setCellTextShrink(isShrinked); + } else { + this.wb.getWorksheet().setSelectionInfo("shrink", isShrinked); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellTextColor = function(color) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellTextColor) { + ws.objectRender.controller.setCellTextColor(color); + } else { + if (color instanceof asc_CColor) { + color = CorrectAscColor(color); + this.wb.setFontAttributes("c", color); + this.wb.restoreFocus(); + } + } + + }; + + spreadsheet_api.prototype.asc_setCellBackgroundColor = function(color) { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellBackgroundColor) { + ws.objectRender.controller.setCellBackgroundColor(color); + } else { + if (color instanceof asc_CColor || null == color) { + if (null != color) { + color = CorrectAscColor(color); + } + this.wb.getWorksheet().setSelectionInfo("bc", color); + this.wb.restoreFocus(); + } + } + }; + + spreadsheet_api.prototype.asc_setCellBorders = function(borders) { + this.wb.getWorksheet().setSelectionInfo("border", borders); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_setCellFormat = function(format) { + this.wb.getWorksheet().setSelectionInfo("format", format); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_setCellAngle = function(angle) { + + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.setCellAngle) { + ws.objectRender.controller.setCellAngle(angle); + } else { + this.wb.getWorksheet().setSelectionInfo("angle", angle); + this.wb.restoreFocus(); + } + }; + + spreadsheet_api.prototype.asc_setCellStyle = function(name) { + this.wb.getWorksheet().setSelectionInfo("style", name); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_increaseCellDigitNumbers = function() { + this.wb.getWorksheet().setSelectionInfo("changeDigNum", +1); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_decreaseCellDigitNumbers = function() { + this.wb.getWorksheet().setSelectionInfo("changeDigNum", -1); + this.wb.restoreFocus(); + }; + + // Увеличение размера шрифта + spreadsheet_api.prototype.asc_increaseFontSize = function() { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.increaseFontSize) { + ws.objectRender.controller.increaseFontSize(); + } else { + this.wb.changeFontSize("changeFontSize", true); + this.wb.restoreFocus(); + } + }; + + // Уменьшение размера шрифта + spreadsheet_api.prototype.asc_decreaseFontSize = function() { + var ws = this.wb.getWorksheet(); + if (ws.objectRender.selectedGraphicObjectsExists() && ws.objectRender.controller.decreaseFontSize) { + ws.objectRender.controller.decreaseFontSize(); + } else { + this.wb.changeFontSize("changeFontSize", false); + this.wb.restoreFocus(); + } + }; + + // Формат по образцу + spreadsheet_api.prototype.asc_formatPainter = function(stateFormatPainter) { + if (this.wb) { + this.wb.formatPainter(stateFormatPainter); + } + }; + + spreadsheet_api.prototype.asc_onMouseUp = function(event, x, y) { + this.controller._onWindowMouseUpExternal(event, x, y); + }; + + // + + spreadsheet_api.prototype.asc_selectFunction = function() { + + }; + + spreadsheet_api.prototype.asc_insertHyperlink = function(options) { + this.wb.insertHyperlink(options); + }; + + spreadsheet_api.prototype.asc_removeHyperlink = function() { + this.wb.removeHyperlink(); + }; + + spreadsheet_api.prototype.asc_insertFormula = function(functionName, type, autoComplete) { + this.wb.insertFormulaInEditor(functionName, type, autoComplete); + this.wb.restoreFocus(); + }; + + spreadsheet_api.prototype.asc_getFormulasInfo = function() { + return this.formulasList; + }; + spreadsheet_api.prototype.asc_getFormulaLocaleName = function(name) { + return cFormulaFunctionToLocale ? cFormulaFunctionToLocale[name] : name; + }; + + spreadsheet_api.prototype.asc_recalc = function(isRecalcWB) { + this.wbModel.recalcWB(isRecalcWB); + }; + + spreadsheet_api.prototype.asc_setFontRenderingMode = function(mode) { + if (mode !== this.fontRenderingMode) { + this.fontRenderingMode = mode; + if (this.wb) { + this.wb.setFontRenderingMode(mode, /*isInit*/false); + } + } + }; + + /** + * Режим выбора диапазона + * @param {c_oAscSelectionDialogType} selectionDialogType + * @param selectRange + */ + spreadsheet_api.prototype.asc_setSelectionDialogMode = function(selectionDialogType, selectRange) { + this.controller.setSelectionDialogMode(c_oAscSelectionDialogType.None !== selectionDialogType); + if (this.wb) { + this.wb._onStopFormatPainter(); + this.wb.setSelectionDialogMode(selectionDialogType, selectRange); + } + }; + + spreadsheet_api.prototype.asc_SendThemeColors = function(colors, standart_colors) { + this._gui_control_colors = { Colors: colors, StandartColors: standart_colors }; + var ret = this.handlers.trigger("asc_onSendThemeColors", colors, standart_colors); + if (false !== ret) { + this._gui_control_colors = null; + } + }; + + spreadsheet_api.prototype.asc_SendThemeColorSchemes = function(param) { + this._gui_color_schemes = param; + var ret = this.handlers.trigger("asc_onSendThemeColorSchemes", param); + if (false !== ret) { + this._gui_color_schemes = null; + } + }; + spreadsheet_api.prototype.asc_ChangeColorScheme = function(index_scheme) { + var t = this; + var onChangeColorScheme = function(res) { + if (res) { + var theme = t.wbModel.theme; + + var oldClrScheme = theme.themeElements.clrScheme; + var _count_defaults = g_oUserColorScheme.length; + if (index_scheme < _count_defaults) { + var _obj = g_oUserColorScheme[index_scheme]; + var scheme = new ClrScheme(); + scheme.name = _obj["name"]; + var _c; + + _c = _obj["dk1"]; + scheme.colors[8] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["lt1"]; + scheme.colors[12] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["dk2"]; + scheme.colors[9] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["lt2"]; + scheme.colors[13] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent1"]; + scheme.colors[0] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent2"]; + scheme.colors[1] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent3"]; + scheme.colors[2] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent4"]; + scheme.colors[3] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent5"]; + scheme.colors[4] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["accent6"]; + scheme.colors[5] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["hlink"]; + scheme.colors[11] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + _c = _obj["folHlink"]; + scheme.colors[10] = CreateUniColorRGB(_c["R"], _c["G"], _c["B"]); + + theme.themeElements.clrScheme = scheme; + } else { + index_scheme -= _count_defaults; + + if (index_scheme < 0 || index_scheme >= theme.extraClrSchemeLst.length) { + return; + } + + theme.themeElements.clrScheme = theme.extraClrSchemeLst[index_scheme].clrScheme.createDuplicate(); + } + History.Create_NewPoint(); + //не делаем Duplicate потому что предполагаем что схема не будет менять частями, а только обьектом целиком. + History.Add(g_oUndoRedoWorkbook, historyitem_Workbook_ChangeColorScheme, null, null, new UndoRedoData_ClrScheme(oldClrScheme, theme.themeElements.clrScheme)); + t.asc_AfterChangeColorScheme(); + } + }; + // ToDo поправить заглушку, сделать новый тип lock element-а + var sheetId = -1; // Делаем не существующий лист и не существующий объект + var lockInfo = this.collaborativeEditing.getLockInfo(c_oAscLockTypeElem.Object, /*subType*/null, sheetId, sheetId); + this._getIsLockObjectSheet(lockInfo, onChangeColorScheme); + }; + spreadsheet_api.prototype.asc_AfterChangeColorScheme = function() { + this.wbModel.rebuildColors(); + this.asc_CheckGuiControlColors(); + this.asc_ApplyColorScheme(true); + }; + spreadsheet_api.prototype.asc_ApplyColorScheme = function(bRedraw) { + + if (!window["NATIVE_EDITOR_ENJINE"]) { + var wsViews = Asc["editor"].wb.wsViews; + for (var i = 0; i < wsViews.length; ++i) { + if (wsViews[i] && wsViews[i].objectRender && wsViews[i].objectRender.controller) { + wsViews[i].objectRender.controller.startRecalculate(); + } + } + this.chartPreviewManager.clearPreviews(); + this.textArtPreviewManager.clear(); + } + + // На view-режиме не нужно отправлять стили + if (true !== this.getViewMode() && !this.isMobileVersion) { + // Отправка стилей + this._sendWorkbookStyles(); + } + + if (bRedraw) { + this.handlers.trigger("asc_onUpdateChartStyles"); + this.wb.drawWS(); + } + }; + + ///////////////////////////////////////////////////////////////////////// + ////////////////////////////AutoSave api///////////////////////////////// + ///////////////////////////////////////////////////////////////////////// + spreadsheet_api.prototype._autoSave = function() { + if ((0 === this.autoSaveGap && (!this.collaborativeEditing.getFast() || !this.collaborativeEditing.getCollaborativeEditing())) + || this.asc_getCellEditMode() || this.asc_getIsTrackShape() || this.isOpenedChartFrame || + !History.IsEndTransaction() || !this.canSave) { + return; + } + if (!History.Is_Modified(true) && !(this.collaborativeEditing.getCollaborativeEditing() && 0 !== this.collaborativeEditing.getOwnLocksLength())) { + if (this.collaborativeEditing.getFast() && this.collaborativeEditing.haveOtherChanges()) { + CollaborativeEditing.Clear_CollaborativeMarks(); + + // Принимаем чужие изменения + this.collaborativeEditing.applyChanges(); + // Пересылаем свои изменения (просто стираем чужие lock-и, т.к. своих изменений нет) + this.collaborativeEditing.sendChanges(); + // Шлем update для toolbar-а, т.к. когда select в lock ячейке нужно заблокировать toolbar + this.wb._onWSSelectionChanged(/*info*/null); + } + return; + } + if (null === this.lastSaveTime) { + this.lastSaveTime = new Date(); + return; + } + var saveGap = this.collaborativeEditing.getFast() ? this.autoSaveGapRealTime : + (this.collaborativeEditing.getCollaborativeEditing() ? this.autoSaveGapSlow : this.autoSaveGapFast); + var gap = new Date() - this.lastSaveTime - saveGap; + if (0 <= gap) { + this.asc_Save(true); + } + }; + + spreadsheet_api.prototype._onUpdateDocumentCanSave = function() { + // Можно модифицировать это условие на более быстрое (менять самим состояние в аргументах, а не запрашивать каждый раз) + var tmp = History.Is_Modified() || (this.collaborativeEditing.getCollaborativeEditing() && 0 !== this.collaborativeEditing.getOwnLocksLength()); + if (tmp !== this.isDocumentCanSave) { + this.isDocumentCanSave = tmp; + this.handlers.trigger('asc_onDocumentCanSaveChanged', this.isDocumentCanSave); + } + }; + + spreadsheet_api.prototype._onCheckCommentRemoveLock = function(lockElem) { + var res = false; + var sheetId = lockElem["sheetId"]; + if (-1 !== sheetId && 0 === sheetId.indexOf(CCellCommentator.sStartCommentId)) { + // Коммментарий + res = true; + this.handlers.trigger("asc_onUnLockComment", lockElem["rangeOrObjectId"]); + } + return res; + }; + + spreadsheet_api.prototype.onUpdateDocumentModified = function(bIsModified) { + // Обновляем только после окончания сохранения + if (this.canSave) { + this.handlers.trigger("asc_onDocumentModifiedChanged", bIsModified); + this._onUpdateDocumentCanSave(); + + if (undefined !== window["AscDesktopEditor"]) { + window["AscDesktopEditor"]["onDocumentModifiedChanged"](bIsModified); + } + } + }; + + // Выставление локали + spreadsheet_api.prototype.asc_setLocalization = function(oLocalizedData) { + if (null == oLocalizedData) { + cFormulaFunctionLocalized = null; + cFormulaFunctionToLocale = null; + } else { + cFormulaFunctionLocalized = {}; + cFormulaFunctionToLocale = {}; + var localName; + for (var i in cFormulaFunction) { + localName = oLocalizedData[i] ? oLocalizedData[i]['n'] : null; + localName = localName ? localName : i; + cFormulaFunctionLocalized[localName] = cFormulaFunction[i]; + cFormulaFunctionToLocale[i] = localName; + } + } + build_local_rx(oLocalizedData?oLocalizedData["LocalFormulaOperands"]:null); + if (this.wb) { + this.wb.initFormulasList(); + } + if (this.wbModel) { + this.wbModel.rebuildColors(); + } + }; + + spreadsheet_api.prototype.asc_nativeOpenFile = function(base64File, version) { + asc["editor"] = this; + + this.SpellCheckUrl = ''; + + this.User = new asc.asc_CUser(); + this.User.setId("TM"); + this.User.setUserName("native"); + + this.wbModel = new Workbook(this.handlers, this); + this.initGlobalObjects(this.wbModel); + + var oBinaryFileReader = new Asc.BinaryFileReader(); + + if (undefined === version) { + oBinaryFileReader.Read(base64File, this.wbModel); + } else { + g_nCurFileVersion = version; + oBinaryFileReader.ReadData(base64File, this.wbModel); + } + g_oIdCounter.Set_Load(false); + + this._coAuthoringInit(); + this.wb = new asc.WorkbookView(this.wbModel, this.controller, this.handlers, window["_null_object"], window["_null_object"], this, this.collaborativeEditing, this.fontRenderingMode); + }; + + spreadsheet_api.prototype.asc_nativeCalculateFile = function() { + window['DoctRendererMode'] = true; + this.wb._nativeCalculate(); + }; + + spreadsheet_api.prototype.asc_nativeApplyChanges = function(changes) { + for (var i = 0, l = changes.length; i < l; ++i) { + this.CoAuthoringApi.onSaveChanges(changes[i], null, true); + } + this.collaborativeEditing.applyChanges(); + }; + + spreadsheet_api.prototype.asc_nativeApplyChanges2 = function(data, isFull) { + if (null != this.wbModel) { + this.oRedoObjectParamNative = this.wbModel.DeserializeHistoryNative(this.oRedoObjectParamNative, data, isFull); + } + if (isFull) { + this._onUpdateAfterApplyChanges(); + } + }; + + spreadsheet_api.prototype.asc_nativeGetFile = function() { + this.wb._initCommentsToSave(); + var oBinaryFileWriter = new Asc.BinaryFileWriter(this.wbModel); + return oBinaryFileWriter.Write(); + }; + spreadsheet_api.prototype.asc_nativeGetFileData = function() { + this.wb._initCommentsToSave(); + var oBinaryFileWriter = new Asc.BinaryFileWriter(this.wbModel); + oBinaryFileWriter.Write2(); + + var _header = oBinaryFileWriter.WriteFileHeader(oBinaryFileWriter.Memory.GetCurPosition()); + window["native"]["Save_End"](_header, oBinaryFileWriter.Memory.GetCurPosition()); + + return oBinaryFileWriter.Memory.ImData.data; + }; + + spreadsheet_api.prototype.asc_nativeCheckPdfRenderer = function(_memory1, _memory2) { + if (true) { + // pos не должен минимизироваться!!! + + _memory1.Copy = _memory1["Copy"]; + _memory1.ClearNoAttack = _memory1["ClearNoAttack"]; + _memory1.WriteByte = _memory1["WriteByte"]; + _memory1.WriteBool = _memory1["WriteBool"]; + _memory1.WriteLong = _memory1["WriteLong"]; + _memory1.WriteDouble = _memory1["WriteDouble"]; + _memory1.WriteString = _memory1["WriteString"]; + _memory1.WriteString2 = _memory1["WriteString2"]; + + _memory2.Copy = _memory1["Copy"]; + _memory2.ClearNoAttack = _memory1["ClearNoAttack"]; + _memory2.WriteByte = _memory1["WriteByte"]; + _memory2.WriteBool = _memory1["WriteBool"]; + _memory2.WriteLong = _memory1["WriteLong"]; + _memory2.WriteDouble = _memory1["WriteDouble"]; + _memory2.WriteString = _memory1["WriteString"]; + _memory2.WriteString2 = _memory1["WriteString2"]; + } + + var _printer = new CPdfPrinter(); + _printer.DocumentRenderer.Memory = _memory1; + _printer.DocumentRenderer.VectorMemoryForPrint = _memory2; + return _printer; + }; + + spreadsheet_api.prototype.asc_nativeCalculate = function() { + }; + + spreadsheet_api.prototype.asc_nativePrint = function(_printer, _page, _param) { + var _adjustPrint = window.AscDesktopEditor_PrintData ? window.AscDesktopEditor_PrintData : new asc_CAdjustPrint(); + window.AscDesktopEditor_PrintData = undefined; + + if (1 == _param) + { + _adjustPrint.asc_setPrintType(c_oAscPrintType.EntireWorkbook); + _adjustPrint.asc_setFitToWidth(true); + _adjustPrint.asc_setFitToHeight(true); + } + + var _printPagesData = this.wb.calcPagesPrint(_adjustPrint); + + if (undefined === _printer && _page === undefined) { + var pdf_writer = new CPdfPrinter(); + var isEndPrint = this.wb.printSheet(pdf_writer, _printPagesData); + + if (undefined !== window["AscDesktopEditor"]) { + var pagescount = pdf_writer.DocumentRenderer.m_lPagesCount; + + window["AscDesktopEditor"]["Print_Start"](this.documentId + "/", pagescount, "", -1); + + for (var i = 0; i < pagescount; i++) { + var _start = pdf_writer.DocumentRenderer.m_arrayPages[i].StartOffset; + var _end = pdf_writer.DocumentRenderer.Memory.pos; + if (i != (pagescount - 1)) { + _end = pdf_writer.DocumentRenderer.m_arrayPages[i + 1].StartOffset; + } + + window["AscDesktopEditor"]["Print_Page"](pdf_writer.DocumentRenderer.Memory.GetBase64Memory2(_start, _end - _start), pdf_writer.DocumentRenderer.m_arrayPages[i].Width, pdf_writer.DocumentRenderer.m_arrayPages[i].Height); + } + + window["AscDesktopEditor"]["Print_End"](); + } + return pdf_writer.DocumentRenderer.Memory; + } + + var isEndPrint = this.wb.printSheet(_printer, _printPagesData); + return _printer.DocumentRenderer.Memory; + }; + + spreadsheet_api.prototype.asc_nativePrintPagesCount = function() { + return 1; + }; + + spreadsheet_api.prototype.asc_nativeGetPDF = function(_param) { + var _ret = this.asc_nativePrint(undefined, undefined, _param); + + window["native"]["Save_End"]("", _ret.GetCurPosition()); + return _ret.data; + }; + /* + * Export + * ----------------------------------------------------------------------------- + */ + + window["AscDesktopEditor_Save"] = function() { + return window["Asc"]["editor"].asc_Save(false); + }; + + asc["spreadsheet_api"] = spreadsheet_api; + prot = spreadsheet_api.prototype; + + prot["asc_GetFontThumbnailsPath"] = prot.asc_GetFontThumbnailsPath; + prot["asc_SetFontsPath"] = prot.asc_SetFontsPath; + prot["asc_setDocInfo"] = prot.asc_setDocInfo; + prot["asc_getLocaleExample"] = prot.asc_getLocaleExample; + prot["asc_getLocaleCurrency"] = prot.asc_getLocaleCurrency; + prot["asc_setLocale"] = prot.asc_setLocale; + prot["asc_getEditorPermissions"] = prot.asc_getEditorPermissions; + prot["asc_LoadDocument"] = prot.asc_LoadDocument; + prot["asc_LoadEmptyDocument"] = prot.asc_LoadEmptyDocument; + prot["asc_DownloadAs"] = prot.asc_DownloadAs; + prot["asc_Save"] = prot.asc_Save; + prot["asc_Print"] = prot.asc_Print; + prot["asc_Resize"] = prot.asc_Resize; + prot["asc_Copy"] = prot.asc_Copy; + prot["asc_Paste"] = prot.asc_Paste; + prot["asc_Cut"] = prot.asc_Cut; + prot["asc_Undo"] = prot.asc_Undo; + prot["asc_Redo"] = prot.asc_Redo; + + prot["asc_getDocumentName"] = prot.asc_getDocumentName; + prot["asc_isDocumentModified"] = prot.asc_isDocumentModified; + prot["asc_isDocumentCanSave"] = prot.asc_isDocumentCanSave; + prot["asc_getCanUndo"] = prot.asc_getCanUndo; + prot["asc_getCanRedo"] = prot.asc_getCanRedo; + + prot["asc_setAutoSaveGap"] = prot.asc_setAutoSaveGap; + + prot["asc_setMobileVersion"] = prot.asc_setMobileVersion; + prot["asc_setViewMode"] = prot.asc_setViewMode; + prot["asc_setUseEmbeddedCutFonts"] = prot.asc_setUseEmbeddedCutFonts; + prot["asc_setAdvancedOptions"] = prot.asc_setAdvancedOptions; + prot["asc_setPageOptions"] = prot.asc_setPageOptions; + prot["asc_getPageOptions"] = prot.asc_getPageOptions; + + prot["asc_registerCallback"] = prot.asc_registerCallback; + prot["asc_unregisterCallback"] = prot.asc_unregisterCallback; + + prot["asc_getController"] = prot.asc_getController; + prot["asc_changeArtImageFromFile"] = prot.asc_changeArtImageFromFile; + + prot["asc_SetDocumentPlaceChangedEnabled"] = prot.asc_SetDocumentPlaceChangedEnabled; + prot["asc_SetFastCollaborative"] = prot.asc_SetFastCollaborative; + + // Workbook interface + + prot["asc_getWorksheetsCount"] = prot.asc_getWorksheetsCount; + prot["asc_getWorksheetName"] = prot.asc_getWorksheetName; + prot["asc_getWorksheetTabColor"] = prot.asc_getWorksheetTabColor; + prot["asc_setWorksheetTabColor"] = prot.asc_setWorksheetTabColor; + prot["asc_getActiveWorksheetIndex"] = prot.asc_getActiveWorksheetIndex; + prot["asc_getActiveWorksheetId"] = prot.asc_getActiveWorksheetId; + prot["asc_getWorksheetId"] = prot.asc_getWorksheetId; + prot["asc_isWorksheetHidden"] = prot.asc_isWorksheetHidden; + prot["asc_isWorksheetLockedOrDeleted"] = prot.asc_isWorksheetLockedOrDeleted; + prot["asc_isWorkbookLocked"] = prot.asc_isWorkbookLocked; + prot["asc_getHiddenWorksheets"] = prot.asc_getHiddenWorksheets; + prot["asc_showWorksheet"] = prot.asc_showWorksheet; + prot["asc_showActiveWorksheet"] = prot.asc_showActiveWorksheet; + prot["asc_hideWorksheet"] = prot.asc_hideWorksheet; + prot["asc_renameWorksheet"] = prot.asc_renameWorksheet; + prot["asc_addWorksheet"] = prot.asc_addWorksheet; + prot["asc_insertWorksheet"] = prot.asc_insertWorksheet; + prot["asc_deleteWorksheet"] = prot.asc_deleteWorksheet; + prot["asc_moveWorksheet"] = prot.asc_moveWorksheet; + prot["asc_copyWorksheet"] = prot.asc_copyWorksheet; + prot["asc_cleanSelection"] = prot.asc_cleanSelection; + prot["asc_getZoom"] = prot.asc_getZoom; + prot["asc_setZoom"] = prot.asc_setZoom; + prot["asc_enableKeyEvents"] = prot.asc_enableKeyEvents; + prot["asc_searchEnabled"] = prot.asc_searchEnabled; + prot["asc_findText"] = prot.asc_findText; + prot["asc_replaceText"] = prot.asc_replaceText; + prot["asc_endFindText"] = prot.asc_endFindText; + prot["asc_findCell"] = prot.asc_findCell; + prot["asc_closeCellEditor"] = prot.asc_closeCellEditor; + + // Spreadsheet interface + + prot["asc_getColumnWidth"] = prot.asc_getColumnWidth; + prot["asc_setColumnWidth"] = prot.asc_setColumnWidth; + prot["asc_showColumns"] = prot.asc_showColumns; + prot["asc_hideColumns"] = prot.asc_hideColumns; + prot["asc_getRowHeight"] = prot.asc_getRowHeight; + prot["asc_setRowHeight"] = prot.asc_setRowHeight; + prot["asc_showRows"] = prot.asc_showRows; + prot["asc_hideRows"] = prot.asc_hideRows; + prot["asc_insertCells"] = prot.asc_insertCells; + prot["asc_deleteCells"] = prot.asc_deleteCells; + prot["asc_mergeCells"] = prot.asc_mergeCells; + prot["asc_sortCells"] = prot.asc_sortCells; + prot["asc_emptyCells"] = prot.asc_emptyCells; + prot["asc_mergeCellsDataLost"] = prot.asc_mergeCellsDataLost; + prot["asc_getSheetViewSettings"] = prot.asc_getSheetViewSettings; + prot["asc_setSheetViewSettings"] = prot.asc_setSheetViewSettings; + + // Defined Names + prot["asc_getDefinedNames"] = prot.asc_getDefinedNames; + prot["asc_setDefinedNames"] = prot.asc_setDefinedNames; + prot["asc_editDefinedNames"] = prot.asc_editDefinedNames; + prot["asc_delDefinedNames"] = prot.asc_delDefinedNames; + prot["asc_getDefaultDefinedName"] = prot.asc_getDefaultDefinedName; + prot["asc_checkDefinedName"] = prot.asc_checkDefinedName; + + // Auto filters interface + prot["asc_addAutoFilter"] = prot.asc_addAutoFilter; + prot["asc_changeAutoFilter"] = prot.asc_changeAutoFilter; + prot["asc_applyAutoFilter"] = prot.asc_applyAutoFilter; + prot["asc_sortColFilter"] = prot.asc_sortColFilter; + prot["asc_getAddFormatTableOptions"] = prot.asc_getAddFormatTableOptions; + prot["asc_clearFilter"] = prot.asc_clearFilter; + + // Drawing objects interface + + prot["asc_showDrawingObjects"] = prot.asc_showDrawingObjects; + prot["asc_setChartTranslate"] = prot.asc_setChartTranslate; + prot["asc_setTextArtTranslate"] = prot.asc_setTextArtTranslate; + prot["asc_drawingObjectsExist"] = prot.asc_drawingObjectsExist; + prot["asc_getChartObject"] = prot.asc_getChartObject; + prot["asc_addChartDrawingObject"] = prot.asc_addChartDrawingObject; + prot["asc_editChartDrawingObject"] = prot.asc_editChartDrawingObject; + prot["asc_addImageDrawingObject"] = prot.asc_addImageDrawingObject; + prot["asc_setSelectedDrawingObjectLayer"] = prot.asc_setSelectedDrawingObjectLayer; + prot["asc_getChartPreviews"] = prot.asc_getChartPreviews; + prot["asc_getTextArtPreviews"] = prot.asc_getTextArtPreviews; + prot["asc_checkDataRange"] = prot.asc_checkDataRange; + prot["asc_getBinaryFileWriter"] = prot.asc_getBinaryFileWriter; + prot["asc_getWordChartObject"] = prot.asc_getWordChartObject; + prot["asc_cleanWorksheet"] = prot.asc_cleanWorksheet; + prot["asc_showImageFileDialog"] = prot.asc_showImageFileDialog; + prot["asc_addImage"] = prot.asc_addImage; + prot["asc_setData"] = prot.asc_setData; + prot["asc_getData"] = prot.asc_getData; + prot["asc_onCloseChartFrame"] = prot.asc_onCloseChartFrame; + + // Cell comment interface + prot["asc_addComment"] = prot.asc_addComment; + prot["asc_changeComment"] = prot.asc_changeComment; + prot["asc_findComment"] = prot.asc_findComment; + prot["asc_removeComment"] = prot.asc_removeComment; + prot["asc_showComment"] = prot.asc_showComment; + prot["asc_selectComment"] = prot.asc_selectComment; + + prot["asc_showComments"] = prot.asc_showComments; + prot["asc_hideComments"] = prot.asc_hideComments; + + prot["asc_getComments"] = prot.asc_getComments; + prot["asc_getDocumentComments"] = prot.asc_getDocumentComments; + prot["asc_getWorkbookComments"] = prot.asc_getWorkbookComments; + + // Shapes + prot["setStartPointHistory"] = prot.setStartPointHistory; + prot["setEndPointHistory"] = prot.setEndPointHistory; + prot["asc_startAddShape"] = prot.asc_startAddShape; + prot["asc_endAddShape"] = prot.asc_endAddShape; + prot["asc_isAddAutoshape"] = prot.asc_isAddAutoshape; + prot["asc_canAddShapeHyperlink"] = prot.asc_canAddShapeHyperlink; + prot["asc_canGroupGraphicsObjects"] = prot.asc_canGroupGraphicsObjects; + prot["asc_groupGraphicsObjects"] = prot.asc_groupGraphicsObjects; + prot["asc_canUnGroupGraphicsObjects"] = prot.asc_canUnGroupGraphicsObjects; + prot["asc_unGroupGraphicsObjects"] = prot.asc_unGroupGraphicsObjects; + prot["asc_getGraphicObjectProps"] = prot.asc_getGraphicObjectProps; + prot["asc_setGraphicObjectProps"] = prot.asc_setGraphicObjectProps; + prot["asc_getOriginalImageSize"] = prot.asc_getOriginalImageSize; + prot["asc_changeShapeType"] = prot.asc_changeShapeType; + prot["asc_setInterfaceDrawImagePlaceShape"] = prot.asc_setInterfaceDrawImagePlaceShape; + prot["asc_setInterfaceDrawImagePlaceTextArt"] = prot.asc_setInterfaceDrawImagePlaceTextArt; + prot["asc_changeImageFromFile"] = prot.asc_changeImageFromFile; + prot["asc_putPrLineSpacing"] = prot.asc_putPrLineSpacing; + prot["asc_addTextArt"] = prot.asc_addTextArt; + prot["asc_putLineSpacingBeforeAfter"] = prot.asc_putLineSpacingBeforeAfter; + prot["asc_setDrawImagePlaceParagraph"] = prot.asc_setDrawImagePlaceParagraph; + prot["asc_changeShapeImageFromFile"] = prot.asc_changeShapeImageFromFile; + + // Frozen pane + prot["asc_freezePane"] = prot.asc_freezePane; + + // Cell interface + prot["asc_getCellInfo"] = prot.asc_getCellInfo; + prot["asc_getActiveCellCoord"] = prot.asc_getActiveCellCoord; + prot["asc_getAnchorPosition"] = prot.asc_getAnchorPosition; + prot["asc_setCellFontName"] = prot.asc_setCellFontName; + prot["asc_setCellFontSize"] = prot.asc_setCellFontSize; + prot["asc_setCellBold"] = prot.asc_setCellBold; + prot["asc_setCellItalic"] = prot.asc_setCellItalic; + prot["asc_setCellUnderline"] = prot.asc_setCellUnderline; + prot["asc_setCellStrikeout"] = prot.asc_setCellStrikeout; + prot["asc_setCellSubscript"] = prot.asc_setCellSubscript; + prot["asc_setCellSuperscript"] = prot.asc_setCellSuperscript; + prot["asc_setCellAlign"] = prot.asc_setCellAlign; + prot["asc_setCellVertAlign"] = prot.asc_setCellVertAlign; + prot["asc_setCellTextWrap"] = prot.asc_setCellTextWrap; + prot["asc_setCellTextShrink"] = prot.asc_setCellTextShrink; + prot["asc_setCellTextColor"] = prot.asc_setCellTextColor; + prot["asc_setCellBackgroundColor"] = prot.asc_setCellBackgroundColor; + prot["asc_setCellBorders"] = prot.asc_setCellBorders; + prot["asc_setCellFormat"] = prot.asc_setCellFormat; + prot["asc_setCellAngle"] = prot.asc_setCellAngle; + prot["asc_setCellStyle"] = prot.asc_setCellStyle; + prot["asc_increaseCellDigitNumbers"] = prot.asc_increaseCellDigitNumbers; + prot["asc_decreaseCellDigitNumbers"] = prot.asc_decreaseCellDigitNumbers; + prot["asc_increaseFontSize"] = prot.asc_increaseFontSize; + prot["asc_decreaseFontSize"] = prot.asc_decreaseFontSize; + prot["asc_formatPainter"] = prot.asc_formatPainter; + + prot["asc_onMouseUp"] = prot.asc_onMouseUp; + + prot["asc_selectFunction"] = prot.asc_selectFunction; + prot["asc_insertHyperlink"] = prot.asc_insertHyperlink; + prot["asc_removeHyperlink"] = prot.asc_removeHyperlink; + prot["asc_insertFormula"] = prot.asc_insertFormula; + prot["asc_getFormulasInfo"] = prot.asc_getFormulasInfo; + prot["asc_getFormulaLocaleName"] = prot.asc_getFormulaLocaleName; + prot["asc_setFontRenderingMode"] = prot.asc_setFontRenderingMode; + prot["asc_setSelectionDialogMode"] = prot.asc_setSelectionDialogMode; + prot["asc_ChangeColorScheme"] = prot.asc_ChangeColorScheme; + ///////////////////////////////////////////////////////////////////////// + ///////////////////CoAuthoring and Chat api////////////////////////////// + ///////////////////////////////////////////////////////////////////////// + prot["asc_coAuthoringChatSendMessage"] = prot.asc_coAuthoringChatSendMessage; + prot["asc_coAuthoringGetUsers"] = prot.asc_coAuthoringGetUsers; + prot["asc_coAuthoringChatGetMessages"] = prot.asc_coAuthoringChatGetMessages; + prot["asc_coAuthoringDisconnect"] = prot.asc_coAuthoringDisconnect; + + // other + prot["asc_stopSaving"] = prot.asc_stopSaving; + prot["asc_continueSaving"] = prot.asc_continueSaving; + + // Version History + prot["asc_showRevision"] = prot.asc_showRevision; + prot["asc_undoAllChanges"] = prot.asc_undoAllChanges; + + prot["asc_setLocalization"] = prot.asc_setLocalization; + + // native + prot["asc_nativeOpenFile"] = prot.asc_nativeOpenFile; + prot["asc_nativeCalculateFile"] = prot.asc_nativeCalculateFile; + prot["asc_nativeApplyChanges"] = prot.asc_nativeApplyChanges; + prot["asc_nativeApplyChanges2"] = prot.asc_nativeApplyChanges2; + prot["asc_nativeGetFile"] = prot.asc_nativeGetFile; + prot["asc_nativeGetFileData"] = prot.asc_nativeGetFileData; + prot["asc_nativeCheckPdfRenderer"] = prot.asc_nativeCheckPdfRenderer; + prot["asc_nativeCalculate"] = prot.asc_nativeCalculate; + prot["asc_nativePrint"] = prot.asc_nativePrint; + prot["asc_nativePrintPagesCount"] = prot.asc_nativePrintPagesCount; + prot["asc_nativeGetPDF"] = prot.asc_nativeGetPDF; + + prot['asc_isOffline'] = prot.asc_isOffline; + prot['asc_getUrlType'] = prot.asc_getUrlType; +})(jQuery, window); diff --git a/sdk/Excel/apiDefines.js b/sdk/Excel/apiDefines.js new file mode 100644 index 000000000..86c82672b --- /dev/null +++ b/sdk/Excel/apiDefines.js @@ -0,0 +1,356 @@ +"use strict"; + +// Используем [] вместо new Array() для ускорения (http://jsperf.com/creation-array) +// Используем {} вместо new Object() для ускорения (http://jsperf.com/creation-object) +var c_oAscError = { + Level: { + Critical: -1, + NoCritical: 0 + }, + ID: { + ServerSaveComplete: 3, + ConvertationProgress: 2, + DownloadProgress: 1, + No: 0, + Unknown: -1, + ConvertationTimeout: -2, + ConvertationError: -3, + DownloadError: -4, + UnexpectedGuid: -5, + Database: -6, + FileRequest: -7, + FileVKey: -8, + UplImageSize: -9, + UplImageExt: -10, + UplImageFileCount: -11, + NoSupportClipdoard: -12, + PastInMergeAreaError: -13, + StockChartError: -14, + DataRangeError: -15, + CannotMoveRange: -16, + UplImageUrl: -17, + CoAuthoringDisconnect: -18, + ConvertationPassword: -19, + + VKeyEncrypt: -20, + KeyExpire: -21, + UserCountExceed: -22, + + /* для формул */ + FrmlWrongCountParentheses: -300, + FrmlWrongOperator: -301, + FrmlWrongMaxArgument: -302, + FrmlWrongCountArgument: -303, + FrmlWrongFunctionName: -304, + FrmlAnotherParsingError: -305, + FrmlWrongArgumentRange: -306, + FrmlOperandExpected: -307, + FrmlParenthesesCorrectCount: -308, + FrmlWrongReferences: -309, + + InvalidReferenceOrName: -310, + LockCreateDefName: -311, + + + AutoFilterDataRangeError: -50, + AutoFilterChangeFormatTableError: -51, + AutoFilterChangeError: -52, + AutoFilterMoveToHiddenRangeError: -53, + LockedAllError: -54, + LockedWorksheetRename: -55, + + PasteMaxRangeError: -65, + + MaxDataSeriesError: -80, + CannotFillRange: -81, + + UserDrop: -100, + Warning: -101, + + OpenWarning: 500 + } +}; +var c_oAscConfirm = { + ConfirmReplaceRange: 0 +}; + +var c_oAscAlignType = { + NONE: "none", + LEFT: "left", + CENTER: "center", + RIGHT: "right", + JUSTIFY: "justify", + TOP: "top", + MIDDLE: "center", + BOTTOM: "bottom" +}; + +var c_oAscMergeOptions = { + Unmerge: 0, + Merge: 1, + MergeCenter: 2, + MergeAcross: 3 +}; + +var c_oAscSortOptions = { + Ascending: 1, + Descending: 2 +}; + +var c_oAscInsertOptions = { + InsertCellsAndShiftRight: 1, + InsertCellsAndShiftDown: 2, + InsertColumns: 3, + InsertRows: 4 +}; + +var c_oAscDeleteOptions = { + DeleteCellsAndShiftLeft: 1, + DeleteCellsAndShiftTop: 2, + DeleteColumns: 3, + DeleteRows: 4 +}; + +var c_oAscBorderOptions = { + Top: 0, + Right: 1, + Bottom: 2, + Left: 3, + DiagD: 4, + DiagU: 5, + InnerV: 6, + InnerH: 7 +}; + +var c_oAscCleanOptions = { + All: 0, + Text: 1, + Format: 2, + Formula: 4, + Comments: 5, + Hyperlinks: 6 +}; + +var c_oAscDrawDepOptions = { + Master: 0, + Slave: 1, + Clear: 2 +}; + +// selection type +var c_oAscSelectionType = { + RangeCells: 1, + RangeCol: 2, + RangeRow: 3, + RangeMax: 4, + RangeImage: 5, + RangeChart: 6, + RangeShape: 7, + RangeShapeText: 8, + RangeChartText: 9, + RangeFrozen: 10 +}; + +var c_oAscSelectionDialogType = { + None: 0, + FormatTable: 1, + Chart: 2, + DefinedName: 3 +}; + +var c_oAscGraphicOption = { + ScrollVertical: 1, + ScrollHorizontal: 2 +}; + +var c_oAscHyperlinkType = { + WebLink: 1, + RangeLink: 2 +}; + +var c_oAscMouseMoveType = { + None: 0, + Hyperlink: 1, + Comment: 2, + LockedObject: 3, + ResizeColumn: 4, + ResizeRow: 5 +}; + +var c_oAscMouseMoveLockedObjectType = { + None: -1, + Range: 0, + TableProperties: 1, + Sheet: 2 +}; + +// Print default options (in mm) +var c_oAscPrintDefaultSettings = { + // Размеры страницы при печати + PageWidth: 210, + PageHeight: 297, + PageOrientation: c_oAscPageOrientation.PagePortrait, + + // Поля для страницы при печати + PageLeftField: 17.8, + PageRightField: 17.8, + PageTopField: 19.1, + PageBottomField: 19.1, + + PageGridLines: 0, + PageHeadings: 0 +}; + +var c_oAscLockTypeElem = { + Range: 1, + Object: 2, + Sheet: 3 +}; + +var c_oAscLockTypeElemSubType = { + DeleteColumns: 1, + InsertColumns: 2, + DeleteRows: 3, + InsertRows: 4, + ChangeProperties: 5, + DefinedNames: 6 +}; + +var c_oAscRecalcIndexTypes = { + RecalcIndexAdd: 1, + RecalcIndexRemove: 2 +}; + +// Тип печати +var c_oAscPrintType = { + ActiveSheets: 0, // Активные листы + EntireWorkbook: 1, // Всю книгу + Selection: 2 // Выделенный фрагмент +}; +// Тип печати +var c_oAscLayoutPageType = { + FitToWidth: 0, // На всю ширину + ActualSize: 1 // По реальным размерам +}; + +/** @enum */ +var c_oAscCustomAutoFilter = { + equals: 1, + isGreaterThan: 2, + isGreaterThanOrEqualTo: 3, + isLessThan: 4, + isLessThanOrEqualTo: 5, + doesNotEqual: 6, + beginsWith: 7, + doesNotBeginWith: 8, + endsWith: 9, + doesNotEndWith: 10, + contains: 11, + doesNotContain: 12 +}; + +var c_oAscChangeFilterOptions = { + filter: 1, + style: 2 +}; + +// Состояние редактора ячейки +var c_oAscCellEditorState = { + editEnd: 0, // Окончание редактирования + editStart: 1, // Начало редактирования + editEmptyCell: 2, // Редактирование пустой ячейки (доступны функции и свойства текста) + editText: 3, // Редактирование текста, числа, даты и др. формата, кроме формулы + editFormula: 4 // Редактирование формулы +}; + +// Состояние select-а +var c_oAscCellEditorSelectState = { + no : 0, + char : 1, + word : 2 +}; + +// Пересчитывать ли ширину столбца +var c_oAscCanChangeColWidth = { + none: 0, // not recalc + numbers: 1, // only numbers + all: 2 // numbers + text +}; + +var c_oAscPaneState = { + Frozen: "frozen", + FrozenSplit: "frozenSplit" +}; + +var c_oAscFindLookIn = { + Formulas: 1, + Value: 2, + Annotations: 3 +}; + +var c_oTargetType = { + None: 0, + ColumnResize: 1, + RowResize: 2, + FillHandle: 3, + MoveRange: 4, + MoveResizeRange: 5, + FilterObject: 6, + ColumnHeader: 7, + RowHeader: 8, + Corner: 9, + Hyperlink: 10, + Cells: 11, + Shape: 12, + FrozenAnchorH: 14, + FrozenAnchorV: 15 +}; + +var c_oAscAutoFilterTypes = { + ColorFilter: 0, + CustomFilters: 1, + DynamicFilter: 2, + Top10: 3, + Filters: 4 +}; + +var c_oAscCoAuthoringMeBorderColor = new window["CColor"](22, 156, 0); +var c_oAscCoAuthoringOtherBorderColor = new window["CColor"](238, 53, 37); +var c_oAscCoAuthoringLockTablePropertiesBorderColor = new window["CColor"](255, 144, 0); +var c_oAscCoAuthoringDottedWidth = 2; +var c_oAscCoAuthoringDottedDistance = 2; + +var c_oAscFormulaRangeBorderColor = [ + new window["CColor"](95, 140, 237), + new window["CColor"](235, 94, 96), + new window["CColor"](141, 97, 194), + new window["CColor"](45, 150, 57), + new window["CColor"](191, 76, 145), + new window["CColor"](227, 130, 34), + new window["CColor"](55, 127, 158) +]; + +var c_oAscLockNameFrozenPane = "frozenPane"; +var c_oAscLockNameTabColor = "tabColor"; + +var c_oAscGetDefinedNamesList = { + Worksheet: 0, + WorksheetWorkbook: 1, + All: 2 +}; + +var c_oAscDefinedNameReason = { + WrongName: -1, + IsLocked: -2, + Existed: -3, + LockDefNameManager: -4, + NameReserved: -5, + OK: 0 +}; + +var c_oAscPopUpSelectorType = { + None: 0, + Func: 1, + Range: 2, + Table: 3 +}; diff --git a/sdk/Excel/css/gradient.png b/sdk/Excel/css/gradient.png new file mode 100644 index 000000000..d3ac3a528 Binary files /dev/null and b/sdk/Excel/css/gradient.png differ diff --git a/sdk/Excel/css/main-mobile.css b/sdk/Excel/css/main-mobile.css new file mode 100644 index 000000000..df215c56b --- /dev/null +++ b/sdk/Excel/css/main-mobile.css @@ -0,0 +1,110 @@ +@charset "UTF-8"; + +/* + * Worksheet canvas + * -------------------------------------------------------- + */ + +#ws-canvas-outer { + position: absolute; + left: 0; + top: 0; + right: 0; + bottom: 0; +} + +#ws-canvas { + border: 0; +} + +#ws-canvas-overlay { + border: 0; + position: absolute; + left: 0; + top: 0; + z-index: 1; +} + +/* + * Worksheet scroll bars + * -------------------------------------------------------- + */ + +#ws-v-scrollbar { + position: absolute; + right: 0; + width: 19px; + top: -1px; + bottom: 18px; + overflow: hidden; + z-index: 10; +} + +#ws-v-scroll-helper { + width: 1px; +} + +#ws-h-scrollbar { + position: absolute; + bottom: 0; + height: 19px; + left: 0; + right: 18px; + overflow: hidden; + z-index: 10; +} + +#ws-h-scroll-helper { + height: 1px; +} + +#ws-scrollbar-corner { + position: absolute; + right: 0; + bottom: 0; + width: 18px; + height: 18px; + background-color: #DCE2E8; + border: 0; + z-index: 10; +} + +/* Scrollbars common */ + +#ws-v-scrollbar .jspVerticalBar, +#ws-h-scrollbar .jspHorizontalBar, +#ws-v-scrollbar .jspTrack, +#ws-h-scrollbar .jspTrack { + background-color: #DCE2E8; +} + +#ws-v-scrollbar .jspDrag, +#ws-h-scrollbar .jspDrag { + background-color: #C0C0C0; +} +#ws-v-scrollbar .jspDrag.jspHover, +#ws-v-scrollbar .jspDrag.jspActive, +#ws-h-scrollbar .jspDrag.jspHover, +#ws-h-scrollbar .jspDrag.jspActive { + background-color: #808080; +} + +/* Vertical scrollbar */ + +#ws-v-scrollbar .jspVerticalBar { + width: 7px; + border-left: 1px solid #C1C6CC; +} +#ws-v-scrollbar .jspTrack { + width: 8px; +} + +/* Horizontal scrollbar */ + +#ws-h-scrollbar .jspHorizontalBar { + height: 7px; + border-top: 1px solid #C1C6CC; +} +#ws-h-scrollbar .jspTrack { + height: 8px; +} diff --git a/sdk/Excel/css/main.css b/sdk/Excel/css/main.css new file mode 100644 index 000000000..3c6f17999 --- /dev/null +++ b/sdk/Excel/css/main.css @@ -0,0 +1,156 @@ +@charset "UTF-8"; + +/* + * Worksheet canvas + * -------------------------------------------------------- + */ + +#ws-canvas-outer { + position: absolute; + left: 0; + top: 0; + right: 14px; + bottom: 14px; + overflow: hidden; +} + +#ws-canvas { + border: 0; + -webkit-user-select: none; +} + +#ws-canvas-overlay, #ws-canvas-graphic, #ws-canvas-graphic-overlay { + -webkit-user-select: none; + border: 0; + position: absolute; + left: 0; + top: 0; + z-index: 1; +} + +/* + * Worksheet scroll bars + * -------------------------------------------------------- + */ + +#ws-v-scrollbar { + position: absolute; + right: 0; + width: 14px; + top: 0px; + bottom: 14px; + overflow: hidden; + z-index: 10; + background-color: #f1f1f1; +} + +#ws-v-scroll-helper { + width: 1px; +} + +#ws-h-scrollbar { + position: absolute; + bottom: 0; + height: 14px; + left: 0px; + right: 14px; + overflow: hidden; + z-index: 10; + background-color: #f1f1f1; +} + +#ws-h-scroll-helper { + height: 1px; +} + +#ws-scrollbar-corner { + position: absolute; + right: 0; + bottom: 0; + width: 14px; + height: 14px; + background-color: #F4F4F4; + border: 0; + z-index: 10; +} + +/* Scrollbars common */ + +#ws-v-scrollbar .jspVerticalBar, +#ws-h-scrollbar .jspHorizontalBar, +#ws-v-scrollbar .jspTrack, +#ws-h-scrollbar .jspTrack { + background-color: #DCE2E8; +} + +#ws-v-scrollbar .jspDrag, +#ws-h-scrollbar .jspDrag { + background-color: #C0C0C0; +} +#ws-v-scrollbar .jspDrag.jspHover, +#ws-v-scrollbar .jspDrag.jspActive, +#ws-h-scrollbar .jspDrag.jspHover, +#ws-h-scrollbar .jspDrag.jspActive { + background-color: #808080; +} + +/* Vertical scrollbar */ + +#ws-v-scrollbar .jspVerticalBar { + width: 7px; + border-left: 1px solid #C1C6CC; +} +#ws-v-scrollbar .jspTrack { + width: 8px; +} + +/* Horizontal scrollbar */ + +#ws-h-scrollbar .jspHorizontalBar { + height: 7px; + border-top: 1px solid #C1C6CC; +} +#ws-h-scrollbar .jspTrack { + height: 8px; +} + +/* + * Cell editor + * -------------------------------------------------------- + */ + +#ce-canvas-outer { + position: absolute; + border: 0; + overflow: hidden; +} + +#ce-canvas, +#ce-canvas-overlay { + border: 0; + position: absolute; + left: 0; + top: 0; +} + +#ce-cursor { + position: absolute; + background-color: #000; + width: 1px; + height: 11pt; + cursor: text; +} + +#apiPopUpSelector { + position: absolute; +} +#apiPopUpList { + width: 100%; + height: 100%; + max-height: 210px; + overflow: hidden; + position: relative; +} +#apiPopUpList li { + max-width: 500px; +} \ No newline at end of file diff --git a/sdk/Excel/css/nav-buttons.png b/sdk/Excel/css/nav-buttons.png new file mode 100644 index 000000000..9be029e59 Binary files /dev/null and b/sdk/Excel/css/nav-buttons.png differ diff --git a/sdk/Excel/document/editor.js b/sdk/Excel/document/editor.js new file mode 100644 index 000000000..db2c58ed2 --- /dev/null +++ b/sdk/Excel/document/editor.js @@ -0,0 +1,3 @@ +function getTestWorkbook() { + return "XLSY;v2;5548;BQG7DwAAAvgQAAADgAIAAAScAgAAAGQPAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABgAAAAAAwAAAAABAQELAAAAAgYAAAAABAEAAADEDAAAANIAAAABGQAAAAAGCgAAABsEOARBBEIEMgABBAEAAAACAQILFAAAAAAFAAAAAABsIUABBQAAAAAAAC5ADjwAAAAABUfhehSuxzFAAQXMzMzMzAwzQAIFR+F6FK7HMUADBczMzMzMDDNABAVmZmZmZmYpQAUFZmZmZmZmKUAPBgAAAAABAQEBCRAGAAAAAAEAAQEACTUAAAAKMAAAAAAECAAAAAQGJAAAAAUfAAAAAAQAAABEADgAAQQAAAAAAAAAAwgAAAAAAAAAAMBbQAUAAAAABwAAAAAAxQoAAAEZAAAAAAYKAAAAGwQ4BEEEQgQxAAEEAgAAAAIBAgKZAAAAAxkAAAACBAgAAAADBAgAAAAFBQAAAAAAACJABgEBAxkAAAACBAoAAAADBAoAAAAFBQAAAAAAJC1ABgEBAxkAAAACBA8AAAADBA8AAAAFBQAAAAAAAAAABgEBAxkAAAACBBAAAAADBBAAAAAFBQAAAAAAtiVABgEBAxwAAAAAAQECBBEAAAADBBEAAAAFBQAAAAAAAABABgEBCxQAAAAABQAAAAAAbCFAAQUAAAAAAAAuQA48AAAAAAVH4XoUrscxQAEFzMzMzMwMM0ACBUfhehSuxzFAAwXMzMzMzAwzQAQFZmZmZmZmKUAFBWZmZmZmZilADwYAAAAAAQEBAQkQBgAAAAABAAEBAAmfBQAACrMBAAAABAIAAAACBQAAAAAAgDxABgEBBAaaAQAABR8AAAAABAAAAEIAMgABBAAAAAAAAAADCAAAAAAAAAAAAPA/BRIAAAAABAAAAEQAMgABBAAAAAEAAAAFEgAAAAAEAAAARgAyAAEEAAAAAgAAAAUlAAAAAAQAAABIADIAAQQAAAADAAAAAgEAAAAFAwgAAAAAAAAAAAAAAAUfAAAAAAQAAABKADIAAQQAAAAEAAAAAwgAAAAAAAAAAADwPwUfAAAAAAQAAABMADIAAQQAAAAAAAAAAwgAAAAAAAAAAADwPwU+AAAAAAQAAABOADIAAQQAAAAAAAAABBoAAAAMBhQAAABTAFUATQAoAEwAMgA6AEwANQApAAMIAAAAAAAAAAAAJEAFHwAAAAAEAAAAUQAyAAEEAAAAAAAAAAMIAAAAAAAAAAAA8D8FJQAAAAAEAAAAUgAyAAEEAAAABQAAAAIBAAAABQMIAAAAAAAAAAAA8D8FEgAAAAAEAAAAUwAyAAEEAAAABgAAAAUSAAAAAAQAAABUADIAAQQAAAAGAAAABRIAAAAABAAAAFUAMgABBAAAAAYAAAAKJAEAAAAEAwAAAAQGGAEAAAUlAAAAAAQAAABCADMAAQQAAAAAAAAAAgEAAAAFAwgAAAAAAAAAAAAAAAUfAAAAAAQAAABIADMAAQQAAAAHAAAAAwgAAAAAAAAAAADwPwUfAAAAAAQAAABKADMAAQQAAAAIAAAAAwgAAAAAAAAAAAAAQAUfAAAAAAQAAABMADMAAQQAAAAAAAAAAwgAAAAAAAAAAAAAQAUlAAAAAAQAAABOADMAAQQAAAAAAAAAAgEAAAAFAwgAAAAAAAAAAADwPwUlAAAAAAQAAABSADMAAQQAAAAFAAAAAgEAAAAFAwgAAAAAAAAAAAAAQAUSAAAAAAQAAABTADMAAQQAAAAGAAAABRIAAAAABAAAAFQAMwABBAAAAAYAAAAKDgEAAAAEBAAAAAIFAAAAAADgQEAEBvgAAAAFJQAAAAAEAAAAQgA0AAEEAAAAAAAAAAIBAAAABQMIAAAAAAAAAAAACEAFEgAAAAAEAAAARAA0AAEEAAAACQAAAAUSAAAAAAQAAABGADQAAQQAAAAKAAAABSUAAAAABAAAAEgANAABBAAAAAsAAAACAQAAAAUDCAAAAAAAAAAAABBABR8AAAAABAAAAEoANAABBAAAAAwAAAADCAAAAAAAAAAAAAhABR8AAAAABAAAAEwANAABBAAAAAAAAAADCAAAAAAAAAAAAAhABRIAAAAABAAAAFMANAABBAAAAAYAAAAFEgAAAAAEAAAAVAA0AAEEAAAABgAAAApeAAAAAAQFAAAAAgUAAAAAAIAvQAQGSAAAAAUfAAAAAAQAAABKADUAAQQAAAANAAAAAwgAAAAAAAAAAAAQQAUfAAAAAAQAAABMADUAAQQAAAAAAAAAAwgAAAAAAAAAAAAQQAqMAAAAAAQGAAAAAgUAAAAAAIAvQAQGdgAAAAUSAAAAAAQAAABEADYAAQQAAAAOAAAABRIAAAAABAAAAEYANgABBAAAAA8AAAAFHwAAAAAEAAAASgA2AAEEAAAAEAAAAAMIAAAAAAAAAAAAFEAFHwAAAAAEAAAATAA2AAEEAAAAAAAAAAMIAAAAAAAAAAAAFEAKMAAAAAAEBwAAAAQGJAAAAAUfAAAAAAQAAABWADcAAQQAAAAAAAAAAwgAAAAAAAAAgLPVQAoPAAAAAAQIAAAAAwEBBAYAAAAACjIAAAAABAoAAAAEBiYAAAAFIQAAAAAGAAAAUwAxADAAAQQAAAAAAAAAAwgAAAAAAAAAAMBbQAoyAAAAAAQOAAAABAYmAAAABSEAAAAABgAAAFQAMQA0AAEEAAAAAAAAAAMIAAAAAAAAAADAa0AFYwAAAAY7AAAAAAQAAABSADIAASIAAABoAHQAdABwADoALwAvAHcAdwB3AC4AeQBhAC4AcgB1AC8AAwYAAAAxADIAMwAGHgAAAAAEAAAAUgAzAAIQAAAAGwQ4BEEEQgQxACEAQQAxAAceAAAACAoAAABTADIAOgBVADIACAoAAABTADMAOgBUADQADMYAAAANXgAAAAABAAAAAQEgAAAAAAQBAAAAAQVswRZswVYeQAIECwAAAAMFFyWZc7QbFEACIAAAAAAECQAAAAEFq6qqqqoaLUACBCAAAAADBc052q207uA/BAkAAAAFBAAAAAAAAAANXgAAAAABAAAAAQEgAAAAAAQLAAAAAQWZutz+IMMuQAIECwAAAAMFpsGpXuDuAEACIAAAAAAEDAAAAAEFAAAAAADAL0ACBBcAAAADBbfSum/xvw9ABAkAAAAFBAAAAAEAAAATmgIAABTZAAAAAAQGAAAAAQQVAAAAAgZpAAAAA2QAAAAABgAAAHoAegB6AAEwAAAATgBhAE4ALQBOAGEATgAtAE4AYQBOAFQATgBhAE4AOgBOAGEATgA6AE4AYQBOAFoAAg4AAAB1AHMAZQByAF8ANgAyAAMGAAAAWQBvAHUABgEAAAAABAQWAAAABgQGAAAACAQYAAAACgQLAAAABQQAAAAABwQAAAAACQQ8AAAACwQTAAAADAWZmZmZGXl2QA0FZmZmZmZuRUAOBZiZmZmZOUZADwWHiIiIiEg3QBABABEBABTZAAAAAAQJAAAAAQQSAAAAAgZpAAAAA2QAAAAABgAAAHgAeAB4AAEwAAAATgBhAE4ALQBOAGEATgAtAE4AYQBOAFQATgBhAE4AOgBOAGEATgA6AE4AYQBOAFoAAg4AAAB1AHMAZQByAF8ANgAyAAMGAAAAWQBvAHUABgEAAAAABAQTAAAABgQJAAAACAQVAAAACgQNAAAABQQAAAAABwQAAAAACQQ8AAAACwQTAAAADAXMzMzMTExzQA0FERERERG5SkAOBZiZmZmZOUZADwWHiIiIiEg3QBABABEBABTZAAAAAAQNAAAAAQQTAAAAAgZpAAAAA2QAAAAABgAAAHkAeQB5AAEwAAAATgBhAE4ALQBOAGEATgAtAE4AYQBOAFQATgBhAE4AOgBOAGEATgA6AE4AYQBOAFoAAg4AAAB1AHMAZQByAF8ANgAyAAMGAAAAWQBvAHUABgEAAAAABAQUAAAABgQNAAAACAQWAAAACgQRAAAABQQAAAAABwQAAAAACQQ8AAAACwQTAAAADAW7u7u7O1t0QA0FMjMzMzOnUkAOBZiZmZmZOUZADwWHiIiIiEg3QBABABEBAAAeAQAAARkAAAAABgoAAAAbBDgEQQRCBDMAAQQDAAAAAgEACxQAAAAABQAAAAAAbCFAAQUAAAAAAAAuQA48AAAAAAVH4XoUrscxQAEFzMzMzMwMM0ACBUfhehSuxzFAAwXMzMzMzAwzQAQFZmZmZmZmKUAFBWZmZmZmZilADwYAAAAAAQEBAQkQBgAAAAABAAEBAAkAAAAABWMAAAAGOwAAAAAEAAAAUgAyAAEiAAAAaAB0AHQAcAA6AC8ALwB3AHcAdwAuAHkAYQAuAHIAdQAvAAMGAAAAMQAyADMABh4AAAAABAAAAFIAMwACEAAAABsEOARBBEIEMQAhAEEAMQAHHgAAAAgKAAAAUwAyADoAVQAyAAgKAAAAUwAzADoAVAA0AFMAAAAATgAAAAEiAAAAAxQAAABpAG0AYQBnAGUAMQAuAGoAcABnAAIEAAAAAAAAAAEiAAAAAxQAAABpAG0AYQBnAGUAMgAuAGoAcABnAAIEAAAAAQAAADkBAAAABwAAAAMCAAAAcQAACwAAAAMGAAAAcQB3AGUAABUAAAADEAAAABsEOARBBEIEMQAhAEEAMQAA2gAAAAEoAAAAAhwAAAAEBhYAAABBAHIAaQBhAGwAIABCAGwAYQBjAGsAAwIAAABxAAEYAAAAAgwAAAABBgYAAAAABAAA/wADAgAAAHcAAQ8AAAACAwAAAAcBAwMCAAAAZQABDwAAAAIDAAAAAwEBAwIAAAByAAEPAAAAAgMAAAAAAQEDAgAAAHQAARYAAAACCgAAAAYFAAAAAAAAOkADAgAAAHkAAQ8AAAACAwAAAAgBAgMCAAAAdQABDwAAAAIDAAAABQEBAwIAAABpAAEMAAAAAgAAAAADAgAAAG8AAB8AAAADGgAAAHEAdwAgAGUAIABlAGUAIABlACAAZQAgAGUAsAQAAADIAAAAAQAAAAABFAAAAAQPAAAAAAYGAAAAAAQAAAAAAQENAVAAAAAADwAAAAAGBgAAAAAEAAAAAAEBDQIPAAAAAAYGAAAAAAQAAAAAAQENBA8AAAAABgYAAAAABAAAAAABAQ0FDwAAAAAGBgAAAAAEAAAAAAEBDQFQAAAAAA8AAAAABgYAAAAABAAAAAABAQYCDwAAAAAGBgAAAAAEAAAAAAEBBgQPAAAAAAYGAAAAAAQAAAAAAQEGBQ8AAAAABgYAAAAABAAAAAABAQYEUwAAAAUFAAAAAAAAAAAFBQAAAAAAAAAABRAAAAAACwAAAAEGAAAAAATw2cYABRAAAAAACwAAAAEGAAAAAAQAwP8ABRAAAAAACwAAAAEGAAAAAATNX2wABmEAAAAHKgAAAAEGBgAAAAAEAAAAAAQGDgAAAEMAYQBsAGkAYgByAGkABgUAAAAAAAAmQActAAAAAQYGAAAAAAT/AAAABAYOAAAAQwBhAGwAaQBiAHIAaQAGBQAAAAAAACZABwEDCIcAAAAJggAAAAAGdgAAAF8ALQAqACAAIwAsACMAIwAwAC4AMAAwACIAQAQuACIAXwAtADsAXAAtACoAIAAjACwAIwAjADAALgAwADAAIgBABC4AIgBfAC0AOwBfAC0AKgAgACIALQAiAD8APwAiAEAELgAiAF8ALQA7AF8ALQBAAF8ALQABBKAAAAACQQIAAAMYAAAABgQAAAAABwQAAAAACAQAAAAACQQAAAAAAxsAAAAGBAAAAAACAQEHBAIAAAAIBAAAAAAJBAAAAAADGwAAAAEBAQYEAQAAAAcEAAAAAAgEAAAAAAkEAAAAAAMkAAAABgQAAAAABwQAAAAACAQAAAAACQQAAAAAAAEBDQYDAAAABwEBAxsAAAAGBAAAAAAHBAAAAAAIBAAAAAAEAQEJBAIAAAADGwAAAAYEAAAAAAcEAAAAAAMBAQgEAQAAAAkEAAAAAAMkAAAABgQAAAAABwQAAAAACAQAAAAACQQAAAAAAAEBDQYDAAAAAAEAAyQAAAAGBAAAAAAHBAAAAAAIBAAAAAAJBAAAAAAAAQENBgMAAAAAAQYDGwAAAAYEAAAAAAcEAAAAAAgEAAAAAAQBAQkEoAAAAAMbAAAABgQAAAAAAgEBBwQDAAAACAQAAAAACQQAAAAAAxsAAAABAQEGBAIAAAAHBAAAAAAIBAAAAAAJBAAAAAADJAAAAAYEAAAAAAcEAAAAAAgEAAAAAAkEAAAAAAABAQ0GAwAAAAgBAQMbAAAABgQAAAAABwQAAAAACAQAAAAABAEBCQQOAAAAAxsAAAAGBAAAAAAHBAAAAAAIBAAAAAAEAQEJBAoAAAADGwAAAAYEAAAAAAIBAQcEBAAAAAgEAAAAAAkEAAAAAAMbAAAAAQEBBgQDAAAABwQAAAAACAQAAAAACQQAAAAAAxsAAAAGBAAAAAAHBAAAAAAIBAAAAAAEAQEJBAsAAAAMTgAAAAAiAAAAVABhAGIAbABlAFMAdAB5AGwAZQBNAGUAZABpAHUAbQAyAAEiAAAAUABpAHYAbwB0AFMAdAB5AGwAZQBMAGkAZwBoAHQAMQA2AA=="; +} \ No newline at end of file diff --git a/sdk/Excel/document/empty-workbook.js b/sdk/Excel/document/empty-workbook.js new file mode 100644 index 000000000..8eeb1fed2 --- /dev/null +++ b/sdk/Excel/document/empty-workbook.js @@ -0,0 +1,3 @@ +function getEmptyWorkbook() { + return "XLSY;v2;5958;BAKAAgAAA7kDAAAEzAMAAABaBAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAADUBAAAAHgAAAAEZAAAAAAAAAAABAAAAAAIAAAAABAAAAAAFAAAAAAQKAAAABQAAAAAFAAAAAAYvAAAAByoAAAABBgMAAAACAQEEBg4AAABDAGEAbABpAGIAcgBpAAkBAQYFAAAAAAAAJkAOHQAAAAMYAAAABgQAAAAABwQAAAAACAQAAAAACQQAAAAAAiMAAAADHgAAAAYEAAAAAAcEAAAAAAgEAAAAAAkEAAAAAAwEAAAAAA8oAAAAECMAAAAABAAAAAAAAAAEDAAAAE4AbwByAG0AYQBsAAUEAAAAAAAAAAoAAAAADE4AAAAAIgAAAFQAYQBiAGwAZQBTAHQAeQBsAGUATQBlAGQAaQB1AG0AMgABIgAAAFAAaQB2AG8AdABTAHQAeQBsAGUATABpAGcAaAB0ADEANgAPAAAAAAAAAAABBQAAAAIAAAAAigAAAACFAAAAARgAAAAABgwAAABTAGgAZQBlAHQAMQABBAEAAAAEBAAAAEEAMQAWBQAAABcAAAAACwoAAAABBQAAAAAAAC5ADjwAAAAABUfhehSuxzFAAQXMzMzMzAwzQAIFR+F6FK7HMUADBczMzMzMDDNABAV7FK5H4XoeQAUFexSuR+F6HkAJAAAAAOgSAAAF4xIAABTeEgAA+gAMAAAATwBmAGYAaQBjAGUAIABUAGgAZQBtAGUA+wCxEgAAABUBAAD6AAYAAABPAGYAZgBpAGMAZQD7DB4AAAAEGQAAAPoABgAAAHcAaQBuAGQAbwB3AAH/Av8D//sNDQAAAAEIAAAA+gDuAewC4fsIJgAAAAQhAAAA+gAKAAAAdwBpAG4AZABvAHcAVABlAHgAdAABAAIAAwD7Cg0AAAABCAAAAPoAgAEAAoD7AA0AAAABCAAAAPoATwGBAr37CQ0AAAABCAAAAPoAHwFJAn37AQ0AAAABCAAAAPoAwAFQAk37Ag0AAAABCAAAAPoAmwG7Aln7Aw0AAAABCAAAAPoAgAFkAqL7Cw0AAAABCAAAAPoAAAEAAv/7BA0AAAABCAAAAPoASwGsAsb7BQ0AAAABCAAAAPoA9wGWAkb7AakKAAD6AAkAAABDAG8AbQBwAG8AcwBpAHQAZQD7AEMFAAAAFQAAAPoDBwAAAEMAYQBsAGkAYgByAGkA+wERAAAA+gMFAAAAQQByAGkAYQBsAPsCEQAAAPoDBQAAAEEAcgBpAGEAbAD7A/gEAAAeAAAAACQAAAD6AAQAAABKAHAAYQBuAAEIAAAALf8z/yAAMP+0MLcwwzCvMPsAHgAAAPoABAAAAEgAYQBuAGcAAQUAAADRuUDHIADgrBW1+wAYAAAA+gAEAAAASABhAG4AcwABAgAAAItbU0/7AB4AAAD6AAQAAABIAGEAbgB0AAEFAAAArl/fjmNr0Z7UmvsAHgAAAPoABAAAAEEAcgBhAGIAAQUAAABBAHIAaQBhAGwA+wAeAAAA+gAEAAAASABlAGIAcgABBQAAAEEAcgBpAGEAbAD7ACgAAAD6AAQAAABUAGgAYQBpAAEKAAAAQwBvAHIAZABpAGEAIABOAGUAdwD7AB4AAAD6AAQAAABFAHQAaABpAAEFAAAATgB5AGEAbABhAPsAIAAAAPoABAAAAEIAZQBuAGcAAQYAAABWAHIAaQBuAGQAYQD7ACAAAAD6AAQAAABHAHUAagByAAEGAAAAUwBoAHIAdQB0AGkA+wAkAAAA+gAEAAAASwBoAG0AcgABCAAAAEQAYQB1AG4AUABlAG4AaAD7AB4AAAD6AAQAAABLAG4AZABhAAEFAAAAVAB1AG4AZwBhAPsAHgAAAPoABAAAAEcAdQByAHUAAQUAAABSAGEAYQB2AGkA+wAkAAAA+gAEAAAAQwBhAG4AcwABCAAAAEUAdQBwAGgAZQBtAGkAYQD7ADwAAAD6AAQAAABDAGgAZQByAAEUAAAAUABsAGEAbgB0AGEAZwBlAG4AZQB0ACAAQwBoAGUAcgBvAGsAZQBlAPsAOAAAAPoABAAAAFkAaQBpAGkAARIAAABNAGkAYwByAG8AcwBvAGYAdAAgAFkAaQAgAEIAYQBpAHQAaQD7ADgAAAD6AAQAAABUAGkAYgB0AAESAAAATQBpAGMAcgBvAHMAbwBmAHQAIABIAGkAbQBhAGwAYQB5AGEA+wAiAAAA+gAEAAAAVABoAGEAYQABBwAAAE0AVgAgAEIAbwBsAGkA+wAgAAAA+gAEAAAARABlAHYAYQABBgAAAE0AYQBuAGcAYQBsAPsAIgAAAPoABAAAAFQAZQBsAHUAAQcAAABHAGEAdQB0AGEAbQBpAPsAHgAAAPoABAAAAFQAYQBtAGwAAQUAAABMAGEAdABoAGEA+wA2AAAA+gAEAAAAUwB5AHIAYwABEQAAAEUAcwB0AHIAYQBuAGcAZQBsAG8AIABFAGQAZQBzAHMAYQD7ACIAAAD6AAQAAABPAHIAeQBhAAEHAAAASwBhAGwAaQBuAGcAYQD7ACIAAAD6AAQAAABNAGwAeQBtAAEHAAAASwBhAHIAdABpAGsAYQD7ACYAAAD6AAQAAABMAGEAbwBvAAEJAAAARABvAGsAQwBoAGEAbQBwAGEA+wAsAAAA+gAEAAAAUwBpAG4AaAABDAAAAEkAcwBrAG8AbwBsAGEAIABQAG8AdABhAPsAMgAAAPoABAAAAE0AbwBuAGcAAQ8AAABNAG8AbgBnAG8AbABpAGEAbgAgAEIAYQBpAHQAaQD7AB4AAAD6AAQAAABWAGkAZQB0AAEFAAAAQQByAGkAYQBsAPsANAAAAPoABAAAAFUAaQBnAGgAARAAAABNAGkAYwByAG8AcwBvAGYAdAAgAFUAaQBnAGgAdQByAPsAIgAAAPoABAAAAEcAZQBvAHIAAQcAAABTAHkAbABmAGEAZQBuAPsBQwUAAAAVAAAA+gMHAAAAQwBhAGwAaQBiAHIAaQD7AREAAAD6AwUAAABBAHIAaQBhAGwA+wIRAAAA+gMFAAAAQQByAGkAYQBsAPsD+AQAAB4AAAAAJAAAAPoABAAAAEoAcABhAG4AAQgAAAAt/zP/IAAw/7QwtzDDMK8w+wAeAAAA+gAEAAAASABhAG4AZwABBQAAANG5QMcgAOCsFbX7ABgAAAD6AAQAAABIAGEAbgBzAAECAAAAi1tTT/sAHgAAAPoABAAAAEgAYQBuAHQAAQUAAACuX9+OY2vRntSa+wAeAAAA+gAEAAAAQQByAGEAYgABBQAAAEEAcgBpAGEAbAD7AB4AAAD6AAQAAABIAGUAYgByAAEFAAAAQQByAGkAYQBsAPsAKAAAAPoABAAAAFQAaABhAGkAAQoAAABDAG8AcgBkAGkAYQAgAE4AZQB3APsAHgAAAPoABAAAAEUAdABoAGkAAQUAAABOAHkAYQBsAGEA+wAgAAAA+gAEAAAAQgBlAG4AZwABBgAAAFYAcgBpAG4AZABhAPsAIAAAAPoABAAAAEcAdQBqAHIAAQYAAABTAGgAcgB1AHQAaQD7ACQAAAD6AAQAAABLAGgAbQByAAEIAAAARABhAHUAbgBQAGUAbgBoAPsAHgAAAPoABAAAAEsAbgBkAGEAAQUAAABUAHUAbgBnAGEA+wAeAAAA+gAEAAAARwB1AHIAdQABBQAAAFIAYQBhAHYAaQD7ACQAAAD6AAQAAABDAGEAbgBzAAEIAAAARQB1AHAAaABlAG0AaQBhAPsAPAAAAPoABAAAAEMAaABlAHIAARQAAABQAGwAYQBuAHQAYQBnAGUAbgBlAHQAIABDAGgAZQByAG8AawBlAGUA+wA4AAAA+gAEAAAAWQBpAGkAaQABEgAAAE0AaQBjAHIAbwBzAG8AZgB0ACAAWQBpACAAQgBhAGkAdABpAPsAOAAAAPoABAAAAFQAaQBiAHQAARIAAABNAGkAYwByAG8AcwBvAGYAdAAgAEgAaQBtAGEAbABhAHkAYQD7ACIAAAD6AAQAAABUAGgAYQBhAAEHAAAATQBWACAAQgBvAGwAaQD7ACAAAAD6AAQAAABEAGUAdgBhAAEGAAAATQBhAG4AZwBhAGwA+wAiAAAA+gAEAAAAVABlAGwAdQABBwAAAEcAYQB1AHQAYQBtAGkA+wAeAAAA+gAEAAAAVABhAG0AbAABBQAAAEwAYQB0AGgAYQD7ADYAAAD6AAQAAABTAHkAcgBjAAERAAAARQBzAHQAcgBhAG4AZwBlAGwAbwAgAEUAZABlAHMAcwBhAPsAIgAAAPoABAAAAE8AcgB5AGEAAQcAAABLAGEAbABpAG4AZwBhAPsAIgAAAPoABAAAAE0AbAB5AG0AAQcAAABLAGEAcgB0AGkAawBhAPsAJgAAAPoABAAAAEwAYQBvAG8AAQkAAABEAG8AawBDAGgAYQBtAHAAYQD7ACwAAAD6AAQAAABTAGkAbgBoAAEMAAAASQBzAGsAbwBvAGwAYQAgAFAAbwB0AGEA+wAyAAAA+gAEAAAATQBvAG4AZwABDwAAAE0AbwBuAGcAbwBsAGkAYQBuACAAQgBhAGkAdABpAPsAHgAAAPoABAAAAFYAaQBlAHQAAQUAAABBAHIAaQBhAGwA+wA0AAAA+gAEAAAAVQBpAGcAaAABEAAAAE0AaQBjAHIAbwBzAG8AZgB0ACAAVQBpAGcAaAB1AHIA+wAiAAAA+gAEAAAARwBlAG8AcgABBwAAAFMAeQBsAGYAYQBlAG4A+wLkBgAA+gAGAAAATwBmAGYAaQBjAGUA+wCyAgAAAwAAAAATAAAAAw4AAAAACQAAAAMEAAAA+gAO+wBDAQAABD4BAAD6AQH7ACcBAAADAAAAAFwAAAD6AAAAAAD7AFAAAAADSwAAAPoADvsAQgAAAAIAAAABGAAAAPoABgAAAGEAOgB0AGkAbgB0AAFQwwAA+wEcAAAA+gAIAAAAYQA6AHMAYQB0AE0AbwBkAAHgkwQA+wBcAAAA+gC4iAAA+wBQAAAAA0sAAAD6AA77AEIAAAACAAAAARgAAAD6AAYAAABhADoAdABpAG4AdAABiJAAAPsBHAAAAPoACAAAAGEAOgBzAGEAdABNAG8AZAAB4JMEAPsAXAAAAPoAoIYBAPsAUAAAAANLAAAA+gAO+wBCAAAAAgAAAAEYAAAA+gAGAAAAYQA6AHQAaQBuAHQAAZg6AAD7ARwAAAD6AAgAAABhADoAcwBhAHQATQBvAGQAATBXBQD7AQkAAAD6AEAx9wABAfsASQEAAAREAQAA+gEB+wAtAQAAAwAAAABeAAAA+gAAAAAA+wBSAAAAA00AAAD6AA77AEQAAAACAAAAARoAAAD6AAcAAABhADoAcwBoAGEAZABlAAE4xwAA+wEcAAAA+gAIAAAAYQA6AHMAYQB0AE0AbwBkAAHQ+wEA+wBeAAAA+gCAOAEA+wBSAAAAA00AAAD6AA77AEQAAAACAAAAARoAAAD6AAcAAABhADoAcwBoAGEAZABlAAFIawEA+wEcAAAA+gAIAAAAYQA6AHMAYQB0AE0AbwBkAAHQ+wEA+wBeAAAA+gCghgEA+wBSAAAAA00AAAD6AA77AEQAAAACAAAAARoAAAD6AAcAAABhADoAcwBoAGEAZABlAAEwbwEA+wEcAAAA+gAIAAAAYQA6AHMAYQB0AE0AbwBkAAFYDwIA+wEJAAAA+gBAMfcAAQD7AQoBAAADAAAAAIMAAAD6AAABAAIBAzUlAAD7AFwAAAADVwAAAABSAAAAA00AAAD6AA77AEQAAAACAAAAARoAAAD6AAcAAABhADoAcwBoAGEAZABlAAEYcwEA+wEcAAAA+gAIAAAAYQA6AHMAYQB0AE0AbwBkAAEomgEA+wEEAAAA+gAG+wIHAAAA+gAAAAAA+wA6AAAA+gAAAQACAQM4YwAA+wATAAAAAw4AAAAACQAAAAMEAAAA+gAO+wEEAAAA+gAG+wIHAAAA+gAAAAAA+wA6AAAA+gAAAQACAQPUlAAA+wATAAAAAw4AAAAACQAAAAMEAAAA+gAO+wEEAAAA+gAG+wIHAAAA+gAAAAAA+wITAAAAAwAAAAAAAAAAAAAAAAAAAAAAAAPuAgAAAwAAAAATAAAAAw4AAAAACQAAAAMEAAAA+gAO+wCmAQAABKEBAAD6AQH7AEgBAAADAAAAAFwAAAD6AAAAAAD7AFAAAAADSwAAAPoADvsAQgAAAAIAAAABGAAAAPoABgAAAGEAOgB0AGkAbgB0AAFAnAAA+wEcAAAA+gAIAAAAYQA6AHMAYQB0AE0AbwBkAAEwVwUA+wB7AAAA+gBAnAAA+wBvAAAAA2oAAAD6AA77AGEAAAADAAAAARgAAAD6AAYAAABhADoAdABpAG4AdAAByK8AAPsBGgAAAPoABwAAAGEAOgBzAGgAYQBkAGUAAbiCAQD7ARwAAAD6AAgAAABhADoAcwBhAHQATQBvAGQAATBXBQD7AF4AAAD6AKCGAQD7AFIAAAADTQAAAPoADvsARAAAAAIAAAABGgAAAPoABwAAAGEAOgBzAGgAYQBkAGUAASBOAAD7ARwAAAD6AAgAAABhADoAcwBhAHQATQBvAGQAARjkAwD7AksAAAD6AAD7AEIAAAD6AAUAAAA1ADAAMAAwADAAAQYAAAAtADgAMAAwADAAMAACBQAAADUAMAAwADAAMAADBgAAADEAOAAwADAAMAAwAPsAIgEAAAQdAQAA+gEB+wDIAAAAAgAAAABcAAAA+gAAAAAA+wBQAAAAA0sAAAD6AA77AEIAAAACAAAAARgAAAD6AAYAAABhADoAdABpAG4AdAABgDgBAPsBHAAAAPoACAAAAGEAOgBzAGEAdABNAG8AZAAB4JMEAPsAXgAAAPoAoIYBAPsAUgAAAANNAAAA+gAO+wBEAAAAAgAAAAEaAAAA+gAHAAAAYQA6AHMAaABhAGQAZQABMHUAAPsBHAAAAPoACAAAAGEAOgBzAGEAdABNAG8AZAABQA0DAPsCRwAAAPoAAPsAPgAAAPoABQAAADUAMAAwADAAMAABBQAAADUAMAAwADAAMAACBQAAADUAMAAwADAAMAADBQAAADUAMAAwADAAMAD7BAQAAAAAAAAA"; +} \ No newline at end of file diff --git a/sdk/Excel/document/media/image1.jpg b/sdk/Excel/document/media/image1.jpg new file mode 100644 index 000000000..bc5c9ebc7 Binary files /dev/null and b/sdk/Excel/document/media/image1.jpg differ diff --git a/sdk/Excel/document/media/image2.jpg b/sdk/Excel/document/media/image2.jpg new file mode 100644 index 000000000..c4002e8ea Binary files /dev/null and b/sdk/Excel/document/media/image2.jpg differ diff --git a/sdk/Excel/document/test-workbook9.xlsx b/sdk/Excel/document/test-workbook9.xlsx new file mode 100644 index 000000000..ba76b84e3 Binary files /dev/null and b/sdk/Excel/document/test-workbook9.xlsx differ diff --git a/sdk/Excel/jquery/jquery-1.7.1.js b/sdk/Excel/jquery/jquery-1.7.1.js new file mode 100644 index 000000000..8ccd0ea78 --- /dev/null +++ b/sdk/Excel/jquery/jquery-1.7.1.js @@ -0,0 +1,9266 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context ? context.ownerDocument || context : document ); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.7.1", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.add( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.fireWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).off( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery.Callbacks( "once memory" ); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array, i ) { + var len; + + if ( array ) { + if ( indexOf ) { + return indexOf.call( array, elem, i ); + } + + len = array.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in array && array[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return ( new Date() ).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +// String to Object flags format cache +var flagsCache = {}; + +// Convert String-formatted flags into Object-formatted ones and store in cache +function createFlags( flags ) { + var object = flagsCache[ flags ] = {}, + i, length; + flags = flags.split( /\s+/ ); + for ( i = 0, length = flags.length; i < length; i++ ) { + object[ flags[i] ] = true; + } + return object; +} + +/* + * Create a callback list using the following parameters: + * + * flags: an optional list of space-separated flags that will change how + * the callback list behaves + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible flags: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( flags ) { + + // Convert flags from String-formatted to Object-formatted + // (we check in cache first) + flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; + + var // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = [], + // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Add one or several callbacks to the list + add = function( args ) { + var i, + length, + elem, + type, + actual; + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + // Inspect recursively + add( elem ); + } else if ( type === "function" ) { + // Add if not in unique mode and callback is not in + if ( !flags.unique || !self.has( elem ) ) { + list.push( elem ); + } + } + } + }, + // Fire callbacks + fire = function( context, args ) { + args = args || []; + memory = !flags.memory || [ context, args ]; + firing = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { + memory = true; // Mark as halted + break; + } + } + firing = false; + if ( list ) { + if ( !flags.once ) { + if ( stack && stack.length ) { + memory = stack.shift(); + self.fireWith( memory[ 0 ], memory[ 1 ] ); + } + } else if ( memory === true ) { + self.disable(); + } else { + list = []; + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + var length = list.length; + add( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away, unless previous + // firing was halted (stopOnFalse) + } else if ( memory && memory !== true ) { + firingStart = length; + fire( memory[ 0 ], memory[ 1 ] ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + var args = arguments, + argIndex = 0, + argLength = args.length; + for ( ; argIndex < argLength ; argIndex++ ) { + for ( var i = 0; i < list.length; i++ ) { + if ( args[ argIndex ] === list[ i ] ) { + // Handle firingIndex and firingLength + if ( firing ) { + if ( i <= firingLength ) { + firingLength--; + if ( i <= firingIndex ) { + firingIndex--; + } + } + } + // Remove the element + list.splice( i--, 1 ); + // If we have some unicity property then + // we only need to do this once + if ( flags.unique ) { + break; + } + } + } + } + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + if ( list ) { + var i = 0, + length = list.length; + for ( ; i < length; i++ ) { + if ( fn === list[ i ] ) { + return true; + } + } + } + return false; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory || memory === true ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( stack ) { + if ( firing ) { + if ( !flags.once ) { + stack.push( [ context, args ] ); + } + } else if ( !( flags.once && memory ) ) { + fire( context, args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!memory; + } + }; + + return self; +}; + + + + +var // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + + Deferred: function( func ) { + var doneList = jQuery.Callbacks( "once memory" ), + failList = jQuery.Callbacks( "once memory" ), + progressList = jQuery.Callbacks( "memory" ), + state = "pending", + lists = { + resolve: doneList, + reject: failList, + notify: progressList + }, + promise = { + done: doneList.add, + fail: failList.add, + progress: progressList.add, + + state: function() { + return state; + }, + + // Deprecated + isResolved: doneList.fired, + isRejected: failList.fired, + + then: function( doneCallbacks, failCallbacks, progressCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); + return this; + }, + always: function() { + deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); + return this; + }, + pipe: function( fnDone, fnFail, fnProgress ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ], + progress: [ fnProgress, "notify" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + obj = promise; + } else { + for ( var key in promise ) { + obj[ key ] = promise[ key ]; + } + } + return obj; + } + }, + deferred = promise.promise({}), + key; + + for ( key in lists ) { + deferred[ key ] = lists[ key ].fire; + deferred[ key + "With" ] = lists[ key ].fireWith; + } + + // Handle state + deferred.done( function() { + state = "resolved"; + }, failList.disable, progressList.lock ).fail( function() { + state = "rejected"; + }, doneList.disable, progressList.lock ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = sliceDeferred.call( arguments, 0 ), + i = 0, + length = args.length, + pValues = new Array( length ), + count = length, + pCount = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(), + promise = deferred.promise(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + deferred.resolveWith( deferred, args ); + } + }; + } + function progressFunc( i ) { + return function( value ) { + pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + deferred.notifyWith( promise, pValues ); + }; + } + if ( length > 1 ) { + for ( ; i < length; i++ ) { + if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return promise; + } +}); + + + + +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + marginDiv, + fragment, + tds, + events, + eventName, + i, + isSupported, + div = document.createElement( "div" ), + documentElement = document.documentElement; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = "
a"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( window.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.style.width = "2px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + fragment.removeChild( div ); + + // Null elements to avoid leaks in IE + fragment = select = opt = marginDiv = div = input = null; + + // Run tests that need a body at doc ready + jQuery(function() { + var container, outer, inner, table, td, offsetSupport, + conMarginTop, ptlm, vb, style, html, + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + conMarginTop = 1; + ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;"; + vb = "visibility:hidden;border:0;"; + style = "style='" + ptlm + "border:5px solid #000;padding:0;'"; + html = "
" + + "" + + "
"; + + container = document.createElement("div"); + container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
t
"; + tds = div.getElementsByTagName( "td" ); + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Figure out if the W3C box model works as expected + div.innerHTML = ""; + div.style.width = div.style.paddingLeft = "1px"; + jQuery.boxModel = support.boxModel = div.offsetWidth === 2; + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "
"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.style.cssText = ptlm + vb; + div.innerHTML = html; + + outer = div.firstChild; + inner = outer.firstChild; + td = outer.nextSibling.firstChild.firstChild; + + offsetSupport = { + doesNotAddBorder: ( inner.offsetTop !== 5 ), + doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) + }; + + inner.style.position = "fixed"; + inner.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); + inner.style.position = inner.style.top = ""; + + outer.style.overflow = "hidden"; + outer.style.position = "relative"; + + offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); + offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); + + body.removeChild( container ); + div = container = null; + + jQuery.extend( support, offsetSupport ); + }); + + return support; +})(); + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var privateCache, thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey, + isEvents = name === "events"; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = ++jQuery.uuid; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + privateCache = thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Users should not attempt to inspect the internal events object using jQuery.data, + // it is undocumented and subject to change. But does anyone listen? No. + if ( isEvents && !thisCache[ name ] ) { + return privateCache.events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ internalKey ] : internalKey; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split( " " ); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the cache and need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ internalKey ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + } else { + elem[ internalKey ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, attr, name, + data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) { + attr = this[0].attributes; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + jQuery._data( this[0], "parsedAttrs", true ); + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var self = jQuery( this ), + args = [ parts[0], value ]; + + self.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + jQuery.isNumeric( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery._data( elem, deferDataKey ); + if ( defer && + ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && + ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery._data( elem, queueDataKey ) && + !jQuery._data( elem, markDataKey ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.fire(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = ( type || "fx" ) + "mark"; + jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); + if ( count ) { + jQuery._data( elem, key, count ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + var q; + if ( elem ) { + type = ( type || "fx" ) + "queue"; + q = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = {}; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + jQuery._data( elem, type + ".run", hooks ); + fn.call( elem, function() { + jQuery.dequeue( elem, type ); + }, hooks ); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue " + type + ".run", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { + count++; + tmp.add( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute, + nodeHook, boolHook, fixSpecified; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = ( value || "" ).split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, l, + i = 0; + + if ( value && elem.nodeType === 1 ) { + attrNames = value.toLowerCase().split( rspace ); + l = attrNames.length; + + for ( ; i < l; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + + // See #9699 for explanation of this approach (setting first, then removal) + jQuery.attr( elem, name, "" ); + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) +jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.nodeValue = value + "" ); + } + }; + + // Apply the nodeHook to tabindex + jQuery.attrHooks.tabindex.set = nodeHook.set; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + + + + +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, + rhoverHack = /\bhover(\.\S+)?\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, + quickParse = function( selector ) { + var quick = rquickIs.exec( selector ); + if ( quick ) { + // 0 1 2 3 + // [ _, tag, id, class ] + quick[1] = ( quick[1] || "" ).toLowerCase(); + quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); + } + return quick; + }, + quickIs = function( elem, m ) { + var attrs = elem.attributes || {}; + return ( + (!m[1] || elem.nodeName.toLowerCase() === m[1]) && + (!m[2] || (attrs.id || {}).value === m[2]) && + (!m[3] || m[3].test( (attrs[ "class" ] || {}).value )) + ); + }, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, quick, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + quick: quickParse( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + t, tns, type, origType, namespaces, origCount, + j, events, special, handle, eventType, handleObj; + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, [ "events", "handle" ], true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var type = event.type || event, + namespaces = [], + cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + old = null; + for ( ; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old && old === elem.ownerDocument ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments, 0 ), + run_all = !event.exclusive && !event.namespace, + handlerQueue = [], + i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Determine handlers that should run if there are delegated events + // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) { + + // Pregenerate a single jQuery object for reuse with .is() + jqcur = jQuery(this); + jqcur.context = this.ownerDocument || this; + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + selMatch = {}; + matches = []; + jqcur[0] = cur; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = ( + handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel ) + ); + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) + if ( event.metaKey === undefined ) { + event.metaKey = event.ctrlKey; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector, + ret; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !form._submit_attached ) { + jQuery.event.add( form, "submit._submit", function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + }); + form._submit_attached = true; + } + }); + // return undefined since we don't need an event listener + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + jQuery.event.simulate( "change", this, event, true ); + } + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + elem._change_attached = true; + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + // ( types-Object, data ) + data = selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on.call( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + var handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( var type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + expando = "sizcache" + (Math.random() + '').replace('.', ''), + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rReturn = /\r\n/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context, seed ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set, seed ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set, i, len, match, type, left; + + if ( !expr ) { + return []; + } + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + type, found, item, filter, left, + i, pass, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + filter = Expr.filter[ type ]; + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + pass = not ^ found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Utility function for retreiving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var i, node, + nodeType = elem.nodeType, + ret = ""; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 ) { + // Use textContent || innerText for elements + if ( typeof elem.textContent === 'string' ) { + return elem.textContent; + } else if ( typeof elem.innerText === 'string' ) { + // Replace IE's carriage returns + return elem.innerText.replace( rReturn, '' ); + } else { + // Traverse it's children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + } else { + + // If no nodeType, this is expected to be an array + for ( i = 0; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + if ( node.nodeType !== 8 ) { + ret += getText( node ); + } + } + } + return ret; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var first, last, + doneName, parent, cache, + count, diff, + type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + first = match[2]; + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + doneName = match[0]; + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { + count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent[ expando ] = doneName; + } + + diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Sizzle.attr ? + Sizzle.attr( elem, name ) : + Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + !type && Sizzle.attr ? + result != null : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = ""; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = ""; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "

"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "
"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context, seed ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet, seed ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +Sizzle.selectors.attrMap = {}; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + POS.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array (deprecated as of jQuery 1.7) + if ( jQuery.isArray( selectors ) ) { + var level = 1; + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( i = 0; i < selectors.length; i++ ) { + + if ( jQuery( cur ).is( selectors[ i ] ) ) { + ret.push({ selector: selectors[ i ], elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} + + + + +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /", "" ], + legend: [ 1, "
", "
" ], + thead: [ 1, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + col: [ 2, "", "
" ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize and + + + + + + + + + + +
+ + + + + + + + + + + + + + +
+
+
+
+
100%
+
+
+
+ +
+ + + + + + + + + + + +
+ +
+
+
R:
+
G:
+
B:
+
+
Current
+
Last
+
+
+
+
+
+
+
+
+ +
+
+ + + + + + + + + + + + + + \ No newline at end of file diff --git a/sdk/PowerPoint/menu/Statusbar.js b/sdk/PowerPoint/menu/Statusbar.js new file mode 100644 index 000000000..91b551acf --- /dev/null +++ b/sdk/PowerPoint/menu/Statusbar.js @@ -0,0 +1,516 @@ +var _g_dKoef_mm_to_pix = 96 / 25.4; +var _g_dKoef_pix_to_mm = 25.4 / 96; + +// dublivate classes +function _CBounds() +{ + this.L = 0; // ????? ??????? + this.T = 0; // ??????? ??????? + this.R = 0; // ?????? ??????? (???? ?????? ???? isAbsR, ?? ??? ?????????? ??????, ? ?? R) + this.B = 0; // ??????? ??????? (???? ?????? ???? isAbsB, ?? ??? ?????????? ??????, ? ?? B) + + this.isAbsL = false; + this.isAbsT = false; + this.isAbsR = false; + this.isAbsB = false; + + this.AbsW = -1; + this.AbsH = -1; + + this.SetParams = function(_l,_t,_r,_b,abs_l,abs_t,abs_r,abs_b,absW,absH) + { + this.L = _l; + this.T = _t; + this.R = _r; + this.B = _b; + + this.isAbsL = abs_l; + this.isAbsT = abs_t; + this.isAbsR = abs_r; + this.isAbsB = abs_b; + + this.AbsW = absW; + this.AbsH = absH; + } +} + +function _CAbsolutePosition() +{ + this.L = 0; + this.T = 0; + this.R = 0; + this.B = 0; +} + +var _g_anchor_left = 1; +var _g_anchor_top = 2; +var _g_anchor_right = 4; +var _g_anchor_bottom = 8; + +function _CControl() +{ + this.Bounds = new _CBounds(); + + this.Anchor = _g_anchor_left | _g_anchor_top; + + this.Name = null; + this.Parent = null; + this.TabIndex = null; + + this.HtmlElement = null; + + this.AbsolutePosition = new _CBounds(); + + this.Resize = function(_width,_height) + { + if ((null == this.Parent) || (null == this.HtmlElement)) + return; + + var _x = 0; + var _y = 0; + var _r = 0; + var _b = 0; + + var hor_anchor = (this.Anchor & 0x05); + var ver_anchor = (this.Anchor & 0x0A); + + if (_g_anchor_left == hor_anchor) + { + if (this.Bounds.isAbsL) + _x = this.Bounds.L; + else + _x = (this.Bounds.L * _width / 1000); + + if (-1 != this.Bounds.AbsW) + _r = _x + this.Bounds.AbsW; + else + { + if (this.Bounds.isAbsR) + _r = (_width - this.Bounds.R); + else + _r = this.Bounds.R * _width / 1000; + } + } + else if (_g_anchor_right == hor_anchor) + { + if (this.Bounds.isAbsR) + _r = (_width - this.Bounds.R); + else + _r = (this.Bounds.R * _width / 1000); + + if (-1 != this.Bounds.AbsW) + _x = _r - this.Bounds.AbsW; + else + { + if (this.Bounds.isAbsL) + _x = this.Bounds.L; + else + _x = this.Bounds.L * _width / 1000; + } + } + else if ((_g_anchor_left | _g_anchor_right) == hor_anchor) + { + if (this.Bounds.isAbsL) + _x = this.Bounds.L; + else + _x = (this.Bounds.L * _width / 1000); + + if (this.Bounds.isAbsR) + _r = (_width - this.Bounds.R); + else + _r = (this.Bounds.R * _width / 1000); + } + else + { + _x = this.Bounds.L; + _r = this.Bounds.R; + } + + if (_g_anchor_top == ver_anchor) + { + if (this.Bounds.isAbsT) + _y = this.Bounds.T; + else + _y = (this.Bounds.T * _height / 1000); + + if (-1 != this.Bounds.AbsH) + _b = _y + this.Bounds.AbsH; + else + { + if (this.Bounds.isAbsB) + _b = (_height - this.Bounds.B); + else + _b = this.Bounds.B * _height / 1000; + } + } + else if (_g_anchor_bottom == ver_anchor) + { + if (this.Bounds.isAbsB) + _b = (_height - this.Bounds.B); + else + _b = (this.Bounds.B * _height / 1000); + + if (-1 != this.Bounds.AbsH) + _y = _b - this.Bounds.AbsH; + else + { + if (this.Bounds.isAbsT) + _y = this.Bounds.T; + else + _y = this.Bounds.T * _height / 1000; + } + } + else if ((_g_anchor_top | _g_anchor_bottom) == ver_anchor) + { + if (this.Bounds.isAbsT) + _y = this.Bounds.T; + else + _y = (this.Bounds.T * _height / 1000); + + if (this.Bounds.isAbsB) + _b = (_height - this.Bounds.B); + else + _b = (this.Bounds.B * _height / 1000); + } + else + { + _y = this.Bounds.T; + _b = this.Bounds.B; + } + + this.AbsolutePosition.L = _x; + this.AbsolutePosition.T = _y; + this.AbsolutePosition.R = _r; + this.AbsolutePosition.B = _b; + + this.HtmlElement.style.left = parseInt(_x * _g_dKoef_mm_to_pix + 0.5) + "px"; + this.HtmlElement.style.top = parseInt(_y * _g_dKoef_mm_to_pix + 0.5) + "px"; + this.HtmlElement.style.width = parseInt((_r - _x) * _g_dKoef_mm_to_pix + 0.5) + "px"; + this.HtmlElement.style.height = parseInt((_b - _y) * _g_dKoef_mm_to_pix + 0.5) + "px"; + + this.HtmlElement.width = parseInt((_r - _x) * _g_dKoef_mm_to_pix + 0.5); + this.HtmlElement.height = parseInt((_b - _y) * _g_dKoef_mm_to_pix + 0.5); + } + + +} + +function _CControlContainer() +{ + this.Bounds = new _CBounds(); + this.Anchor = _g_anchor_left | _g_anchor_top; + + this.Name = null; + this.Parent = null; + this.TabIndex = null; + + this.HtmlElement = null; + + this.AbsolutePosition = new _CBounds(); + + this.Controls = new Array(); + + this.AddControl = function(ctrl) + { + ctrl.Parent = this; + this.Controls[this.Controls.length] = ctrl; + } + + this.Resize = function(_width,_height) + { + if (null == this.Parent) + { + this.AbsolutePosition.L = 0; + this.AbsolutePosition.T = 0; + this.AbsolutePosition.R = _width; + this.AbsolutePosition.B = _height; + + if (null != this.HtmlElement) + { + var lCount = this.Controls.length; + for (var i = 0; i < lCount; i++) + { + this.Controls[i].Resize(_width,_height); + } + } + return; + } + + var _x = 0; + var _y = 0; + var _r = 0; + var _b = 0; + + var hor_anchor = (this.Anchor & 0x05); + var ver_anchor = (this.Anchor & 0x0A); + + if (_g_anchor_left == hor_anchor) + { + if (this.Bounds.isAbsL) + _x = this.Bounds.L; + else + _x = (this.Bounds.L * _width / 1000); + + if (-1 != this.Bounds.AbsW) + _r = _x + this.Bounds.AbsW; + else + { + if (this.Bounds.isAbsR) + _r = (_width - this.Bounds.R); + else + _r = this.Bounds.R * _width / 1000; + } + } + else if (_g_anchor_right == hor_anchor) + { + if (this.Bounds.isAbsR) + _r = (_width - this.Bounds.R); + else + _r = (this.Bounds.R * _width / 1000); + + if (-1 != this.Bounds.AbsW) + _x = _r - this.Bounds.AbsW; + else + { + if (this.Bounds.isAbsL) + _x = this.Bounds.L; + else + _x = this.Bounds.L * _width / 1000; + } + } + else if ((_g_anchor_left | _g_anchor_right) == hor_anchor) + { + if (this.Bounds.isAbsL) + _x = this.Bounds.L; + else + _x = (this.Bounds.L * _width / 1000); + + if (this.Bounds.isAbsR) + _r = (_width - this.Bounds.R); + else + _r = (this.Bounds.R * _width / 1000); + } + else + { + _x = this.Bounds.L; + _r = this.Bounds.R; + } + + if (_g_anchor_top == ver_anchor) + { + if (this.Bounds.isAbsT) + _y = this.Bounds.T; + else + _y = (this.Bounds.T * _height / 1000); + + if (-1 != this.Bounds.AbsH) + _b = _y + this.Bounds.AbsH; + else + { + if (this.Bounds.isAbsB) + _b = (_height - this.Bounds.B); + else + _b = this.Bounds.B * _height / 1000; + } + } + else if (_g_anchor_bottom == ver_anchor) + { + if (this.Bounds.isAbsB) + _b = (_height - this.Bounds.B); + else + _b = (this.Bounds.B * _height / 1000); + + if (-1 != this.Bounds.AbsH) + _y = _b - this.Bounds.AbsH; + else + { + if (this.Bounds.isAbsT) + _y = this.Bounds.T; + else + _y = this.Bounds.T * _height / 1000; + } + } + else if ((_g_anchor_top | _g_anchor_bottom) == ver_anchor) + { + if (this.Bounds.isAbsT) + _y = this.Bounds.T; + else + _y = (this.Bounds.T * _height / 1000); + + if (this.Bounds.isAbsB) + _b = (_height - this.Bounds.B); + else + _b = (this.Bounds.B * _height / 1000); + } + else + { + _y = this.Bounds.T; + _b = this.Bounds.B; + } + + this.AbsolutePosition.L = _x; + this.AbsolutePosition.T = _y; + this.AbsolutePosition.R = _r; + this.AbsolutePosition.B = _b; + + this.HtmlElement.style.left = parseInt(_x * _g_dKoef_mm_to_pix + 0.5) + "px"; + this.HtmlElement.style.top = parseInt(_y * _g_dKoef_mm_to_pix + 0.5) + "px"; + this.HtmlElement.style.width = parseInt((_r - _x) * _g_dKoef_mm_to_pix + 0.5) + "px"; + this.HtmlElement.style.height = parseInt((_b - _y) * _g_dKoef_mm_to_pix + 0.5) + "px"; + + var lCount = this.Controls.length; + for (var i = 0; i < lCount; i++) + { + this.Controls[i].Resize(_r - _x,_b - _y); + } + } +} + +function _CreateControlContainer(name) +{ + var ctrl = new _CControlContainer(); + ctrl.Name = name; + ctrl.HtmlElement = document.getElementById(name); + return ctrl; +} +function _CreateControl(name) +{ + var ctrl = new _CControl(); + ctrl.Name = name; + ctrl.HtmlElement = document.getElementById(name); + return ctrl; +} + +var StatusPanel = null; +var StatusPanel_statusText = null; +var StatusPanel_buttonZoomOut = null; +var StatusPanel_buttonZoomText = null; +var StatusPanel_buttonZoomIn = null; + +function InitStatus() +{ + window._button_eventHandlers = button_eventHandlers; + + StatusPanel = _CreateControlContainer("id_status"); + StatusPanel.Bounds.SetParams(0,0,1000,7,false,false,false,true,-1,6); + StatusPanel.Anchor = (g_anchor_left | g_anchor_right | g_anchor_bottom); + + StatusPanel_statusText = _CreateControl("id_status_text"); + StatusPanel_statusText.Bounds.SetParams(0,0,1000,1000,false,false,false,false,-1,-1); + StatusPanel_statusText.Anchor = (g_anchor_left | g_anchor_right | g_anchor_top | g_anchor_bottom); + StatusPanel.AddControl(StatusPanel_statusText); + + StatusPanel_buttonZoomOut = _CreateControl("id_buttonZoomOut"); + StatusPanel_buttonZoomOut.Bounds.SetParams(0,0,26,1000,false,false,true,false,5,5); + StatusPanel_buttonZoomOut.Anchor = (g_anchor_right | g_anchor_top); + StatusPanel.AddControl(StatusPanel_buttonZoomOut); + + StatusPanel_buttonZoomText = _CreateControl("id_TextZoomValue"); + StatusPanel_buttonZoomText.Bounds.SetParams(0,0,11,1000,false,false,true,false,15,5); + StatusPanel_buttonZoomText.Anchor = (g_anchor_right | g_anchor_top); + StatusPanel.AddControl(StatusPanel_buttonZoomText); + + StatusPanel_buttonZoomIn = _CreateControl("id_buttonZoomIn"); + StatusPanel_buttonZoomIn.Bounds.SetParams(0,0,6,1000,false,false,true,false,5,5); + StatusPanel_buttonZoomIn.Anchor = (g_anchor_right | g_anchor_top); + StatusPanel.AddControl(StatusPanel_buttonZoomIn); + + var button_ZoomOut = new window._button_eventHandlers("","0px 0px","0px -20px", "0px -40px",StatusPanel_buttonZoomOut,window.onButtonZoomOutClick); + var button_ZoomIn = new window._button_eventHandlers("","0px -60px","0px -80px", "0px -100px",StatusPanel_buttonZoomIn,window.onButtonZoomInClick); + + RegisterStatusBar(); +} + +window.onButtonZoomOutClick = function() +{ + editor.WordControl.zoom_Out(); +} + +window.onButtonZoomInClick = function() +{ + editor.WordControl.zoom_In(); +} + +function _checkBodyWidth() +{ + var w = 0; + if (window.innerWidth) + w = window.innerWidth; + else if (document.documentElement && document.documentElement.clientWidth) + w = document.documentElement.clientWidth; + else if (document.body) + w = document.body.clientWidth; + return w; +} +function _checkBodyHeight() +{ + var h = 0; + if (window.innerHeight) + h = window.innerHeight; + else if (document.documentElement && document.documentElement.clientHeight) + h = document.documentElement.clientHeight; + else if (document.body) + h = document.body.clientHeight; + return h; +} + +function ResizeStatus() +{ + var status_element = document.getElementById("id_status"); + + var _left = 0; + var _top = _checkBodyHeight() - 22; + if (window.__IScrollReInit != undefined) + _top -= 43; + var _width = _checkBodyWidth(); + var _height = 18; + + status_element.style.left = _left + "px"; + status_element.style.top = _top + "px"; + status_element.style.width = _width + "px"; + status_element.style.height = _height + "px"; + + StatusPanel.AbsolutePosition.L = _left * _g_dKoef_pix_to_mm; + StatusPanel.AbsolutePosition.T = _top * _g_dKoef_pix_to_mm; + StatusPanel.AbsolutePosition.R = (_left + _width) * _g_dKoef_pix_to_mm; + StatusPanel.AbsolutePosition.B = (_top + _height) * _g_dKoef_pix_to_mm; + + if (null != StatusPanel.HtmlElement) + { + var lCount = StatusPanel.Controls.length; + for (var i = 0; i < lCount; i++) + { + StatusPanel.Controls[i].Resize(_width * _g_dKoef_pix_to_mm, _height * _g_dKoef_pix_to_mm); + } + } +} + +var ___pages_count = 0; +var ___page_number = 0; + +function __status_set_zoom(zoom, type) +{ + StatusPanel_buttonZoomText.HtmlElement.innerHTML = zoom + "%"; +} +function __status_set_current_page(number) +{ + ___page_number = number; + StatusPanel_statusText.HtmlElement.innerHTML = " Page " + (___page_number + 1) + " of " + ___pages_count; +} +function __status_set_pagescount(count) +{ + ___pages_count = count; + StatusPanel_statusText.HtmlElement.innerHTML = " Page " + (___page_number + 1) + " of " + ___pages_count; +} +function __status_message(message) +{ + StatusPanel_statusText.HtmlElement.innerHTML = message; +} + +function RegisterStatusBar() +{ + editor.asc_registerCallback("asc_onZoomChange", __status_set_zoom); + editor.asc_registerCallback("asc_onCurrentPage", __status_set_current_page); + editor.asc_registerCallback("asc_onCountPages", __status_set_pagescount); + editor.asc_registerCallback("asc_onMessage", __status_message) +} \ No newline at end of file diff --git a/sdk/PowerPoint/menu/img/Border.png b/sdk/PowerPoint/menu/img/Border.png new file mode 100644 index 000000000..cd8848b21 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Border.png differ diff --git a/sdk/PowerPoint/menu/img/MainMenuBackground.png b/sdk/PowerPoint/menu/img/MainMenuBackground.png new file mode 100644 index 000000000..3f891fe1a Binary files /dev/null and b/sdk/PowerPoint/menu/img/MainMenuBackground.png differ diff --git a/sdk/PowerPoint/menu/img/MainMenu_TM.png b/sdk/PowerPoint/menu/img/MainMenu_TM.png new file mode 100644 index 000000000..4b11a1ef0 Binary files /dev/null and b/sdk/PowerPoint/menu/img/MainMenu_TM.png differ diff --git a/sdk/PowerPoint/menu/img/MarkerType.png b/sdk/PowerPoint/menu/img/MarkerType.png new file mode 100644 index 000000000..8bc70afca Binary files /dev/null and b/sdk/PowerPoint/menu/img/MarkerType.png differ diff --git a/sdk/PowerPoint/menu/img/MultiList.png b/sdk/PowerPoint/menu/img/MultiList.png new file mode 100644 index 000000000..a83948277 Binary files /dev/null and b/sdk/PowerPoint/menu/img/MultiList.png differ diff --git a/sdk/PowerPoint/menu/img/Props.PNG b/sdk/PowerPoint/menu/img/Props.PNG new file mode 100644 index 000000000..7d940b737 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Props.PNG differ diff --git a/sdk/PowerPoint/menu/img/SaveChanges.PNG b/sdk/PowerPoint/menu/img/SaveChanges.PNG new file mode 100644 index 000000000..3e569636f Binary files /dev/null and b/sdk/PowerPoint/menu/img/SaveChanges.PNG differ diff --git a/sdk/PowerPoint/menu/img/Table_ColA.png b/sdk/PowerPoint/menu/img/Table_ColA.png new file mode 100644 index 000000000..2ac8580aa Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_ColA.png differ diff --git a/sdk/PowerPoint/menu/img/Table_ColB.png b/sdk/PowerPoint/menu/img/Table_ColB.png new file mode 100644 index 000000000..69470b83c Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_ColB.png differ diff --git a/sdk/PowerPoint/menu/img/Table_ColD.png b/sdk/PowerPoint/menu/img/Table_ColD.png new file mode 100644 index 000000000..ca29c974e Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_ColD.png differ diff --git a/sdk/PowerPoint/menu/img/Table_Merge.png b/sdk/PowerPoint/menu/img/Table_Merge.png new file mode 100644 index 000000000..157802e04 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_Merge.png differ diff --git a/sdk/PowerPoint/menu/img/Table_MergeDisable.png b/sdk/PowerPoint/menu/img/Table_MergeDisable.png new file mode 100644 index 000000000..9c1c3f66f Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_MergeDisable.png differ diff --git a/sdk/PowerPoint/menu/img/Table_Remove.png b/sdk/PowerPoint/menu/img/Table_Remove.png new file mode 100644 index 000000000..0780623d9 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_Remove.png differ diff --git a/sdk/PowerPoint/menu/img/Table_RowA.png b/sdk/PowerPoint/menu/img/Table_RowA.png new file mode 100644 index 000000000..73771aeda Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_RowA.png differ diff --git a/sdk/PowerPoint/menu/img/Table_RowB.png b/sdk/PowerPoint/menu/img/Table_RowB.png new file mode 100644 index 000000000..7c9ed85b9 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_RowB.png differ diff --git a/sdk/PowerPoint/menu/img/Table_RowD.png b/sdk/PowerPoint/menu/img/Table_RowD.png new file mode 100644 index 000000000..5b5b8099f Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_RowD.png differ diff --git a/sdk/PowerPoint/menu/img/Table_SelectCell.png b/sdk/PowerPoint/menu/img/Table_SelectCell.png new file mode 100644 index 000000000..4730ed2c6 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_SelectCell.png differ diff --git a/sdk/PowerPoint/menu/img/Table_SelectCol.png b/sdk/PowerPoint/menu/img/Table_SelectCol.png new file mode 100644 index 000000000..a148621ee Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_SelectCol.png differ diff --git a/sdk/PowerPoint/menu/img/Table_SelectRow.png b/sdk/PowerPoint/menu/img/Table_SelectRow.png new file mode 100644 index 000000000..d12be768d Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_SelectRow.png differ diff --git a/sdk/PowerPoint/menu/img/Table_SelectTable.png b/sdk/PowerPoint/menu/img/Table_SelectTable.png new file mode 100644 index 000000000..061af04c2 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_SelectTable.png differ diff --git a/sdk/PowerPoint/menu/img/Table_Split.png b/sdk/PowerPoint/menu/img/Table_Split.png new file mode 100644 index 000000000..89f7f7e1b Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_Split.png differ diff --git a/sdk/PowerPoint/menu/img/Table_SplitDisable.png b/sdk/PowerPoint/menu/img/Table_SplitDisable.png new file mode 100644 index 000000000..971f0abf0 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Table_SplitDisable.png differ diff --git a/sdk/PowerPoint/menu/img/Untitled.png b/sdk/PowerPoint/menu/img/Untitled.png new file mode 100644 index 000000000..41532b1d7 Binary files /dev/null and b/sdk/PowerPoint/menu/img/Untitled.png differ diff --git a/sdk/PowerPoint/menu/img/button_bg.png b/sdk/PowerPoint/menu/img/button_bg.png new file mode 100644 index 000000000..d588830b3 Binary files /dev/null and b/sdk/PowerPoint/menu/img/button_bg.png differ diff --git a/sdk/PowerPoint/menu/img/button_inheader.png b/sdk/PowerPoint/menu/img/button_inheader.png new file mode 100644 index 000000000..26dca9212 Binary files /dev/null and b/sdk/PowerPoint/menu/img/button_inheader.png differ diff --git a/sdk/PowerPoint/menu/img/button_over_bg.png b/sdk/PowerPoint/menu/img/button_over_bg.png new file mode 100644 index 000000000..7a1c5eff0 Binary files /dev/null and b/sdk/PowerPoint/menu/img/button_over_bg.png differ diff --git a/sdk/PowerPoint/menu/img/colorSelectorHover.png b/sdk/PowerPoint/menu/img/colorSelectorHover.png new file mode 100644 index 000000000..7208cfd72 Binary files /dev/null and b/sdk/PowerPoint/menu/img/colorSelectorHover.png differ diff --git a/sdk/PowerPoint/menu/img/dimension-highlighted.png b/sdk/PowerPoint/menu/img/dimension-highlighted.png new file mode 100644 index 000000000..b63c2ea61 Binary files /dev/null and b/sdk/PowerPoint/menu/img/dimension-highlighted.png differ diff --git a/sdk/PowerPoint/menu/img/dimension-unhighlighted.png b/sdk/PowerPoint/menu/img/dimension-unhighlighted.png new file mode 100644 index 000000000..a23e6f3be Binary files /dev/null and b/sdk/PowerPoint/menu/img/dimension-unhighlighted.png differ diff --git a/sdk/PowerPoint/menu/img/drawing-16.png b/sdk/PowerPoint/menu/img/drawing-16.png new file mode 100644 index 000000000..63740bd3a Binary files /dev/null and b/sdk/PowerPoint/menu/img/drawing-16.png differ diff --git a/sdk/PowerPoint/menu/img/fill-16.png b/sdk/PowerPoint/menu/img/fill-16.png new file mode 100644 index 000000000..65086d642 Binary files /dev/null and b/sdk/PowerPoint/menu/img/fill-16.png differ diff --git a/sdk/PowerPoint/menu/img/list.png b/sdk/PowerPoint/menu/img/list.png new file mode 100644 index 000000000..5b12714db Binary files /dev/null and b/sdk/PowerPoint/menu/img/list.png differ diff --git a/sdk/PowerPoint/menu/img/marker.png b/sdk/PowerPoint/menu/img/marker.png new file mode 100644 index 000000000..adcc7ffb7 Binary files /dev/null and b/sdk/PowerPoint/menu/img/marker.png differ diff --git a/sdk/PowerPoint/menu/img/marker2.png b/sdk/PowerPoint/menu/img/marker2.png new file mode 100644 index 000000000..49079ca03 Binary files /dev/null and b/sdk/PowerPoint/menu/img/marker2.png differ diff --git a/sdk/PowerPoint/menu/img/markerSelectorHover.png b/sdk/PowerPoint/menu/img/markerSelectorHover.png new file mode 100644 index 000000000..c78741921 Binary files /dev/null and b/sdk/PowerPoint/menu/img/markerSelectorHover.png differ diff --git a/sdk/PowerPoint/menu/img/numberlist.png b/sdk/PowerPoint/menu/img/numberlist.png new file mode 100644 index 000000000..955ab6aea Binary files /dev/null and b/sdk/PowerPoint/menu/img/numberlist.png differ diff --git a/sdk/PowerPoint/menu/img/shadow.png b/sdk/PowerPoint/menu/img/shadow.png new file mode 100644 index 000000000..474aab2d0 Binary files /dev/null and b/sdk/PowerPoint/menu/img/shadow.png differ diff --git a/sdk/PowerPoint/menu/img/spacer.gif b/sdk/PowerPoint/menu/img/spacer.gif new file mode 100644 index 000000000..5bfd67a2d Binary files /dev/null and b/sdk/PowerPoint/menu/img/spacer.gif differ diff --git a/sdk/PowerPoint/menu/img/tmdocs_logo.png b/sdk/PowerPoint/menu/img/tmdocs_logo.png new file mode 100644 index 000000000..ce7c6b972 Binary files /dev/null and b/sdk/PowerPoint/menu/img/tmdocs_logo.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/sdk/PowerPoint/menu/jquery/images/ui-bg_diagonals-thick_18_b81900_40x40.png new file mode 100644 index 000000000..954e22dbd Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-bg_diagonals-thick_20_666666_40x40.png b/sdk/PowerPoint/menu/jquery/images/ui-bg_diagonals-thick_20_666666_40x40.png new file mode 100644 index 000000000..64ece5707 Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-bg_diagonals-thick_20_666666_40x40.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-icons_222222_256x240.png b/sdk/PowerPoint/menu/jquery/images/ui-icons_222222_256x240.png new file mode 100644 index 000000000..ee039dc09 Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-icons_222222_256x240.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-icons_228ef1_256x240.png b/sdk/PowerPoint/menu/jquery/images/ui-icons_228ef1_256x240.png new file mode 100644 index 000000000..10e3631dc Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-icons_228ef1_256x240.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-icons_ef8c08_256x240.png b/sdk/PowerPoint/menu/jquery/images/ui-icons_ef8c08_256x240.png new file mode 100644 index 000000000..35bb8efa9 Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-icons_ef8c08_256x240.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-icons_ffd27a_256x240.png b/sdk/PowerPoint/menu/jquery/images/ui-icons_ffd27a_256x240.png new file mode 100644 index 000000000..baebb63e3 Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-icons_ffd27a_256x240.png differ diff --git a/sdk/PowerPoint/menu/jquery/images/ui-icons_ffffff_256x240.png b/sdk/PowerPoint/menu/jquery/images/ui-icons_ffffff_256x240.png new file mode 100644 index 000000000..bef5178a9 Binary files /dev/null and b/sdk/PowerPoint/menu/jquery/images/ui-icons_ffffff_256x240.png differ diff --git a/sdk/PowerPoint/menu/js/images/blank.gif b/sdk/PowerPoint/menu/js/images/blank.gif new file mode 100644 index 000000000..75b945d25 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/blank.gif differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_background.png b/sdk/PowerPoint/menu/js/images/colorpicker_background.png new file mode 100644 index 000000000..8401572f1 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_background.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_hex.png b/sdk/PowerPoint/menu/js/images/colorpicker_hex.png new file mode 100644 index 000000000..4e532d7c6 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_hex.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_hsb_b.png b/sdk/PowerPoint/menu/js/images/colorpicker_hsb_b.png new file mode 100644 index 000000000..dfac595d0 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_hsb_b.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_hsb_h.png b/sdk/PowerPoint/menu/js/images/colorpicker_hsb_h.png new file mode 100644 index 000000000..3977ed9f2 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_hsb_h.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_hsb_s.png b/sdk/PowerPoint/menu/js/images/colorpicker_hsb_s.png new file mode 100644 index 000000000..a2a699736 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_hsb_s.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_indic.gif b/sdk/PowerPoint/menu/js/images/colorpicker_indic.gif new file mode 100644 index 000000000..f9fa95e28 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_indic.gif differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_overlay.png b/sdk/PowerPoint/menu/js/images/colorpicker_overlay.png new file mode 100644 index 000000000..561cdd9c5 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_overlay.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_rgb_b.png b/sdk/PowerPoint/menu/js/images/colorpicker_rgb_b.png new file mode 100644 index 000000000..dfac595d0 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_rgb_b.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_rgb_g.png b/sdk/PowerPoint/menu/js/images/colorpicker_rgb_g.png new file mode 100644 index 000000000..72b32760a Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_rgb_g.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_rgb_r.png b/sdk/PowerPoint/menu/js/images/colorpicker_rgb_r.png new file mode 100644 index 000000000..4855fe03f Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_rgb_r.png differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_select.gif b/sdk/PowerPoint/menu/js/images/colorpicker_select.gif new file mode 100644 index 000000000..599f7f13a Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_select.gif differ diff --git a/sdk/PowerPoint/menu/js/images/colorpicker_submit.png b/sdk/PowerPoint/menu/js/images/colorpicker_submit.png new file mode 100644 index 000000000..7f4c0825f Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/colorpicker_submit.png differ diff --git a/sdk/PowerPoint/menu/js/images/select.png b/sdk/PowerPoint/menu/js/images/select.png new file mode 100644 index 000000000..21213bfd5 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/select.png differ diff --git a/sdk/PowerPoint/menu/js/images/slider.png b/sdk/PowerPoint/menu/js/images/slider.png new file mode 100644 index 000000000..8b03da96e Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/slider.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/sdk/PowerPoint/menu/js/images/ui-bg_diagonals-thick_18_b81900_40x40.png new file mode 100644 index 000000000..954e22dbd Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_diagonals-thick_20_666666_40x40.png b/sdk/PowerPoint/menu/js/images/ui-bg_diagonals-thick_20_666666_40x40.png new file mode 100644 index 000000000..64ece5707 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_diagonals-thick_20_666666_40x40.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_flat_10_000000_40x100.png b/sdk/PowerPoint/menu/js/images/ui-bg_flat_10_000000_40x100.png new file mode 100644 index 000000000..abdc01082 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_flat_10_000000_40x100.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_glass_100_f6f6f6_1x400.png b/sdk/PowerPoint/menu/js/images/ui-bg_glass_100_f6f6f6_1x400.png new file mode 100644 index 000000000..9b383f4d2 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_glass_100_f6f6f6_1x400.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_glass_100_fdf5ce_1x400.png b/sdk/PowerPoint/menu/js/images/ui-bg_glass_100_fdf5ce_1x400.png new file mode 100644 index 000000000..a23baad25 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_glass_100_fdf5ce_1x400.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_glass_65_ffffff_1x400.png b/sdk/PowerPoint/menu/js/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 000000000..42ccba269 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/sdk/PowerPoint/menu/js/images/ui-bg_highlight-soft_100_eeeeee_1x100.png new file mode 100644 index 000000000..f1273672d Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_highlight-soft_100_eeeeee_1x100.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/sdk/PowerPoint/menu/js/images/ui-bg_highlight-soft_75_ffe45c_1x100.png new file mode 100644 index 000000000..359397acf Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-bg_highlight-soft_75_ffe45c_1x100.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-icons_222222_256x240.png b/sdk/PowerPoint/menu/js/images/ui-icons_222222_256x240.png new file mode 100644 index 000000000..ee039dc09 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-icons_222222_256x240.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-icons_228ef1_256x240.png b/sdk/PowerPoint/menu/js/images/ui-icons_228ef1_256x240.png new file mode 100644 index 000000000..10e3631dc Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-icons_228ef1_256x240.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-icons_ef8c08_256x240.png b/sdk/PowerPoint/menu/js/images/ui-icons_ef8c08_256x240.png new file mode 100644 index 000000000..35bb8efa9 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-icons_ef8c08_256x240.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-icons_ffd27a_256x240.png b/sdk/PowerPoint/menu/js/images/ui-icons_ffd27a_256x240.png new file mode 100644 index 000000000..baebb63e3 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-icons_ffd27a_256x240.png differ diff --git a/sdk/PowerPoint/menu/js/images/ui-icons_ffffff_256x240.png b/sdk/PowerPoint/menu/js/images/ui-icons_ffffff_256x240.png new file mode 100644 index 000000000..bef5178a9 Binary files /dev/null and b/sdk/PowerPoint/menu/js/images/ui-icons_ffffff_256x240.png differ diff --git a/sdk/PowerPoint/menu/js/jquery-1.6.1.min.js b/sdk/PowerPoint/menu/js/jquery-1.6.1.min.js new file mode 100644 index 000000000..b2ac1747f --- /dev/null +++ b/sdk/PowerPoint/menu/js/jquery-1.6.1.min.js @@ -0,0 +1,18 @@ +/*! + * jQuery JavaScript Library v1.6.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu May 12 15:04:36 2011 -0400 + */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!cj[a]){var b=f("<"+a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),c.body.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write("");b=cl.createElement(a),cl.body.appendChild(b),d=f.css(b,"display"),c.body.removeChild(ck)}cj[a]=d}return cj[a]}function cu(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function ct(){cq=b}function cs(){setTimeout(ct,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g=0===c})}function W(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function O(a,b){return(a&&a!=="*"?a+".":"")+b.replace(A,"`").replace(B,"&")}function N(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;ic)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function L(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function F(){return!0}function E(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function H(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(H,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=d.userAgent,x,y,z,A=Object.prototype.toString,B=Object.prototype.hasOwnProperty,C=Array.prototype.push,D=Array.prototype.slice,E=String.prototype.trim,F=Array.prototype.indexOf,G={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return D.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?C.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(D.apply(this,arguments),"slice",D.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:C,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;y.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!y){y=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",z,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",z),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&H()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):G[A.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!B.call(a,"constructor")&&!B.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||B.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c
a",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};f=c.createElement("select"),g=f.appendChild(c.createElement("option")),h=a.getElementsByTagName("input")[0],j={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},h.checked=!0,j.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,j.optDisabled=!g.disabled;try{delete a.test}catch(s){j.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function b(){j.noCloneEvent=!1,a.detachEvent("onclick",b)}),a.cloneNode(!0).fireEvent("onclick")),h=c.createElement("input"),h.value="t",h.setAttribute("type","radio"),j.radioValue=h.value==="t",h.setAttribute("checked","checked"),a.appendChild(h),k=c.createDocumentFragment(),k.appendChild(a.firstChild),j.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",l=c.createElement("body"),m={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(q in m)l.style[q]=m[q];l.appendChild(a),b.insertBefore(l,b.firstChild),j.appendChecked=h.checked,j.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,j.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="
",j.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="
t
",n=a.getElementsByTagName("td"),r=n[0].offsetHeight===0,n[0].style.display="",n[1].style.display="none",j.reliableHiddenOffsets=r&&n[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(i=c.createElement("div"),i.style.width="0",i.style.marginRight="0",a.appendChild(i),j.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(i,null)||{marginRight:0}).marginRight,10)||0)===0),l.innerHTML="",b.removeChild(l);if(a.attachEvent)for(q in{submit:1,change:1,focusin:1})p="on"+q,r=p in a,r||(a.setAttribute(p,"return;"),r=typeof a[p]=="function"),j[q+"Bubbles"]=r;return j}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;return(e.value||"").replace(p,"")}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);c=j&&f.attrFix[c]||c,i=f.attrHooks[c],i||(!t.test(c)||typeof d!="boolean"&&d!==b&&d.toLowerCase()!==c.toLowerCase()?v&&(f.nodeName(a,"form")||u.test(c))&&(i=v):i=w);if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j)return i.get(a,c);h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);c=i&&f.propFix[c]||c,h=f.propHooks[c];return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return a[f.propFix[c]||c]?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=b),a.setAttribute(c,c.toLowerCase()));return c}},f.attrHooks.value={get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return a.value},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=Object.prototype.hasOwnProperty,y=/\.(.*)$/,z=/^(?:textarea|input|select)$/i,A=/\./g,B=/ /g,C=/[^\w\s.|`]/g,D=function(a){return a.replace(C,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=E;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=E);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),D).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem +)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},K=function(c){var d=c.target,e,g;if(!!z.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=J(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:K,beforedeactivate:K,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&K.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&K.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",J(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in I)f.event.add(this,c+".specialChange",I[c]);return z.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return z.test(this.nodeName)}},I=f.event.special.change.filters,I.focus=I.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(h=g;h0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=U.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(W(c[0])||W(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=T.call(arguments);P.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!V[a]?f.unique(e):e,(this.length>1||R.test(d))&&Q.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var Y=/ jQuery\d+="(?:\d+|null)"/g,Z=/^\s+/,$=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,_=/<([\w:]+)/,ba=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]};bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div
","
"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Y,""):null;if(typeof a=="string"&&!bc.test(a)&&(f.support.leadingWhitespace||!Z.test(a))&&!bg[(_.exec(a)||["",""])[1].toLowerCase()]){a=a.replace($,"<$1>");try{for(var c=0,d=this.length;c1&&l0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bj(a,d),e=bk(a),g=bk(d);for(h=0;e[h];++h)bj(e[h],g[h])}if(b){bi(a,d);if(c){e=bk(a),g=bk(d);for(h=0;e[h];++h)bi(e[h],g[h])}}return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument|| +b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!bb.test(k))k=b.createTextNode(k);else{k=k.replace($,"<$1>");var l=(_.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=ba.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]===""&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Z.test(k)&&o.insertBefore(b.createTextNode(Z.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bp.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bo.test(g)?g.replace(bo,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,c){var d,e,g;c=c.replace(br,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bs.test(d)&&bt.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bE=/%20/g,bF=/\[\]$/,bG=/\r?\n/g,bH=/#.*$/,bI=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bJ=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bL=/^(?:GET|HEAD)$/,bM=/^\/\//,bN=/\?/,bO=/)<[^<]*)*<\/script>/gi,bP=/^(?:select|textarea)/i,bQ=/\s+/,bR=/([?&])_=[^&]*/,bS=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bT=f.fn.load,bU={},bV={},bW,bX;try{bW=e.href}catch(bY){bW=c.createElement("a"),bW.href="",bW=bW.href}bX=bS.exec(bW.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bT)return bT.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("
").append(c.replace(bO,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bP.test(this.nodeName)||bJ.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bG,"\r\n")}}):{name:b.name,value:c.replace(bG,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bW,isLocal:bK.test(bX[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bZ(bU),ajaxTransport:bZ(bV),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?ca(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=cb(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bI.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bH,"").replace(bM,bX[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bQ),d.crossDomain==null&&(r=bS.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bX[1]&&r[2]==bX[2]&&(r[3]||(r[1]==="http:"?80:443))==(bX[3]||(bX[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bU,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bL.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bN.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bR,"$1_="+x);d.url=y+(y===d.url?(bN.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bV,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bE,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq,cr=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b
";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){return this[0]?parseFloat(f.css(this[0],d,"padding")):null},f.fn["outer"+c]=function(a){return this[0]?parseFloat(f.css(this[0],d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); \ No newline at end of file diff --git a/sdk/PowerPoint/menu/js/jquery-ui-1.8.13.custom.min.js b/sdk/PowerPoint/menu/js/jquery-ui-1.8.13.custom.min.js new file mode 100644 index 000000000..c5bf1d246 --- /dev/null +++ b/sdk/PowerPoint/menu/js/jquery-ui-1.8.13.custom.min.js @@ -0,0 +1,784 @@ +/*! + * jQuery UI 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.13", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); +b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, +"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", +function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, +outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); +return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= +0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= +this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a); +this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b= +d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop", +a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a= +{left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&& +d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a= +this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions= +{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+ +d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!="hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"), +10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height- +this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&& +d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1];h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left< +g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging"); +this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.13"}); +d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver= +0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs= +c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a, +true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver= +0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor= +a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable"); +if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing= +false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height); +c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size, +d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidthb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width= +a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b= +this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left- +c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this, +arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement, +element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.13"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})}; +if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"), +p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options, +c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName), +g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"), +10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0, +top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h; +g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left: +0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position")); +if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&& +!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost== +"string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid; +var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b, +10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.13", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("");d.secondary&&b.append("");if(!this.options.text){e.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= +1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.13",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j"); +this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? +(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- +m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= +this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= +this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); +c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); +if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.13"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.13"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.delegate("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a", +"mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).delegate("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a","mouseover",function(){if(!d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); +d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==B)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.13"}});var z=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)}, +_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a, +b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker); +if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]); +return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a); +if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d(''); +this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/ +2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a, +"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled= +false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled= +true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false; +for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); +d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal= +null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos= +null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0], +top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover"); +c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"); +a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]}, +_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e- +g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst= +null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): +0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear= +false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay= +d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a); +else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b= +a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort, +g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!= +c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames, +h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear|| +a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? +new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); +n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m, +g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+r+"":f?"":''+r+"";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&& +a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&&x==0?c? +f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
    ';var D=j?'":"";for(t=0;t<7;t++){var q=(t+h)%7;D+="=5?' class="ui-datepicker-week-end"':"")+'>'+s[q]+""}y+=D+"";D=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, +D);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;D=l?6:Math.ceil((t+D)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],F=q.getMonth()!=g,L=F&&!K||!I[0]||k&&qo;R+='";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(q)+""+(F&&!C?" ":L?''+q.getDate()+ +"":''+q.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'': +"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)? +r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+= +(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a, +"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a, +b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!= +"string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay)); +return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&& +arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.13";window["DP_jQuery_"+z]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.13"})})(jQuery); +;/* + * jQuery UI Effects 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easding:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.13",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); +c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, +a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); +a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", +"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* +((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= +e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= +e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.13 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff --git a/sdk/PowerPoint/menu/js/jquery-ui.css b/sdk/PowerPoint/menu/js/jquery-ui.css new file mode 100644 index 000000000..ab0c31e24 --- /dev/null +++ b/sdk/PowerPoint/menu/js/jquery-ui.css @@ -0,0 +1,406 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + + +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; } +.ui-widget-content a { color: #333333; } +.ui-widget-header { border: 1px solid #6688EE; background: #BBCCFF 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; outline: none; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; outline: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; outline: none; } +.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; outline: none; } +.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; outline: none; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; outline: none; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #ffffff; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; } +.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; } +.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; } +.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; } +.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; } +.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; } +.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; }/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; } +.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; } +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* Dialog +----------------------------------*/ +.ui-dialog { position: relative; padding: .2em; width: 300px; } +.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; } +.ui-resizable-s { cursor: s-resize; height: 12px; width: 100%; bottom: -5px; left: 0px; } +.ui-resizable-e { cursor: e-resize; width: 15px; right: -5px; top: 0px; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs +----------------------------------*/ +.ui-tabs { padding: .2em; zoom: 1; } +.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; } +.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/sdk/PowerPoint/menu/js/jquery.clickmenu.js b/sdk/PowerPoint/menu/js/jquery.clickmenu.js new file mode 100644 index 000000000..cca5bc076 --- /dev/null +++ b/sdk/PowerPoint/menu/js/jquery.clickmenu.js @@ -0,0 +1,530 @@ +/* clickMenu - v0.1.6 + * Copyright (c) 2007 Roman Weich + * http://p.sohei.org + * + * Changelog: + * v 0.1.6 - 2007-09-06 + * -fix: having a link in the top-level menu would not open the menu but call the link instead + * v 0.1.5 - 2007-07-07 + * -change/fix: menu opening/closing now through simple show() and hide() calls - before fadeIn and fadeOut were used for which extra functions to stop a already running animation were created -> they were + * buggy (not working with the interface plugin in jquery1.1.2 and not working with jquery1.1.3 at all) and now removed + * -change: removed option: fadeTime + * -change: now using the bgiframe plugin for adding iframes in ie6 when available + * v 0.1.4 - 2007-03-20 + * -fix: the default options were overwritten by the context related options + * -fix: hiding a submenu all hover- and click-events were unbound, even the ones not defined in this plugin - unbinding should work now + * v 0.1.3 - 2007-03-13 + * -fix: some display problems ie had when no width was set on the submenu, so on ie the width for each submenu will be explicitely set + * -fix: the fix to the ie-width-problem is a fix to the "ie does not support css min-width stuff" problem too which displayed some submenus too narrow (it looked just not right) + * -fix: some bugs, when user the was too fast with the mouse + * v 0.1.2 - 2007-03-11 + * -change: made a lot changes in the traversing routines to speed things up (having better memory usage now as well) + * -change: added $.fn.clickMenu.setDefaults() for setting global defaults + * -fix: hoverbug when a main menu item had no submenu + * -fix: some bugs i found while rewriting most of the stuff + * v 0.1.1 - 2007-03-04 + * -change: the width of the submenus is no longer fixed, its set in the plugin now + * -change: the submenu-arrow is now an img, not the background-img of the list element - that allows better positioning, and background-changes on hover (you have to set the image through the arrowSrc option) + * -fix: clicking on a clickMenu while another was already open, didn't close the open one + * -change: clicking on the open main menu item will close it + * -fix: on an open menu moving the mouse to a main menu item and moving it fastly elsewere hid the whole menu + * v 0.1.0 - 2007-03-03 + */ + +(function($) +{ + var defaults = { + onClick: function(){ + $(this).find('>a').each(function(){ + if ( this.href ) + { + window.location = this.href; + } + }); + }, + arrowSrc: '', + subDelay: 300, + mainDelay: 10 + }; + + $.fn.clickMenu = function(options) + { + var shown = false; + var liOffset = ( ($.browser.msie) ? 4 : 2 ); + + var settings = $.extend({}, defaults, options); + + var hideDIV = function(div, delay) + { + //a timer running to show the div? + if ( div.timer && !div.isVisible ) + { + clearTimeout(div.timer); + } + else if (div.timer) + { + return; //hide-timer already running + } + if ( div.isVisible ) + { + div.timer = setTimeout(function() + { + //remove events + $(getAllChilds(getOneChild(div, 'UL'), 'LI')).unbind('mouseover', liHoverIn).unbind('mouseout', liHoverOut).unbind('click', settings.onClick); + //hide it + $(div).hide(); + div.isVisible = false; + div.timer = null; + }, delay); + } + }; + + var showDIV = function(div, delay) + { + if ( div.timer ) + { + clearTimeout(div.timer); + } + if ( !div.isVisible ) + { + div.timer = setTimeout(function() + { + //check if the mouse is still over the parent item - if not dont show the submenu + if ( !checkClass(div.parentNode, 'hover') ) + { + return; + } + //assign events to all div>ul>li-elements + $(getAllChilds(getOneChild(div, 'UL'), 'LI')).mouseover(liHoverIn).mouseout(liHoverOut).click(settings.onClick); + //positioning + if ( !checkClass(div.parentNode, 'main') ) + { + $(div).css('left', div.parentNode.offsetWidth - liOffset); + } + //show it + div.isVisible = true; //we use this over :visible to speed up traversing + $(div).show(); + _valtmp = $(div).parent().children('span').text(); + $(div).children('ul').children().each(function(){ + if ( $(this).text() == _valtmp ) + {$(this).addClass('hover');return;} + }) + + if ( $.browser.msie ) //fixing a display-bug in ie6 and adding min-width + { + var cW = $(getOneChild(div, 'UL')).width(); + if ( cW < 100 ) + { + cW = 100; + } + $(div).css('width', cW); + } + div.timer = null; + // $(div.parentNode).removeClass("mousehover"); + // $(this).addClass("mouseclick") + }, delay); + } + }; + + //same as hover.handlehover in jquery - just can't use hover() directly - need the ability to unbind only the one hover event + var testHandleHover = function(e) + { + // Check if mouse(over|out) are still within the same parent element + var p = (e.type == "mouseover" ? e.fromElement : e.toElement) || e.relatedTarget; + // Traverse up the tree + while ( p && p != this ) + { + try + { + p = p.parentNode; + } + catch(e) + { + p = this; + } + } + // If we actually just moused on to a sub-element, ignore it + if ( p == this ) + { + return false; + } + return true; + }; + + var mainHoverIn = function(e) + { + //no need to test e.target==this, as no child has the same event binded + //its possible, that a main menu item still has hover (if it has no submenu) - thus remove it + var lis = getAllChilds(this.parentNode, 'LI'); + var pattern = new RegExp("(^|\\s)hover(\\s|$)"); + for (var i = 0; i < lis.length; i++) + { + if ( pattern.test(lis[i].className) ) + { + $(lis[i]).removeClass('hover'); + } + } + $(this).addClass('hover'); + if ( shown ) + { + hoverIn(this, settings.mainDelay); + } + }; + + var liHoverIn = function(e) + { + if ( !testHandleHover(e) ) + { + return false; + } + if ( e.target != this ) + { + //look whether the target is a direct child of this (maybe an image) + if ( !isChild(this, e.target) ) + { + return; + } + } + hoverIn(this, settings.subDelay); + }; + + var hoverIn = function(li, delay) + { + var innerDiv = getOneChild(li, 'DIV'); + //stop running timers from the other menus on the same level - a little faster than $('>*>div', li.parentNode) + var n = li.parentNode.firstChild; + for ( ; n; n = n.nextSibling ) + { + if ( n.nodeType == 1 && n.nodeName.toUpperCase() == 'LI' ) + { + var div = getOneChild(n, 'DIV'); + if ( div && div.timer && !div.isVisible ) //clear show-div timer + { + clearTimeout(div.timer); + div.timer = null; + } + } + } + //is there a timer running to hide one of the parent divs? stop it + var pNode = li.parentNode; + for ( ; pNode; pNode = pNode.parentNode ) + { + if ( pNode.nodeType == 1 && pNode.nodeName.toUpperCase() == 'DIV' ) + { + if (pNode.timer) + { + clearTimeout(pNode.timer); + pNode.timer = null; + $(pNode.parentNode).addClass('hover'); + } + } + } + //highlight the current element + if ($('li.hover').hasClass('textSelect')) $('li.hover').removeClass('hover'); + $(li).addClass('hover'); + //is the submenu already visible? + if ( innerDiv && innerDiv.isVisible ) + { + //hide-timer running? + if ( innerDiv.timer ) + { + clearTimeout(innerDiv.timer); + innerDiv.timer = null; + } + else + { + return; + } + } + //hide all open menus on the same level and below and unhighlight the li item (but not the current submenu!) + $(li.parentNode.getElementsByTagName('DIV')).each(function(){ + if ( this != innerDiv && this.isVisible ) + { + hideDIV(this, delay); + $(this.parentNode).removeClass('hover'); + } + }); + //show the submenu, if there is one + if ( innerDiv ) + { + showDIV(innerDiv, delay); + } + }; + + var liHoverOut = function(e) + { + if ( !testHandleHover(e) ) + { + return false; + } + if ( e.target != this ) + { + if ( !isChild(this, e.target) ) //return only if the target is no direct child of this + { + return; + } + } + //remove the hover from the submenu item, if the mouse is hovering out of the menu (this is only for the last open (levelwise) (sub-)menu) + var div = getOneChild(this, 'DIV'); + if ( !div ) + { + $(this).removeClass('hover'); + } + else + { + if ( !div.isVisible ) + { + $(this).removeClass('hover'); + } + } + }; + + var mainHoverOut = function(e) + { + //no need to test e.target==this, as no child has the same event binded + //remove hover + var div = getOneChild(this, 'DIV'); + var relTarget = e.relatedTarget || e.toElement; //this is undefined sometimes (e.g. when the mouse moves out of the window), so dont remove hover then + var p; + if ( !shown ) + { + $(this).removeClass('hover'); + } + else if ( !div && relTarget ) //menuitem has no submenu, so dont remove the hover if the mouse goes outside the menu + { + p = findParentWithClass(e.target, 'UL', 'clickMenu'); + if ( p.contains(relTarget)) + { + $(this).removeClass('hover'); + } + } + else if ( relTarget ) + { + //remove hover only when moving to anywhere inside the clickmenu + p = findParentWithClass(e.target, 'UL', 'clickMenu'); + if ( !div.isVisible && (p.contains(relTarget)) ) + { + $(this).removeClass('hover'); + } + } + }; + + var mainClick = function() + { + var div = getOneChild(this, 'DIV'); + if ( div && div.isVisible ) //clicked on an open main-menu-item + { + clean(); + if (undefined != focusEditor) + focusEditor(); + $(this).addClass('hover'); + // $("#mainmenu .item2").removeClass("item2").addClass("item"); + } + else + { + hoverIn(this, settings.mainDelay); + shown = true; + $(document).bind('mousedown', checkMouse); + // if ( this.id != "fontSizeSelect" && this.id != "fontSelect" && this.id != "fontFormat") + // $("#mainmenu .item").removeClass("item").addClass("item2"); + } + return false; + }; + + var checkMouse = function(e) + { + //is the mouse inside a clickmenu? if yes, is it an open (the current) one? + var vis = false; + var cm = findParentWithClass(e.target, 'UL', 'clickMenu'); + if ( cm ) + { + $(cm.getElementsByTagName('DIV')).each(function(){ + if ( this.isVisible ) + { + vis = true; + } + }); + } + if ( !vis ) + { + clean(); + } + }; + + var clean = function() + { + //remove timeout and hide the divs + $('ul.clickMenu div.outerbox').each(function(){ + if ( this.timer ) + { + clearTimeout(this.timer); + this.timer = null; + } + if ( this.isVisible ) + { + $(this).hide(); + this.isVisible = false; + } + }); + $('ul.clickMenu li').removeClass('hover'); + //remove events + $('ul.clickMenu>li li').unbind('mouseover', liHoverIn).unbind('mouseout', liHoverOut).unbind('click', settings.onClick); + $(document).unbind('mousedown', checkMouse); + // $("#mainmenu .item2").removeClass("item2").addClass("item"); + shown = false; + }; + + var getOneChild = function(elem, name) + { + if ( !elem ) + { + return null; + } + var n = elem.firstChild; + for ( ; n; n = n.nextSibling ) + { + if ( n.nodeType == 1 && n.nodeName.toUpperCase() == name ) + { + return n; + } + } + return null; + }; + + var getAllChilds = function(elem, name) + { + if ( !elem ) + { + return []; + } + var r = []; + var n = elem.firstChild; + for ( ; n; n = n.nextSibling ) + { + if ( n.nodeType == 1 && n.nodeName.toUpperCase() == name ) + { + r[r.length] = n; + } + } + return r; + }; + + var findParentWithClass = function(elem, searchTag, searchClass) + { + var pNode = elem.parentNode; + var pattern = new RegExp("(^|\\s)" + searchClass + "(\\s|$)"); + for ( ; pNode; pNode = pNode.parentNode ) + { + if ( pNode.nodeType == 1 && pNode.nodeName.toUpperCase() == searchTag && pattern.test(pNode.className) ) + { + return pNode; + } + } + return null; + }; + + var checkClass = function(elem, searchClass) + { + var pattern = new RegExp("(^|\\s)" + searchClass + "(\\s|$)"); + if ( pattern.test(elem.className) ) + { + return true; + } + return false; + }; + + var isChild = function(elem, childElem) + { + var n = elem.firstChild; + for ( ; n; n = n.nextSibling ) + { + if ( n == childElem ) + { + return true; + } + } + return false; + }; + + return this.each(function() + { + //add .contains() to mozilla - http://www.quirksmode.org/blog/archives/2006/01/contains_for_mo.html + if (window.Node && Node.prototype && !Node.prototype.contains) + { + Node.prototype.contains = function(arg) + { + return !!(this.compareDocumentPosition(arg) & 16); + }; + } + //add class + if ( !checkClass(this, 'clickMenu') ) + { + $(this).addClass('clickMenu'); + } + //add shadows + $('ul', this).shadowBox(); + //ie6? - add iframes + if ( $.browser.msie && (!$.browser.version || parseInt($.browser.version) <= 6) ) + { + if ( $.fn.bgiframe ) + { + $('div.outerbox', this).bgiframe(); + } + else + { + /* thanks to Mark Gibson - http://www.nabble.com/forum/ViewPost.jtp?post=6504414&framed=y */ + $('div.outerbox', this).append('